Updated

Scripts/reporter_lib/py38+/urllib3/__init__.py

@@ -0,0 +1,211 @@
+"""
+Python HTTP library with thread-safe connection pooling, file post support, user friendly, and more
+"""
+
+from __future__ import annotations
+
+# Set default logging handler to avoid "No handler found" warnings.
+import logging
+import sys
+import typing
+import warnings
+from logging import NullHandler
+
+from . import exceptions
+from ._base_connection import _TYPE_BODY
+from ._collections import HTTPHeaderDict
+from ._version import __version__
+from .connectionpool import HTTPConnectionPool, HTTPSConnectionPool, connection_from_url
+from .filepost import _TYPE_FIELDS, encode_multipart_formdata
+from .poolmanager import PoolManager, ProxyManager, proxy_from_url
+from .response import BaseHTTPResponse, HTTPResponse
+from .util.request import make_headers
+from .util.retry import Retry
+from .util.timeout import Timeout
+
+# Ensure that Python is compiled with OpenSSL 1.1.1+
+# If the 'ssl' module isn't available at all that's
+# fine, we only care if the module is available.
+try:
+    import ssl
+except ImportError:
+    pass
+else:
+    if not ssl.OPENSSL_VERSION.startswith("OpenSSL "):  # Defensive:
+        warnings.warn(
+            "urllib3 v2 only supports OpenSSL 1.1.1+, currently "
+            f"the 'ssl' module is compiled with {ssl.OPENSSL_VERSION!r}. "
+            "See: https://github.com/urllib3/urllib3/issues/3020",
+            exceptions.NotOpenSSLWarning,
+        )
+    elif ssl.OPENSSL_VERSION_INFO < (1, 1, 1):  # Defensive:
+        raise ImportError(
+            "urllib3 v2 only supports OpenSSL 1.1.1+, currently "
+            f"the 'ssl' module is compiled with {ssl.OPENSSL_VERSION!r}. "
+            "See: https://github.com/urllib3/urllib3/issues/2168"
+        )
+
+__author__ = "Andrey Petrov (andrey.petrov@shazow.net)"
+__license__ = "MIT"
+__version__ = __version__
+
+__all__ = (
+    "HTTPConnectionPool",
+    "HTTPHeaderDict",
+    "HTTPSConnectionPool",
+    "PoolManager",
+    "ProxyManager",
+    "HTTPResponse",
+    "Retry",
+    "Timeout",
+    "add_stderr_logger",
+    "connection_from_url",
+    "disable_warnings",
+    "encode_multipart_formdata",
+    "make_headers",
+    "proxy_from_url",
+    "request",
+    "BaseHTTPResponse",
+)
+
+logging.getLogger(__name__).addHandler(NullHandler())
+
+
+def add_stderr_logger(
+    level: int = logging.DEBUG,
+) -> logging.StreamHandler[typing.TextIO]:
+    """
+    Helper for quickly adding a StreamHandler to the logger. Useful for
+    debugging.
+
+    Returns the handler after adding it.
+    """
+    # This method needs to be in this __init__.py to get the __name__ correct
+    # even if urllib3 is vendored within another package.
+    logger = logging.getLogger(__name__)
+    handler = logging.StreamHandler()
+    handler.setFormatter(logging.Formatter("%(asctime)s %(levelname)s %(message)s"))
+    logger.addHandler(handler)
+    logger.setLevel(level)
+    logger.debug("Added a stderr logging handler to logger: %s", __name__)
+    return handler
+
+
+# ... Clean up.
+del NullHandler
+
+
+# All warning filters *must* be appended unless you're really certain that they
+# shouldn't be: otherwise, it's very hard for users to use most Python
+# mechanisms to silence them.
+# SecurityWarning's always go off by default.
+warnings.simplefilter("always", exceptions.SecurityWarning, append=True)
+# InsecurePlatformWarning's don't vary between requests, so we keep it default.
+warnings.simplefilter("default", exceptions.InsecurePlatformWarning, append=True)
+
+
+def disable_warnings(category: type[Warning] = exceptions.HTTPWarning) -> None:
+    """
+    Helper for quickly disabling all urllib3 warnings.
+    """
+    warnings.simplefilter("ignore", category)
+
+
+_DEFAULT_POOL = PoolManager()
+
+
+def request(
+    method: str,
+    url: str,
+    *,
+    body: _TYPE_BODY | None = None,
+    fields: _TYPE_FIELDS | None = None,
+    headers: typing.Mapping[str, str] | None = None,
+    preload_content: bool | None = True,
+    decode_content: bool | None = True,
+    redirect: bool | None = True,
+    retries: Retry | bool | int | None = None,
+    timeout: Timeout | float | int | None = 3,
+    json: typing.Any | None = None,
+) -> BaseHTTPResponse:
+    """
+    A convenience, top-level request method. It uses a module-global ``PoolManager`` instance.
+    Therefore, its side effects could be shared across dependencies relying on it.
+    To avoid side effects create a new ``PoolManager`` instance and use it instead.
+    The method does not accept low-level ``**urlopen_kw`` keyword arguments.
+
+    :param method:
+        HTTP request method (such as GET, POST, PUT, etc.)
+
+    :param url:
+        The URL to perform the request on.
+
+    :param body:
+        Data to send in the request body, either :class:`str`, :class:`bytes`,
+        an iterable of :class:`str`/:class:`bytes`, or a file-like object.
+
+    :param fields:
+        Data to encode and send in the request body.
+
+    :param headers:
+        Dictionary of custom headers to send, such as User-Agent,
+        If-None-Match, etc.
+
+    :param bool preload_content:
+        If True, the response's body will be preloaded into memory.
+
+    :param bool decode_content:
+        If True, will attempt to decode the body based on the
+        'content-encoding' header.
+
+    :param redirect:
+        If True, automatically handle redirects (status codes 301, 302,
+        303, 307, 308). Each redirect counts as a retry. Disabling retries
+        will disable redirect, too.
+
+    :param retries:
+        Configure the number of retries to allow before raising a
+        :class:`~urllib3.exceptions.MaxRetryError` exception.
+
+        If ``None`` (default) will retry 3 times, see ``Retry.DEFAULT``. Pass a
+        :class:`~urllib3.util.retry.Retry` object for fine-grained control
+        over different types of retries.
+        Pass an integer number to retry connection errors that many times,
+        but no other types of errors. Pass zero to never retry.
+
+        If ``False``, then retries are disabled and any exception is raised
+        immediately. Also, instead of raising a MaxRetryError on redirects,
+        the redirect response will be returned.
+
+    :type retries: :class:`~urllib3.util.retry.Retry`, False, or an int.
+
+    :param timeout:
+        If specified, overrides the default timeout for this one
+        request. It may be a float (in seconds) or an instance of
+        :class:`urllib3.util.Timeout`.
+
+    :param json:
+        Data to encode and send as JSON with UTF-encoded in the request body.
+        The ``"Content-Type"`` header will be set to ``"application/json"``
+        unless specified otherwise.
+    """
+
+    return _DEFAULT_POOL.request(
+        method,
+        url,
+        body=body,
+        fields=fields,
+        headers=headers,
+        preload_content=preload_content,
+        decode_content=decode_content,
+        redirect=redirect,
+        retries=retries,
+        timeout=timeout,
+        json=json,
+    )
+
+
+if sys.platform == "emscripten":
+    from .contrib.emscripten import inject_into_urllib3  # noqa: 401
+
+    inject_into_urllib3()

Scripts/reporter_lib/py38+/urllib3/_base_connection.py

@@ -0,0 +1,165 @@
+from __future__ import annotations
+
+import typing
+
+from .util.connection import _TYPE_SOCKET_OPTIONS
+from .util.timeout import _DEFAULT_TIMEOUT, _TYPE_TIMEOUT
+from .util.url import Url
+
+_TYPE_BODY = typing.Union[bytes, typing.IO[typing.Any], typing.Iterable[bytes], str]
+
+
+class ProxyConfig(typing.NamedTuple):
+    ssl_context: ssl.SSLContext | None
+    use_forwarding_for_https: bool
+    assert_hostname: None | str | typing.Literal[False]
+    assert_fingerprint: str | None
+
+
+class _ResponseOptions(typing.NamedTuple):
+    # TODO: Remove this in favor of a better
+    # HTTP request/response lifecycle tracking.
+    request_method: str
+    request_url: str
+    preload_content: bool
+    decode_content: bool
+    enforce_content_length: bool
+
+
+if typing.TYPE_CHECKING:
+    import ssl
+    from typing import Protocol
+
+    from .response import BaseHTTPResponse
+
+    class BaseHTTPConnection(Protocol):
+        default_port: typing.ClassVar[int]
+        default_socket_options: typing.ClassVar[_TYPE_SOCKET_OPTIONS]
+
+        host: str
+        port: int
+        timeout: None | (
+            float
+        )  # Instance doesn't store _DEFAULT_TIMEOUT, must be resolved.
+        blocksize: int
+        source_address: tuple[str, int] | None
+        socket_options: _TYPE_SOCKET_OPTIONS | None
+
+        proxy: Url | None
+        proxy_config: ProxyConfig | None
+
+        is_verified: bool
+        proxy_is_verified: bool | None
+
+        def __init__(
+            self,
+            host: str,
+            port: int | None = None,
+            *,
+            timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
+            source_address: tuple[str, int] | None = None,
+            blocksize: int = 8192,
+            socket_options: _TYPE_SOCKET_OPTIONS | None = ...,
+            proxy: Url | None = None,
+            proxy_config: ProxyConfig | None = None,
+        ) -> None: ...
+
+        def set_tunnel(
+            self,
+            host: str,
+            port: int | None = None,
+            headers: typing.Mapping[str, str] | None = None,
+            scheme: str = "http",
+        ) -> None: ...
+
+        def connect(self) -> None: ...
+
+        def request(
+            self,
+            method: str,
+            url: str,
+            body: _TYPE_BODY | None = None,
+            headers: typing.Mapping[str, str] | None = None,
+            # We know *at least* botocore is depending on the order of the
+            # first 3 parameters so to be safe we only mark the later ones
+            # as keyword-only to ensure we have space to extend.
+            *,
+            chunked: bool = False,
+            preload_content: bool = True,
+            decode_content: bool = True,
+            enforce_content_length: bool = True,
+        ) -> None: ...
+
+        def getresponse(self) -> BaseHTTPResponse: ...
+
+        def close(self) -> None: ...
+
+        @property
+        def is_closed(self) -> bool:
+            """Whether the connection either is brand new or has been previously closed.
+            If this property is True then both ``is_connected`` and ``has_connected_to_proxy``
+            properties must be False.
+            """
+
+        @property
+        def is_connected(self) -> bool:
+            """Whether the connection is actively connected to any origin (proxy or target)"""
+
+        @property
+        def has_connected_to_proxy(self) -> bool:
+            """Whether the connection has successfully connected to its proxy.
+            This returns False if no proxy is in use. Used to determine whether
+            errors are coming from the proxy layer or from tunnelling to the target origin.
+            """
+
+    class BaseHTTPSConnection(BaseHTTPConnection, Protocol):
+        default_port: typing.ClassVar[int]
+        default_socket_options: typing.ClassVar[_TYPE_SOCKET_OPTIONS]
+
+        # Certificate verification methods
+        cert_reqs: int | str | None
+        assert_hostname: None | str | typing.Literal[False]
+        assert_fingerprint: str | None
+        ssl_context: ssl.SSLContext | None
+
+        # Trusted CAs
+        ca_certs: str | None
+        ca_cert_dir: str | None
+        ca_cert_data: None | str | bytes
+
+        # TLS version
+        ssl_minimum_version: int | None
+        ssl_maximum_version: int | None
+        ssl_version: int | str | None  # Deprecated
+
+        # Client certificates
+        cert_file: str | None
+        key_file: str | None
+        key_password: str | None
+
+        def __init__(
+            self,
+            host: str,
+            port: int | None = None,
+            *,
+            timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
+            source_address: tuple[str, int] | None = None,
+            blocksize: int = 16384,
+            socket_options: _TYPE_SOCKET_OPTIONS | None = ...,
+            proxy: Url | None = None,
+            proxy_config: ProxyConfig | None = None,
+            cert_reqs: int | str | None = None,
+            assert_hostname: None | str | typing.Literal[False] = None,
+            assert_fingerprint: str | None = None,
+            server_hostname: str | None = None,
+            ssl_context: ssl.SSLContext | None = None,
+            ca_certs: str | None = None,
+            ca_cert_dir: str | None = None,
+            ca_cert_data: None | str | bytes = None,
+            ssl_minimum_version: int | None = None,
+            ssl_maximum_version: int | None = None,
+            ssl_version: int | str | None = None,  # Deprecated
+            cert_file: str | None = None,
+            key_file: str | None = None,
+            key_password: str | None = None,
+        ) -> None: ...

Scripts/reporter_lib/py38+/urllib3/_collections.py

@@ -0,0 +1,479 @@
+from __future__ import annotations
+
+import typing
+from collections import OrderedDict
+from enum import Enum, auto
+from threading import RLock
+
+if typing.TYPE_CHECKING:
+    # We can only import Protocol if TYPE_CHECKING because it's a development
+    # dependency, and is not available at runtime.
+    from typing import Protocol
+
+    from typing_extensions import Self
+
+    class HasGettableStringKeys(Protocol):
+        def keys(self) -> typing.Iterator[str]: ...
+
+        def __getitem__(self, key: str) -> str: ...
+
+
+__all__ = ["RecentlyUsedContainer", "HTTPHeaderDict"]
+
+
+# Key type
+_KT = typing.TypeVar("_KT")
+# Value type
+_VT = typing.TypeVar("_VT")
+# Default type
+_DT = typing.TypeVar("_DT")
+
+ValidHTTPHeaderSource = typing.Union[
+    "HTTPHeaderDict",
+    typing.Mapping[str, str],
+    typing.Iterable[tuple[str, str]],
+    "HasGettableStringKeys",
+]
+
+
+class _Sentinel(Enum):
+    not_passed = auto()
+
+
+def ensure_can_construct_http_header_dict(
+    potential: object,
+) -> ValidHTTPHeaderSource | None:
+    if isinstance(potential, HTTPHeaderDict):
+        return potential
+    elif isinstance(potential, typing.Mapping):
+        # Full runtime checking of the contents of a Mapping is expensive, so for the
+        # purposes of typechecking, we assume that any Mapping is the right shape.
+        return typing.cast(typing.Mapping[str, str], potential)
+    elif isinstance(potential, typing.Iterable):
+        # Similarly to Mapping, full runtime checking of the contents of an Iterable is
+        # expensive, so for the purposes of typechecking, we assume that any Iterable
+        # is the right shape.
+        return typing.cast(typing.Iterable[tuple[str, str]], potential)
+    elif hasattr(potential, "keys") and hasattr(potential, "__getitem__"):
+        return typing.cast("HasGettableStringKeys", potential)
+    else:
+        return None
+
+
+class RecentlyUsedContainer(typing.Generic[_KT, _VT], typing.MutableMapping[_KT, _VT]):
+    """
+    Provides a thread-safe dict-like container which maintains up to
+    ``maxsize`` keys while throwing away the least-recently-used keys beyond
+    ``maxsize``.
+
+    :param maxsize:
+        Maximum number of recent elements to retain.
+
+    :param dispose_func:
+        Every time an item is evicted from the container,
+        ``dispose_func(value)`` is called.  Callback which will get called
+    """
+
+    _container: typing.OrderedDict[_KT, _VT]
+    _maxsize: int
+    dispose_func: typing.Callable[[_VT], None] | None
+    lock: RLock
+
+    def __init__(
+        self,
+        maxsize: int = 10,
+        dispose_func: typing.Callable[[_VT], None] | None = None,
+    ) -> None:
+        super().__init__()
+        self._maxsize = maxsize
+        self.dispose_func = dispose_func
+        self._container = OrderedDict()
+        self.lock = RLock()
+
+    def __getitem__(self, key: _KT) -> _VT:
+        # Re-insert the item, moving it to the end of the eviction line.
+        with self.lock:
+            item = self._container.pop(key)
+            self._container[key] = item
+            return item
+
+    def __setitem__(self, key: _KT, value: _VT) -> None:
+        evicted_item = None
+        with self.lock:
+            # Possibly evict the existing value of 'key'
+            try:
+                # If the key exists, we'll overwrite it, which won't change the
+                # size of the pool. Because accessing a key should move it to
+                # the end of the eviction line, we pop it out first.
+                evicted_item = key, self._container.pop(key)
+                self._container[key] = value
+            except KeyError:
+                # When the key does not exist, we insert the value first so that
+                # evicting works in all cases, including when self._maxsize is 0
+                self._container[key] = value
+                if len(self._container) > self._maxsize:
+                    # If we didn't evict an existing value, and we've hit our maximum
+                    # size, then we have to evict the least recently used item from
+                    # the beginning of the container.
+                    evicted_item = self._container.popitem(last=False)
+
+        # After releasing the lock on the pool, dispose of any evicted value.
+        if evicted_item is not None and self.dispose_func:
+            _, evicted_value = evicted_item
+            self.dispose_func(evicted_value)
+
+    def __delitem__(self, key: _KT) -> None:
+        with self.lock:
+            value = self._container.pop(key)
+
+        if self.dispose_func:
+            self.dispose_func(value)
+
+    def __len__(self) -> int:
+        with self.lock:
+            return len(self._container)
+
+    def __iter__(self) -> typing.NoReturn:
+        raise NotImplementedError(
+            "Iteration over this class is unlikely to be threadsafe."
+        )
+
+    def clear(self) -> None:
+        with self.lock:
+            # Copy pointers to all values, then wipe the mapping
+            values = list(self._container.values())
+            self._container.clear()
+
+        if self.dispose_func:
+            for value in values:
+                self.dispose_func(value)
+
+    def keys(self) -> set[_KT]:  # type: ignore[override]
+        with self.lock:
+            return set(self._container.keys())
+
+
+class HTTPHeaderDictItemView(set[tuple[str, str]]):
+    """
+    HTTPHeaderDict is unusual for a Mapping[str, str] in that it has two modes of
+    address.
+
+    If we directly try to get an item with a particular name, we will get a string
+    back that is the concatenated version of all the values:
+
+    >>> d['X-Header-Name']
+    'Value1, Value2, Value3'
+
+    However, if we iterate over an HTTPHeaderDict's items, we will optionally combine
+    these values based on whether combine=True was called when building up the dictionary
+
+    >>> d = HTTPHeaderDict({"A": "1", "B": "foo"})
+    >>> d.add("A", "2", combine=True)
+    >>> d.add("B", "bar")
+    >>> list(d.items())
+    [
+        ('A', '1, 2'),
+        ('B', 'foo'),
+        ('B', 'bar'),
+    ]
+
+    This class conforms to the interface required by the MutableMapping ABC while
+    also giving us the nonstandard iteration behavior we want; items with duplicate
+    keys, ordered by time of first insertion.
+    """
+
+    _headers: HTTPHeaderDict
+
+    def __init__(self, headers: HTTPHeaderDict) -> None:
+        self._headers = headers
+
+    def __len__(self) -> int:
+        return len(list(self._headers.iteritems()))
+
+    def __iter__(self) -> typing.Iterator[tuple[str, str]]:
+        return self._headers.iteritems()
+
+    def __contains__(self, item: object) -> bool:
+        if isinstance(item, tuple) and len(item) == 2:
+            passed_key, passed_val = item
+            if isinstance(passed_key, str) and isinstance(passed_val, str):
+                return self._headers._has_value_for_header(passed_key, passed_val)
+        return False
+
+
+class HTTPHeaderDict(typing.MutableMapping[str, str]):
+    """
+    :param headers:
+        An iterable of field-value pairs. Must not contain multiple field names
+        when compared case-insensitively.
+
+    :param kwargs:
+        Additional field-value pairs to pass in to ``dict.update``.
+
+    A ``dict`` like container for storing HTTP Headers.
+
+    Field names are stored and compared case-insensitively in compliance with
+    RFC 7230. Iteration provides the first case-sensitive key seen for each
+    case-insensitive pair.
+
+    Using ``__setitem__`` syntax overwrites fields that compare equal
+    case-insensitively in order to maintain ``dict``'s api. For fields that
+    compare equal, instead create a new ``HTTPHeaderDict`` and use ``.add``
+    in a loop.
+
+    If multiple fields that are equal case-insensitively are passed to the
+    constructor or ``.update``, the behavior is undefined and some will be
+    lost.
+
+    >>> headers = HTTPHeaderDict()
+    >>> headers.add('Set-Cookie', 'foo=bar')
+    >>> headers.add('set-cookie', 'baz=quxx')
+    >>> headers['content-length'] = '7'
+    >>> headers['SET-cookie']
+    'foo=bar, baz=quxx'
+    >>> headers['Content-Length']
+    '7'
+    """
+
+    _container: typing.MutableMapping[str, list[str]]
+
+    def __init__(self, headers: ValidHTTPHeaderSource | None = None, **kwargs: str):
+        super().__init__()
+        self._container = {}  # 'dict' is insert-ordered
+        if headers is not None:
+            if isinstance(headers, HTTPHeaderDict):
+                self._copy_from(headers)
+            else:
+                self.extend(headers)
+        if kwargs:
+            self.extend(kwargs)
+
+    def __setitem__(self, key: str, val: str) -> None:
+        # avoid a bytes/str comparison by decoding before httplib
+        if isinstance(key, bytes):
+            key = key.decode("latin-1")
+        self._container[key.lower()] = [key, val]
+
+    def __getitem__(self, key: str) -> str:
+        val = self._container[key.lower()]
+        return ", ".join(val[1:])
+
+    def __delitem__(self, key: str) -> None:
+        del self._container[key.lower()]
+
+    def __contains__(self, key: object) -> bool:
+        if isinstance(key, str):
+            return key.lower() in self._container
+        return False
+
+    def setdefault(self, key: str, default: str = "") -> str:
+        return super().setdefault(key, default)
+
+    def __eq__(self, other: object) -> bool:
+        maybe_constructable = ensure_can_construct_http_header_dict(other)
+        if maybe_constructable is None:
+            return False
+        else:
+            other_as_http_header_dict = type(self)(maybe_constructable)
+
+        return {k.lower(): v for k, v in self.itermerged()} == {
+            k.lower(): v for k, v in other_as_http_header_dict.itermerged()
+        }
+
+    def __ne__(self, other: object) -> bool:
+        return not self.__eq__(other)
+
+    def __len__(self) -> int:
+        return len(self._container)
+
+    def __iter__(self) -> typing.Iterator[str]:
+        # Only provide the originally cased names
+        for vals in self._container.values():
+            yield vals[0]
+
+    def discard(self, key: str) -> None:
+        try:
+            del self[key]
+        except KeyError:
+            pass
+
+    def add(self, key: str, val: str, *, combine: bool = False) -> None:
+        """Adds a (name, value) pair, doesn't overwrite the value if it already
+        exists.
+
+        If this is called with combine=True, instead of adding a new header value
+        as a distinct item during iteration, this will instead append the value to
+        any existing header value with a comma. If no existing header value exists
+        for the key, then the value will simply be added, ignoring the combine parameter.
+
+        >>> headers = HTTPHeaderDict(foo='bar')
+        >>> headers.add('Foo', 'baz')
+        >>> headers['foo']
+        'bar, baz'
+        >>> list(headers.items())
+        [('foo', 'bar'), ('foo', 'baz')]
+        >>> headers.add('foo', 'quz', combine=True)
+        >>> list(headers.items())
+        [('foo', 'bar, baz, quz')]
+        """
+        # avoid a bytes/str comparison by decoding before httplib
+        if isinstance(key, bytes):
+            key = key.decode("latin-1")
+        key_lower = key.lower()
+        new_vals = [key, val]
+        # Keep the common case aka no item present as fast as possible
+        vals = self._container.setdefault(key_lower, new_vals)
+        if new_vals is not vals:
+            # if there are values here, then there is at least the initial
+            # key/value pair
+            assert len(vals) >= 2
+            if combine:
+                vals[-1] = vals[-1] + ", " + val
+            else:
+                vals.append(val)
+
+    def extend(self, *args: ValidHTTPHeaderSource, **kwargs: str) -> None:
+        """Generic import function for any type of header-like object.
+        Adapted version of MutableMapping.update in order to insert items
+        with self.add instead of self.__setitem__
+        """
+        if len(args) > 1:
+            raise TypeError(
+                f"extend() takes at most 1 positional arguments ({len(args)} given)"
+            )
+        other = args[0] if len(args) >= 1 else ()
+
+        if isinstance(other, HTTPHeaderDict):
+            for key, val in other.iteritems():
+                self.add(key, val)
+        elif isinstance(other, typing.Mapping):
+            for key, val in other.items():
+                self.add(key, val)
+        elif isinstance(other, typing.Iterable):
+            other = typing.cast(typing.Iterable[tuple[str, str]], other)
+            for key, value in other:
+                self.add(key, value)
+        elif hasattr(other, "keys") and hasattr(other, "__getitem__"):
+            # THIS IS NOT A TYPESAFE BRANCH
+            # In this branch, the object has a `keys` attr but is not a Mapping or any of
+            # the other types indicated in the method signature. We do some stuff with
+            # it as though it partially implements the Mapping interface, but we're not
+            # doing that stuff safely AT ALL.
+            for key in other.keys():
+                self.add(key, other[key])
+
+        for key, value in kwargs.items():
+            self.add(key, value)
+
+    @typing.overload
+    def getlist(self, key: str) -> list[str]: ...
+
+    @typing.overload
+    def getlist(self, key: str, default: _DT) -> list[str] | _DT: ...
+
+    def getlist(
+        self, key: str, default: _Sentinel | _DT = _Sentinel.not_passed
+    ) -> list[str] | _DT:
+        """Returns a list of all the values for the named field. Returns an
+        empty list if the key doesn't exist."""
+        try:
+            vals = self._container[key.lower()]
+        except KeyError:
+            if default is _Sentinel.not_passed:
+                # _DT is unbound; empty list is instance of List[str]
+                return []
+            # _DT is bound; default is instance of _DT
+            return default
+        else:
+            # _DT may or may not be bound; vals[1:] is instance of List[str], which
+            # meets our external interface requirement of `Union[List[str], _DT]`.
+            return vals[1:]
+
+    def _prepare_for_method_change(self) -> Self:
+        """
+        Remove content-specific header fields before changing the request
+        method to GET or HEAD according to RFC 9110, Section 15.4.
+        """
+        content_specific_headers = [
+            "Content-Encoding",
+            "Content-Language",
+            "Content-Location",
+            "Content-Type",
+            "Content-Length",
+            "Digest",
+            "Last-Modified",
+        ]
+        for header in content_specific_headers:
+            self.discard(header)
+        return self
+
+    # Backwards compatibility for httplib
+    getheaders = getlist
+    getallmatchingheaders = getlist
+    iget = getlist
+
+    # Backwards compatibility for http.cookiejar
+    get_all = getlist
+
+    def __repr__(self) -> str:
+        return f"{type(self).__name__}({dict(self.itermerged())})"
+
+    def _copy_from(self, other: HTTPHeaderDict) -> None:
+        for key in other:
+            val = other.getlist(key)
+            self._container[key.lower()] = [key, *val]
+
+    def copy(self) -> Self:
+        clone = type(self)()
+        clone._copy_from(self)
+        return clone
+
+    def iteritems(self) -> typing.Iterator[tuple[str, str]]:
+        """Iterate over all header lines, including duplicate ones."""
+        for key in self:
+            vals = self._container[key.lower()]
+            for val in vals[1:]:
+                yield vals[0], val
+
+    def itermerged(self) -> typing.Iterator[tuple[str, str]]:
+        """Iterate over all headers, merging duplicate ones together."""
+        for key in self:
+            val = self._container[key.lower()]
+            yield val[0], ", ".join(val[1:])
+
+    def items(self) -> HTTPHeaderDictItemView:  # type: ignore[override]
+        return HTTPHeaderDictItemView(self)
+
+    def _has_value_for_header(self, header_name: str, potential_value: str) -> bool:
+        if header_name in self:
+            return potential_value in self._container[header_name.lower()][1:]
+        return False
+
+    def __ior__(self, other: object) -> HTTPHeaderDict:
+        # Supports extending a header dict in-place using operator |=
+        # combining items with add instead of __setitem__
+        maybe_constructable = ensure_can_construct_http_header_dict(other)
+        if maybe_constructable is None:
+            return NotImplemented
+        self.extend(maybe_constructable)
+        return self
+
+    def __or__(self, other: object) -> Self:
+        # Supports merging header dicts using operator |
+        # combining items with add instead of __setitem__
+        maybe_constructable = ensure_can_construct_http_header_dict(other)
+        if maybe_constructable is None:
+            return NotImplemented
+        result = self.copy()
+        result.extend(maybe_constructable)
+        return result
+
+    def __ror__(self, other: object) -> Self:
+        # Supports merging header dicts using operator | when other is on left side
+        # combining items with add instead of __setitem__
+        maybe_constructable = ensure_can_construct_http_header_dict(other)
+        if maybe_constructable is None:
+            return NotImplemented
+        result = type(self)(maybe_constructable)
+        result.extend(self)
+        return result

Scripts/reporter_lib/py38+/urllib3/_request_methods.py

@@ -0,0 +1,278 @@
+from __future__ import annotations
+
+import json as _json
+import typing
+from urllib.parse import urlencode
+
+from ._base_connection import _TYPE_BODY
+from ._collections import HTTPHeaderDict
+from .filepost import _TYPE_FIELDS, encode_multipart_formdata
+from .response import BaseHTTPResponse
+
+__all__ = ["RequestMethods"]
+
+_TYPE_ENCODE_URL_FIELDS = typing.Union[
+    typing.Sequence[tuple[str, typing.Union[str, bytes]]],
+    typing.Mapping[str, typing.Union[str, bytes]],
+]
+
+
+class RequestMethods:
+    """
+    Convenience mixin for classes who implement a :meth:`urlopen` method, such
+    as :class:`urllib3.HTTPConnectionPool` and
+    :class:`urllib3.PoolManager`.
+
+    Provides behavior for making common types of HTTP request methods and
+    decides which type of request field encoding to use.
+
+    Specifically,
+
+    :meth:`.request_encode_url` is for sending requests whose fields are
+    encoded in the URL (such as GET, HEAD, DELETE).
+
+    :meth:`.request_encode_body` is for sending requests whose fields are
+    encoded in the *body* of the request using multipart or www-form-urlencoded
+    (such as for POST, PUT, PATCH).
+
+    :meth:`.request` is for making any kind of request, it will look up the
+    appropriate encoding format and use one of the above two methods to make
+    the request.
+
+    Initializer parameters:
+
+    :param headers:
+        Headers to include with all requests, unless other headers are given
+        explicitly.
+    """
+
+    _encode_url_methods = {"DELETE", "GET", "HEAD", "OPTIONS"}
+
+    def __init__(self, headers: typing.Mapping[str, str] | None = None) -> None:
+        self.headers = headers or {}
+
+    def urlopen(
+        self,
+        method: str,
+        url: str,
+        body: _TYPE_BODY | None = None,
+        headers: typing.Mapping[str, str] | None = None,
+        encode_multipart: bool = True,
+        multipart_boundary: str | None = None,
+        **kw: typing.Any,
+    ) -> BaseHTTPResponse:  # Abstract
+        raise NotImplementedError(
+            "Classes extending RequestMethods must implement "
+            "their own ``urlopen`` method."
+        )
+
+    def request(
+        self,
+        method: str,
+        url: str,
+        body: _TYPE_BODY | None = None,
+        fields: _TYPE_FIELDS | None = None,
+        headers: typing.Mapping[str, str] | None = None,
+        json: typing.Any | None = None,
+        **urlopen_kw: typing.Any,
+    ) -> BaseHTTPResponse:
+        """
+        Make a request using :meth:`urlopen` with the appropriate encoding of
+        ``fields`` based on the ``method`` used.
+
+        This is a convenience method that requires the least amount of manual
+        effort. It can be used in most situations, while still having the
+        option to drop down to more specific methods when necessary, such as
+        :meth:`request_encode_url`, :meth:`request_encode_body`,
+        or even the lowest level :meth:`urlopen`.
+
+        :param method:
+            HTTP request method (such as GET, POST, PUT, etc.)
+
+        :param url:
+            The URL to perform the request on.
+
+        :param body:
+            Data to send in the request body, either :class:`str`, :class:`bytes`,
+            an iterable of :class:`str`/:class:`bytes`, or a file-like object.
+
+        :param fields:
+            Data to encode and send in the URL or request body, depending on ``method``.
+
+        :param headers:
+            Dictionary of custom headers to send, such as User-Agent,
+            If-None-Match, etc. If None, pool headers are used. If provided,
+            these headers completely replace any pool-specific headers.
+
+        :param json:
+            Data to encode and send as JSON with UTF-encoded in the request body.
+            The ``"Content-Type"`` header will be set to ``"application/json"``
+            unless specified otherwise.
+        """
+        method = method.upper()
+
+        if json is not None and body is not None:
+            raise TypeError(
+                "request got values for both 'body' and 'json' parameters which are mutually exclusive"
+            )
+
+        if json is not None:
+            if headers is None:
+                headers = self.headers
+
+            if not ("content-type" in map(str.lower, headers.keys())):
+                headers = HTTPHeaderDict(headers)
+                headers["Content-Type"] = "application/json"
+
+            body = _json.dumps(json, separators=(",", ":"), ensure_ascii=False).encode(
+                "utf-8"
+            )
+
+        if body is not None:
+            urlopen_kw["body"] = body
+
+        if method in self._encode_url_methods:
+            return self.request_encode_url(
+                method,
+                url,
+                fields=fields,  # type: ignore[arg-type]
+                headers=headers,
+                **urlopen_kw,
+            )
+        else:
+            return self.request_encode_body(
+                method, url, fields=fields, headers=headers, **urlopen_kw
+            )
+
+    def request_encode_url(
+        self,
+        method: str,
+        url: str,
+        fields: _TYPE_ENCODE_URL_FIELDS | None = None,
+        headers: typing.Mapping[str, str] | None = None,
+        **urlopen_kw: str,
+    ) -> BaseHTTPResponse:
+        """
+        Make a request using :meth:`urlopen` with the ``fields`` encoded in
+        the url. This is useful for request methods like GET, HEAD, DELETE, etc.
+
+        :param method:
+            HTTP request method (such as GET, POST, PUT, etc.)
+
+        :param url:
+            The URL to perform the request on.
+
+        :param fields:
+            Data to encode and send in the URL.
+
+        :param headers:
+            Dictionary of custom headers to send, such as User-Agent,
+            If-None-Match, etc. If None, pool headers are used. If provided,
+            these headers completely replace any pool-specific headers.
+        """
+        if headers is None:
+            headers = self.headers
+
+        extra_kw: dict[str, typing.Any] = {"headers": headers}
+        extra_kw.update(urlopen_kw)
+
+        if fields:
+            url += "?" + urlencode(fields)
+
+        return self.urlopen(method, url, **extra_kw)
+
+    def request_encode_body(
+        self,
+        method: str,
+        url: str,
+        fields: _TYPE_FIELDS | None = None,
+        headers: typing.Mapping[str, str] | None = None,
+        encode_multipart: bool = True,
+        multipart_boundary: str | None = None,
+        **urlopen_kw: str,
+    ) -> BaseHTTPResponse:
+        """
+        Make a request using :meth:`urlopen` with the ``fields`` encoded in
+        the body. This is useful for request methods like POST, PUT, PATCH, etc.
+
+        When ``encode_multipart=True`` (default), then
+        :func:`urllib3.encode_multipart_formdata` is used to encode
+        the payload with the appropriate content type. Otherwise
+        :func:`urllib.parse.urlencode` is used with the
+        'application/x-www-form-urlencoded' content type.
+
+        Multipart encoding must be used when posting files, and it's reasonably
+        safe to use it in other times too. However, it may break request
+        signing, such as with OAuth.
+
+        Supports an optional ``fields`` parameter of key/value strings AND
+        key/filetuple. A filetuple is a (filename, data, MIME type) tuple where
+        the MIME type is optional. For example::
+
+            fields = {
+                'foo': 'bar',
+                'fakefile': ('foofile.txt', 'contents of foofile'),
+                'realfile': ('barfile.txt', open('realfile').read()),
+                'typedfile': ('bazfile.bin', open('bazfile').read(),
+                              'image/jpeg'),
+                'nonamefile': 'contents of nonamefile field',
+            }
+
+        When uploading a file, providing a filename (the first parameter of the
+        tuple) is optional but recommended to best mimic behavior of browsers.
+
+        Note that if ``headers`` are supplied, the 'Content-Type' header will
+        be overwritten because it depends on the dynamic random boundary string
+        which is used to compose the body of the request. The random boundary
+        string can be explicitly set with the ``multipart_boundary`` parameter.
+
+        :param method:
+            HTTP request method (such as GET, POST, PUT, etc.)
+
+        :param url:
+            The URL to perform the request on.
+
+        :param fields:
+            Data to encode and send in the request body.
+
+        :param headers:
+            Dictionary of custom headers to send, such as User-Agent,
+            If-None-Match, etc. If None, pool headers are used. If provided,
+            these headers completely replace any pool-specific headers.
+
+        :param encode_multipart:
+            If True, encode the ``fields`` using the multipart/form-data MIME
+            format.
+
+        :param multipart_boundary:
+            If not specified, then a random boundary will be generated using
+            :func:`urllib3.filepost.choose_boundary`.
+        """
+        if headers is None:
+            headers = self.headers
+
+        extra_kw: dict[str, typing.Any] = {"headers": HTTPHeaderDict(headers)}
+        body: bytes | str
+
+        if fields:
+            if "body" in urlopen_kw:
+                raise TypeError(
+                    "request got values for both 'fields' and 'body', can only specify one."
+                )
+
+            if encode_multipart:
+                body, content_type = encode_multipart_formdata(
+                    fields, boundary=multipart_boundary
+                )
+            else:
+                body, content_type = (
+                    urlencode(fields),  # type: ignore[arg-type]
+                    "application/x-www-form-urlencoded",
+                )
+
+            extra_kw["body"] = body
+            extra_kw["headers"].setdefault("Content-Type", content_type)
+
+        extra_kw.update(urlopen_kw)
+
+        return self.urlopen(method, url, **extra_kw)

Scripts/reporter_lib/py38+/urllib3/_version.py

@@ -0,0 +1,16 @@
+# file generated by setuptools_scm
+# don't change, don't track in version control
+TYPE_CHECKING = False
+if TYPE_CHECKING:
+    from typing import Tuple, Union
+    VERSION_TUPLE = Tuple[Union[int, str], ...]
+else:
+    VERSION_TUPLE = object
+
+version: str
+__version__: str
+__version_tuple__: VERSION_TUPLE
+version_tuple: VERSION_TUPLE
+
+__version__ = version = '2.3.0'
+__version_tuple__ = version_tuple = (2, 3, 0)

Scripts/reporter_lib/py38+/urllib3/contrib/emscripten/__init__.py

@@ -0,0 +1,16 @@
+from __future__ import annotations
+
+import urllib3.connection
+
+from ...connectionpool import HTTPConnectionPool, HTTPSConnectionPool
+from .connection import EmscriptenHTTPConnection, EmscriptenHTTPSConnection
+
+
+def inject_into_urllib3() -> None:
+    # override connection classes to use emscripten specific classes
+    # n.b. mypy complains about the overriding of classes below
+    # if it isn't ignored
+    HTTPConnectionPool.ConnectionCls = EmscriptenHTTPConnection
+    HTTPSConnectionPool.ConnectionCls = EmscriptenHTTPSConnection
+    urllib3.connection.HTTPConnection = EmscriptenHTTPConnection  # type: ignore[misc,assignment]
+    urllib3.connection.HTTPSConnection = EmscriptenHTTPSConnection  # type: ignore[misc,assignment]

Scripts/reporter_lib/py38+/urllib3/contrib/emscripten/connection.py

@@ -0,0 +1,255 @@
+from __future__ import annotations
+
+import os
+import typing
+
+# use http.client.HTTPException for consistency with non-emscripten
+from http.client import HTTPException as HTTPException  # noqa: F401
+from http.client import ResponseNotReady
+
+from ..._base_connection import _TYPE_BODY
+from ...connection import HTTPConnection, ProxyConfig, port_by_scheme
+from ...exceptions import TimeoutError
+from ...response import BaseHTTPResponse
+from ...util.connection import _TYPE_SOCKET_OPTIONS
+from ...util.timeout import _DEFAULT_TIMEOUT, _TYPE_TIMEOUT
+from ...util.url import Url
+from .fetch import _RequestError, _TimeoutError, send_request, send_streaming_request
+from .request import EmscriptenRequest
+from .response import EmscriptenHttpResponseWrapper, EmscriptenResponse
+
+if typing.TYPE_CHECKING:
+    from ..._base_connection import BaseHTTPConnection, BaseHTTPSConnection
+
+
+class EmscriptenHTTPConnection:
+    default_port: typing.ClassVar[int] = port_by_scheme["http"]
+    default_socket_options: typing.ClassVar[_TYPE_SOCKET_OPTIONS]
+
+    timeout: None | (float)
+
+    host: str
+    port: int
+    blocksize: int
+    source_address: tuple[str, int] | None
+    socket_options: _TYPE_SOCKET_OPTIONS | None
+
+    proxy: Url | None
+    proxy_config: ProxyConfig | None
+
+    is_verified: bool = False
+    proxy_is_verified: bool | None = None
+
+    _response: EmscriptenResponse | None
+
+    def __init__(
+        self,
+        host: str,
+        port: int = 0,
+        *,
+        timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
+        source_address: tuple[str, int] | None = None,
+        blocksize: int = 8192,
+        socket_options: _TYPE_SOCKET_OPTIONS | None = None,
+        proxy: Url | None = None,
+        proxy_config: ProxyConfig | None = None,
+    ) -> None:
+        self.host = host
+        self.port = port
+        self.timeout = timeout if isinstance(timeout, float) else 0.0
+        self.scheme = "http"
+        self._closed = True
+        self._response = None
+        # ignore these things because we don't
+        # have control over that stuff
+        self.proxy = None
+        self.proxy_config = None
+        self.blocksize = blocksize
+        self.source_address = None
+        self.socket_options = None
+        self.is_verified = False
+
+    def set_tunnel(
+        self,
+        host: str,
+        port: int | None = 0,
+        headers: typing.Mapping[str, str] | None = None,
+        scheme: str = "http",
+    ) -> None:
+        pass
+
+    def connect(self) -> None:
+        pass
+
+    def request(
+        self,
+        method: str,
+        url: str,
+        body: _TYPE_BODY | None = None,
+        headers: typing.Mapping[str, str] | None = None,
+        # We know *at least* botocore is depending on the order of the
+        # first 3 parameters so to be safe we only mark the later ones
+        # as keyword-only to ensure we have space to extend.
+        *,
+        chunked: bool = False,
+        preload_content: bool = True,
+        decode_content: bool = True,
+        enforce_content_length: bool = True,
+    ) -> None:
+        self._closed = False
+        if url.startswith("/"):
+            # no scheme / host / port included, make a full url
+            url = f"{self.scheme}://{self.host}:{self.port}" + url
+        request = EmscriptenRequest(
+            url=url,
+            method=method,
+            timeout=self.timeout if self.timeout else 0,
+            decode_content=decode_content,
+        )
+        request.set_body(body)
+        if headers:
+            for k, v in headers.items():
+                request.set_header(k, v)
+        self._response = None
+        try:
+            if not preload_content:
+                self._response = send_streaming_request(request)
+            if self._response is None:
+                self._response = send_request(request)
+        except _TimeoutError as e:
+            raise TimeoutError(e.message) from e
+        except _RequestError as e:
+            raise HTTPException(e.message) from e
+
+    def getresponse(self) -> BaseHTTPResponse:
+        if self._response is not None:
+            return EmscriptenHttpResponseWrapper(
+                internal_response=self._response,
+                url=self._response.request.url,
+                connection=self,
+            )
+        else:
+            raise ResponseNotReady()
+
+    def close(self) -> None:
+        self._closed = True
+        self._response = None
+
+    @property
+    def is_closed(self) -> bool:
+        """Whether the connection either is brand new or has been previously closed.
+        If this property is True then both ``is_connected`` and ``has_connected_to_proxy``
+        properties must be False.
+        """
+        return self._closed
+
+    @property
+    def is_connected(self) -> bool:
+        """Whether the connection is actively connected to any origin (proxy or target)"""
+        return True
+
+    @property
+    def has_connected_to_proxy(self) -> bool:
+        """Whether the connection has successfully connected to its proxy.
+        This returns False if no proxy is in use. Used to determine whether
+        errors are coming from the proxy layer or from tunnelling to the target origin.
+        """
+        return False
+
+
+class EmscriptenHTTPSConnection(EmscriptenHTTPConnection):
+    default_port = port_by_scheme["https"]
+    # all this is basically ignored, as browser handles https
+    cert_reqs: int | str | None = None
+    ca_certs: str | None = None
+    ca_cert_dir: str | None = None
+    ca_cert_data: None | str | bytes = None
+    cert_file: str | None
+    key_file: str | None
+    key_password: str | None
+    ssl_context: typing.Any | None
+    ssl_version: int | str | None = None
+    ssl_minimum_version: int | None = None
+    ssl_maximum_version: int | None = None
+    assert_hostname: None | str | typing.Literal[False]
+    assert_fingerprint: str | None = None
+
+    def __init__(
+        self,
+        host: str,
+        port: int = 0,
+        *,
+        timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
+        source_address: tuple[str, int] | None = None,
+        blocksize: int = 16384,
+        socket_options: (
+            None | _TYPE_SOCKET_OPTIONS
+        ) = HTTPConnection.default_socket_options,
+        proxy: Url | None = None,
+        proxy_config: ProxyConfig | None = None,
+        cert_reqs: int | str | None = None,
+        assert_hostname: None | str | typing.Literal[False] = None,
+        assert_fingerprint: str | None = None,
+        server_hostname: str | None = None,
+        ssl_context: typing.Any | None = None,
+        ca_certs: str | None = None,
+        ca_cert_dir: str | None = None,
+        ca_cert_data: None | str | bytes = None,
+        ssl_minimum_version: int | None = None,
+        ssl_maximum_version: int | None = None,
+        ssl_version: int | str | None = None,  # Deprecated
+        cert_file: str | None = None,
+        key_file: str | None = None,
+        key_password: str | None = None,
+    ) -> None:
+        super().__init__(
+            host,
+            port=port,
+            timeout=timeout,
+            source_address=source_address,
+            blocksize=blocksize,
+            socket_options=socket_options,
+            proxy=proxy,
+            proxy_config=proxy_config,
+        )
+        self.scheme = "https"
+
+        self.key_file = key_file
+        self.cert_file = cert_file
+        self.key_password = key_password
+        self.ssl_context = ssl_context
+        self.server_hostname = server_hostname
+        self.assert_hostname = assert_hostname
+        self.assert_fingerprint = assert_fingerprint
+        self.ssl_version = ssl_version
+        self.ssl_minimum_version = ssl_minimum_version
+        self.ssl_maximum_version = ssl_maximum_version
+        self.ca_certs = ca_certs and os.path.expanduser(ca_certs)
+        self.ca_cert_dir = ca_cert_dir and os.path.expanduser(ca_cert_dir)
+        self.ca_cert_data = ca_cert_data
+
+        self.cert_reqs = None
+
+        # The browser will automatically verify all requests.
+        # We have no control over that setting.
+        self.is_verified = True
+
+    def set_cert(
+        self,
+        key_file: str | None = None,
+        cert_file: str | None = None,
+        cert_reqs: int | str | None = None,
+        key_password: str | None = None,
+        ca_certs: str | None = None,
+        assert_hostname: None | str | typing.Literal[False] = None,
+        assert_fingerprint: str | None = None,
+        ca_cert_dir: str | None = None,
+        ca_cert_data: None | str | bytes = None,
+    ) -> None:
+        pass
+
+
+# verify that this class implements BaseHTTP(s) connection correctly
+if typing.TYPE_CHECKING:
+    _supports_http_protocol: BaseHTTPConnection = EmscriptenHTTPConnection("", 0)
+    _supports_https_protocol: BaseHTTPSConnection = EmscriptenHTTPSConnection("", 0)

Scripts/reporter_lib/py38+/urllib3/contrib/emscripten/emscripten_fetch_worker.js

@@ -0,0 +1,110 @@
+let Status = {
+  SUCCESS_HEADER: -1,
+  SUCCESS_EOF: -2,
+  ERROR_TIMEOUT: -3,
+  ERROR_EXCEPTION: -4,
+};
+
+let connections = {};
+let nextConnectionID = 1;
+const encoder = new TextEncoder();
+
+self.addEventListener("message", async function (event) {
+  if (event.data.close) {
+    let connectionID = event.data.close;
+    delete connections[connectionID];
+    return;
+  } else if (event.data.getMore) {
+    let connectionID = event.data.getMore;
+    let { curOffset, value, reader, intBuffer, byteBuffer } =
+      connections[connectionID];
+    // if we still have some in buffer, then just send it back straight away
+    if (!value || curOffset >= value.length) {
+      // read another buffer if required
+      try {
+        let readResponse = await reader.read();
+
+        if (readResponse.done) {
+          // read everything - clear connection and return
+          delete connections[connectionID];
+          Atomics.store(intBuffer, 0, Status.SUCCESS_EOF);
+          Atomics.notify(intBuffer, 0);
+          // finished reading successfully
+          // return from event handler
+          return;
+        }
+        curOffset = 0;
+        connections[connectionID].value = readResponse.value;
+        value = readResponse.value;
+      } catch (error) {
+        console.log("Request exception:", error);
+        let errorBytes = encoder.encode(error.message);
+        let written = errorBytes.length;
+        byteBuffer.set(errorBytes);
+        intBuffer[1] = written;
+        Atomics.store(intBuffer, 0, Status.ERROR_EXCEPTION);
+        Atomics.notify(intBuffer, 0);
+      }
+    }
+
+    // send as much buffer as we can
+    let curLen = value.length - curOffset;
+    if (curLen > byteBuffer.length) {
+      curLen = byteBuffer.length;
+    }
+    byteBuffer.set(value.subarray(curOffset, curOffset + curLen), 0);
+
+    Atomics.store(intBuffer, 0, curLen); // store current length in bytes
+    Atomics.notify(intBuffer, 0);
+    curOffset += curLen;
+    connections[connectionID].curOffset = curOffset;
+
+    return;
+  } else {
+    // start fetch
+    let connectionID = nextConnectionID;
+    nextConnectionID += 1;
+    const intBuffer = new Int32Array(event.data.buffer);
+    const byteBuffer = new Uint8Array(event.data.buffer, 8);
+    try {
+      const response = await fetch(event.data.url, event.data.fetchParams);
+      // return the headers first via textencoder
+      var headers = [];
+      for (const pair of response.headers.entries()) {
+        headers.push([pair[0], pair[1]]);
+      }
+      let headerObj = {
+        headers: headers,
+        status: response.status,
+        connectionID,
+      };
+      const headerText = JSON.stringify(headerObj);
+      let headerBytes = encoder.encode(headerText);
+      let written = headerBytes.length;
+      byteBuffer.set(headerBytes);
+      intBuffer[1] = written;
+      // make a connection
+      connections[connectionID] = {
+        reader: response.body.getReader(),
+        intBuffer: intBuffer,
+        byteBuffer: byteBuffer,
+        value: undefined,
+        curOffset: 0,
+      };
+      // set header ready
+      Atomics.store(intBuffer, 0, Status.SUCCESS_HEADER);
+      Atomics.notify(intBuffer, 0);
+      // all fetching after this goes through a new postmessage call with getMore
+      // this allows for parallel requests
+    } catch (error) {
+      console.log("Request exception:", error);
+      let errorBytes = encoder.encode(error.message);
+      let written = errorBytes.length;
+      byteBuffer.set(errorBytes);
+      intBuffer[1] = written;
+      Atomics.store(intBuffer, 0, Status.ERROR_EXCEPTION);
+      Atomics.notify(intBuffer, 0);
+    }
+  }
+});
+self.postMessage({ inited: true });

Scripts/reporter_lib/py38+/urllib3/contrib/emscripten/fetch.py

@@ -0,0 +1,708 @@
+"""
+Support for streaming http requests in emscripten.
+
+A few caveats -
+
+If your browser (or Node.js) has WebAssembly JavaScript Promise Integration enabled
+https://github.com/WebAssembly/js-promise-integration/blob/main/proposals/js-promise-integration/Overview.md
+*and* you launch pyodide using `pyodide.runPythonAsync`, this will fetch data using the
+JavaScript asynchronous fetch api (wrapped via `pyodide.ffi.call_sync`). In this case
+timeouts and streaming should just work.
+
+Otherwise, it uses a combination of XMLHttpRequest and a web-worker for streaming.
+
+This approach has several caveats:
+
+Firstly, you can't do streaming http in the main UI thread, because atomics.wait isn't allowed.
+Streaming only works if you're running pyodide in a web worker.
+
+Secondly, this uses an extra web worker and SharedArrayBuffer to do the asynchronous fetch
+operation, so it requires that you have crossOriginIsolation enabled, by serving over https
+(or from localhost) with the two headers below set:
+
+    Cross-Origin-Opener-Policy: same-origin
+    Cross-Origin-Embedder-Policy: require-corp
+
+You can tell if cross origin isolation is successfully enabled by looking at the global crossOriginIsolated variable in
+JavaScript console. If it isn't, streaming requests will fallback to XMLHttpRequest, i.e. getting the whole
+request into a buffer and then returning it. it shows a warning in the JavaScript console in this case.
+
+Finally, the webworker which does the streaming fetch is created on initial import, but will only be started once
+control is returned to javascript. Call `await wait_for_streaming_ready()` to wait for streaming fetch.
+
+NB: in this code, there are a lot of JavaScript objects. They are named js_*
+to make it clear what type of object they are.
+"""
+
+from __future__ import annotations
+
+import io
+import json
+from email.parser import Parser
+from importlib.resources import files
+from typing import TYPE_CHECKING, Any
+
+import js  # type: ignore[import-not-found]
+from pyodide.ffi import (  # type: ignore[import-not-found]
+    JsArray,
+    JsException,
+    JsProxy,
+    to_js,
+)
+
+if TYPE_CHECKING:
+    from typing_extensions import Buffer
+
+from .request import EmscriptenRequest
+from .response import EmscriptenResponse
+
+"""
+There are some headers that trigger unintended CORS preflight requests.
+See also https://github.com/koenvo/pyodide-http/issues/22
+"""
+HEADERS_TO_IGNORE = ("user-agent",)
+
+SUCCESS_HEADER = -1
+SUCCESS_EOF = -2
+ERROR_TIMEOUT = -3
+ERROR_EXCEPTION = -4
+
+_STREAMING_WORKER_CODE = (
+    files(__package__)
+    .joinpath("emscripten_fetch_worker.js")
+    .read_text(encoding="utf-8")
+)
+
+
+class _RequestError(Exception):
+    def __init__(
+        self,
+        message: str | None = None,
+        *,
+        request: EmscriptenRequest | None = None,
+        response: EmscriptenResponse | None = None,
+    ):
+        self.request = request
+        self.response = response
+        self.message = message
+        super().__init__(self.message)
+
+
+class _StreamingError(_RequestError):
+    pass
+
+
+class _TimeoutError(_RequestError):
+    pass
+
+
+def _obj_from_dict(dict_val: dict[str, Any]) -> JsProxy:
+    return to_js(dict_val, dict_converter=js.Object.fromEntries)
+
+
+class _ReadStream(io.RawIOBase):
+    def __init__(
+        self,
+        int_buffer: JsArray,
+        byte_buffer: JsArray,
+        timeout: float,
+        worker: JsProxy,
+        connection_id: int,
+        request: EmscriptenRequest,
+    ):
+        self.int_buffer = int_buffer
+        self.byte_buffer = byte_buffer
+        self.read_pos = 0
+        self.read_len = 0
+        self.connection_id = connection_id
+        self.worker = worker
+        self.timeout = int(1000 * timeout) if timeout > 0 else None
+        self.is_live = True
+        self._is_closed = False
+        self.request: EmscriptenRequest | None = request
+
+    def __del__(self) -> None:
+        self.close()
+
+    # this is compatible with _base_connection
+    def is_closed(self) -> bool:
+        return self._is_closed
+
+    # for compatibility with RawIOBase
+    @property
+    def closed(self) -> bool:
+        return self.is_closed()
+
+    def close(self) -> None:
+        if self.is_closed():
+            return
+        self.read_len = 0
+        self.read_pos = 0
+        self.int_buffer = None
+        self.byte_buffer = None
+        self._is_closed = True
+        self.request = None
+        if self.is_live:
+            self.worker.postMessage(_obj_from_dict({"close": self.connection_id}))
+            self.is_live = False
+        super().close()
+
+    def readable(self) -> bool:
+        return True
+
+    def writable(self) -> bool:
+        return False
+
+    def seekable(self) -> bool:
+        return False
+
+    def readinto(self, byte_obj: Buffer) -> int:
+        if not self.int_buffer:
+            raise _StreamingError(
+                "No buffer for stream in _ReadStream.readinto",
+                request=self.request,
+                response=None,
+            )
+        if self.read_len == 0:
+            # wait for the worker to send something
+            js.Atomics.store(self.int_buffer, 0, ERROR_TIMEOUT)
+            self.worker.postMessage(_obj_from_dict({"getMore": self.connection_id}))
+            if (
+                js.Atomics.wait(self.int_buffer, 0, ERROR_TIMEOUT, self.timeout)
+                == "timed-out"
+            ):
+                raise _TimeoutError
+            data_len = self.int_buffer[0]
+            if data_len > 0:
+                self.read_len = data_len
+                self.read_pos = 0
+            elif data_len == ERROR_EXCEPTION:
+                string_len = self.int_buffer[1]
+                # decode the error string
+                js_decoder = js.TextDecoder.new()
+                json_str = js_decoder.decode(self.byte_buffer.slice(0, string_len))
+                raise _StreamingError(
+                    f"Exception thrown in fetch: {json_str}",
+                    request=self.request,
+                    response=None,
+                )
+            else:
+                # EOF, free the buffers and return zero
+                # and free the request
+                self.is_live = False
+                self.close()
+                return 0
+        # copy from int32array to python bytes
+        ret_length = min(self.read_len, len(memoryview(byte_obj)))
+        subarray = self.byte_buffer.subarray(
+            self.read_pos, self.read_pos + ret_length
+        ).to_py()
+        memoryview(byte_obj)[0:ret_length] = subarray
+        self.read_len -= ret_length
+        self.read_pos += ret_length
+        return ret_length
+
+
+class _StreamingFetcher:
+    def __init__(self) -> None:
+        # make web-worker and data buffer on startup
+        self.streaming_ready = False
+
+        js_data_blob = js.Blob.new(
+            to_js([_STREAMING_WORKER_CODE], create_pyproxies=False),
+            _obj_from_dict({"type": "application/javascript"}),
+        )
+
+        def promise_resolver(js_resolve_fn: JsProxy, js_reject_fn: JsProxy) -> None:
+            def onMsg(e: JsProxy) -> None:
+                self.streaming_ready = True
+                js_resolve_fn(e)
+
+            def onErr(e: JsProxy) -> None:
+                js_reject_fn(e)  # Defensive: never happens in ci
+
+            self.js_worker.onmessage = onMsg
+            self.js_worker.onerror = onErr
+
+        js_data_url = js.URL.createObjectURL(js_data_blob)
+        self.js_worker = js.globalThis.Worker.new(js_data_url)
+        self.js_worker_ready_promise = js.globalThis.Promise.new(promise_resolver)
+
+    def send(self, request: EmscriptenRequest) -> EmscriptenResponse:
+        headers = {
+            k: v for k, v in request.headers.items() if k not in HEADERS_TO_IGNORE
+        }
+
+        body = request.body
+        fetch_data = {"headers": headers, "body": to_js(body), "method": request.method}
+        # start the request off in the worker
+        timeout = int(1000 * request.timeout) if request.timeout > 0 else None
+        js_shared_buffer = js.SharedArrayBuffer.new(1048576)
+        js_int_buffer = js.Int32Array.new(js_shared_buffer)
+        js_byte_buffer = js.Uint8Array.new(js_shared_buffer, 8)
+
+        js.Atomics.store(js_int_buffer, 0, ERROR_TIMEOUT)
+        js.Atomics.notify(js_int_buffer, 0)
+        js_absolute_url = js.URL.new(request.url, js.location).href
+        self.js_worker.postMessage(
+            _obj_from_dict(
+                {
+                    "buffer": js_shared_buffer,
+                    "url": js_absolute_url,
+                    "fetchParams": fetch_data,
+                }
+            )
+        )
+        # wait for the worker to send something
+        js.Atomics.wait(js_int_buffer, 0, ERROR_TIMEOUT, timeout)
+        if js_int_buffer[0] == ERROR_TIMEOUT:
+            raise _TimeoutError(
+                "Timeout connecting to streaming request",
+                request=request,
+                response=None,
+            )
+        elif js_int_buffer[0] == SUCCESS_HEADER:
+            # got response
+            # header length is in second int of intBuffer
+            string_len = js_int_buffer[1]
+            # decode the rest to a JSON string
+            js_decoder = js.TextDecoder.new()
+            # this does a copy (the slice) because decode can't work on shared array
+            # for some silly reason
+            json_str = js_decoder.decode(js_byte_buffer.slice(0, string_len))
+            # get it as an object
+            response_obj = json.loads(json_str)
+            return EmscriptenResponse(
+                request=request,
+                status_code=response_obj["status"],
+                headers=response_obj["headers"],
+                body=_ReadStream(
+                    js_int_buffer,
+                    js_byte_buffer,
+                    request.timeout,
+                    self.js_worker,
+                    response_obj["connectionID"],
+                    request,
+                ),
+            )
+        elif js_int_buffer[0] == ERROR_EXCEPTION:
+            string_len = js_int_buffer[1]
+            # decode the error string
+            js_decoder = js.TextDecoder.new()
+            json_str = js_decoder.decode(js_byte_buffer.slice(0, string_len))
+            raise _StreamingError(
+                f"Exception thrown in fetch: {json_str}", request=request, response=None
+            )
+        else:
+            raise _StreamingError(
+                f"Unknown status from worker in fetch: {js_int_buffer[0]}",
+                request=request,
+                response=None,
+            )
+
+
+class _JSPIReadStream(io.RawIOBase):
+    """
+    A read stream that uses pyodide.ffi.run_sync to read from a JavaScript fetch
+    response. This requires support for WebAssembly JavaScript Promise Integration
+    in the containing browser, and for pyodide to be launched via runPythonAsync.
+
+    :param js_read_stream:
+        The JavaScript stream reader
+
+    :param timeout:
+        Timeout in seconds
+
+    :param request:
+        The request we're handling
+
+    :param response:
+        The response this stream relates to
+
+    :param js_abort_controller:
+        A JavaScript AbortController object, used for timeouts
+    """
+
+    def __init__(
+        self,
+        js_read_stream: Any,
+        timeout: float,
+        request: EmscriptenRequest,
+        response: EmscriptenResponse,
+        js_abort_controller: Any,  # JavaScript AbortController for timeouts
+    ):
+        self.js_read_stream = js_read_stream
+        self.timeout = timeout
+        self._is_closed = False
+        self._is_done = False
+        self.request: EmscriptenRequest | None = request
+        self.response: EmscriptenResponse | None = response
+        self.current_buffer = None
+        self.current_buffer_pos = 0
+        self.js_abort_controller = js_abort_controller
+
+    def __del__(self) -> None:
+        self.close()
+
+    # this is compatible with _base_connection
+    def is_closed(self) -> bool:
+        return self._is_closed
+
+    # for compatibility with RawIOBase
+    @property
+    def closed(self) -> bool:
+        return self.is_closed()
+
+    def close(self) -> None:
+        if self.is_closed():
+            return
+        self.read_len = 0
+        self.read_pos = 0
+        self.js_read_stream.cancel()
+        self.js_read_stream = None
+        self._is_closed = True
+        self._is_done = True
+        self.request = None
+        self.response = None
+        super().close()
+
+    def readable(self) -> bool:
+        return True
+
+    def writable(self) -> bool:
+        return False
+
+    def seekable(self) -> bool:
+        return False
+
+    def _get_next_buffer(self) -> bool:
+        result_js = _run_sync_with_timeout(
+            self.js_read_stream.read(),
+            self.timeout,
+            self.js_abort_controller,
+            request=self.request,
+            response=self.response,
+        )
+        if result_js.done:
+            self._is_done = True
+            return False
+        else:
+            self.current_buffer = result_js.value.to_py()
+            self.current_buffer_pos = 0
+            return True
+
+    def readinto(self, byte_obj: Buffer) -> int:
+        if self.current_buffer is None:
+            if not self._get_next_buffer() or self.current_buffer is None:
+                self.close()
+                return 0
+        ret_length = min(
+            len(byte_obj), len(self.current_buffer) - self.current_buffer_pos
+        )
+        byte_obj[0:ret_length] = self.current_buffer[
+            self.current_buffer_pos : self.current_buffer_pos + ret_length
+        ]
+        self.current_buffer_pos += ret_length
+        if self.current_buffer_pos == len(self.current_buffer):
+            self.current_buffer = None
+        return ret_length
+
+
+# check if we are in a worker or not
+def is_in_browser_main_thread() -> bool:
+    return hasattr(js, "window") and hasattr(js, "self") and js.self == js.window
+
+
+def is_cross_origin_isolated() -> bool:
+    return hasattr(js, "crossOriginIsolated") and js.crossOriginIsolated
+
+
+def is_in_node() -> bool:
+    return (
+        hasattr(js, "process")
+        and hasattr(js.process, "release")
+        and hasattr(js.process.release, "name")
+        and js.process.release.name == "node"
+    )
+
+
+def is_worker_available() -> bool:
+    return hasattr(js, "Worker") and hasattr(js, "Blob")
+
+
+_fetcher: _StreamingFetcher | None = None
+
+if is_worker_available() and (
+    (is_cross_origin_isolated() and not is_in_browser_main_thread())
+    and (not is_in_node())
+):
+    _fetcher = _StreamingFetcher()
+else:
+    _fetcher = None
+
+
+NODE_JSPI_ERROR = (
+    "urllib3 only works in Node.js with pyodide.runPythonAsync"
+    " and requires the flag --experimental-wasm-stack-switching in "
+    " versions of node <24."
+)
+
+
+def send_streaming_request(request: EmscriptenRequest) -> EmscriptenResponse | None:
+    if has_jspi():
+        return send_jspi_request(request, True)
+    elif is_in_node():
+        raise _RequestError(
+            message=NODE_JSPI_ERROR,
+            request=request,
+            response=None,
+        )
+
+    if _fetcher and streaming_ready():
+        return _fetcher.send(request)
+    else:
+        _show_streaming_warning()
+        return None
+
+
+_SHOWN_TIMEOUT_WARNING = False
+
+
+def _show_timeout_warning() -> None:
+    global _SHOWN_TIMEOUT_WARNING
+    if not _SHOWN_TIMEOUT_WARNING:
+        _SHOWN_TIMEOUT_WARNING = True
+        message = "Warning: Timeout is not available on main browser thread"
+        js.console.warn(message)
+
+
+_SHOWN_STREAMING_WARNING = False
+
+
+def _show_streaming_warning() -> None:
+    global _SHOWN_STREAMING_WARNING
+    if not _SHOWN_STREAMING_WARNING:
+        _SHOWN_STREAMING_WARNING = True
+        message = "Can't stream HTTP requests because: \n"
+        if not is_cross_origin_isolated():
+            message += "  Page is not cross-origin isolated\n"
+        if is_in_browser_main_thread():
+            message += "  Python is running in main browser thread\n"
+        if not is_worker_available():
+            message += " Worker or Blob classes are not available in this environment."  # Defensive: this is always False in browsers that we test in
+        if streaming_ready() is False:
+            message += """ Streaming fetch worker isn't ready. If you want to be sure that streaming fetch
+is working, you need to call: 'await urllib3.contrib.emscripten.fetch.wait_for_streaming_ready()`"""
+        from js import console
+
+        console.warn(message)
+
+
+def send_request(request: EmscriptenRequest) -> EmscriptenResponse:
+    if has_jspi():
+        return send_jspi_request(request, False)
+    elif is_in_node():
+        raise _RequestError(
+            message=NODE_JSPI_ERROR,
+            request=request,
+            response=None,
+        )
+    try:
+        js_xhr = js.XMLHttpRequest.new()
+
+        if not is_in_browser_main_thread():
+            js_xhr.responseType = "arraybuffer"
+            if request.timeout:
+                js_xhr.timeout = int(request.timeout * 1000)
+        else:
+            js_xhr.overrideMimeType("text/plain; charset=ISO-8859-15")
+            if request.timeout:
+                # timeout isn't available on the main thread - show a warning in console
+                # if it is set
+                _show_timeout_warning()
+
+        js_xhr.open(request.method, request.url, False)
+        for name, value in request.headers.items():
+            if name.lower() not in HEADERS_TO_IGNORE:
+                js_xhr.setRequestHeader(name, value)
+
+        js_xhr.send(to_js(request.body))
+
+        headers = dict(Parser().parsestr(js_xhr.getAllResponseHeaders()))
+
+        if not is_in_browser_main_thread():
+            body = js_xhr.response.to_py().tobytes()
+        else:
+            body = js_xhr.response.encode("ISO-8859-15")
+        return EmscriptenResponse(
+            status_code=js_xhr.status, headers=headers, body=body, request=request
+        )
+    except JsException as err:
+        if err.name == "TimeoutError":
+            raise _TimeoutError(err.message, request=request)
+        elif err.name == "NetworkError":
+            raise _RequestError(err.message, request=request)
+        else:
+            # general http error
+            raise _RequestError(err.message, request=request)
+
+
+def send_jspi_request(
+    request: EmscriptenRequest, streaming: bool
+) -> EmscriptenResponse:
+    """
+    Send a request using WebAssembly JavaScript Promise Integration
+    to wrap the asynchronous JavaScript fetch api (experimental).
+
+    :param request:
+        Request to send
+
+    :param streaming:
+        Whether to stream the response
+
+    :return: The response object
+    :rtype: EmscriptenResponse
+    """
+    timeout = request.timeout
+    js_abort_controller = js.AbortController.new()
+    headers = {k: v for k, v in request.headers.items() if k not in HEADERS_TO_IGNORE}
+    req_body = request.body
+    fetch_data = {
+        "headers": headers,
+        "body": to_js(req_body),
+        "method": request.method,
+        "signal": js_abort_controller.signal,
+    }
+    # Call JavaScript fetch (async api, returns a promise)
+    fetcher_promise_js = js.fetch(request.url, _obj_from_dict(fetch_data))
+    # Now suspend WebAssembly until we resolve that promise
+    # or time out.
+    response_js = _run_sync_with_timeout(
+        fetcher_promise_js,
+        timeout,
+        js_abort_controller,
+        request=request,
+        response=None,
+    )
+    headers = {}
+    header_iter = response_js.headers.entries()
+    while True:
+        iter_value_js = header_iter.next()
+        if getattr(iter_value_js, "done", False):
+            break
+        else:
+            headers[str(iter_value_js.value[0])] = str(iter_value_js.value[1])
+    status_code = response_js.status
+    body: bytes | io.RawIOBase = b""
+
+    response = EmscriptenResponse(
+        status_code=status_code, headers=headers, body=b"", request=request
+    )
+    if streaming:
+        # get via inputstream
+        if response_js.body is not None:
+            # get a reader from the fetch response
+            body_stream_js = response_js.body.getReader()
+            body = _JSPIReadStream(
+                body_stream_js, timeout, request, response, js_abort_controller
+            )
+    else:
+        # get directly via arraybuffer
+        # n.b. this is another async JavaScript call.
+        body = _run_sync_with_timeout(
+            response_js.arrayBuffer(),
+            timeout,
+            js_abort_controller,
+            request=request,
+            response=response,
+        ).to_py()
+    response.body = body
+    return response
+
+
+def _run_sync_with_timeout(
+    promise: Any,
+    timeout: float,
+    js_abort_controller: Any,
+    request: EmscriptenRequest | None,
+    response: EmscriptenResponse | None,
+) -> Any:
+    """
+    Await a JavaScript promise synchronously with a timeout which is implemented
+    via the AbortController
+
+    :param promise:
+        Javascript promise to await
+
+    :param timeout:
+        Timeout in seconds
+
+    :param js_abort_controller:
+        A JavaScript AbortController object, used on timeout
+
+    :param request:
+        The request being handled
+
+    :param response:
+        The response being handled (if it exists yet)
+
+    :raises _TimeoutError: If the request times out
+    :raises _RequestError: If the request raises a JavaScript exception
+
+    :return: The result of awaiting the promise.
+    """
+    timer_id = None
+    if timeout > 0:
+        timer_id = js.setTimeout(
+            js_abort_controller.abort.bind(js_abort_controller), int(timeout * 1000)
+        )
+    try:
+        from pyodide.ffi import run_sync
+
+        # run_sync here uses WebAssembly JavaScript Promise Integration to
+        # suspend python until the JavaScript promise resolves.
+        return run_sync(promise)
+    except JsException as err:
+        if err.name == "AbortError":
+            raise _TimeoutError(
+                message="Request timed out", request=request, response=response
+            )
+        else:
+            raise _RequestError(message=err.message, request=request, response=response)
+    finally:
+        if timer_id is not None:
+            js.clearTimeout(timer_id)
+
+
+def has_jspi() -> bool:
+    """
+    Return true if jspi can be used.
+
+    This requires both browser support and also WebAssembly
+    to be in the correct state - i.e. that the javascript
+    call into python was async not sync.
+
+    :return: True if jspi can be used.
+    :rtype: bool
+    """
+    try:
+        from pyodide.ffi import can_run_sync, run_sync  # noqa: F401
+
+        return bool(can_run_sync())
+    except ImportError:
+        return False
+
+
+def streaming_ready() -> bool | None:
+    if _fetcher:
+        return _fetcher.streaming_ready
+    else:
+        return None  # no fetcher, return None to signify that
+
+
+async def wait_for_streaming_ready() -> bool:
+    if _fetcher:
+        await _fetcher.js_worker_ready_promise
+        return True
+    else:
+        return False

Scripts/reporter_lib/py38+/urllib3/contrib/emscripten/request.py

@@ -0,0 +1,22 @@
+from __future__ import annotations
+
+from dataclasses import dataclass, field
+
+from ..._base_connection import _TYPE_BODY
+
+
+@dataclass
+class EmscriptenRequest:
+    method: str
+    url: str
+    params: dict[str, str] | None = None
+    body: _TYPE_BODY | None = None
+    headers: dict[str, str] = field(default_factory=dict)
+    timeout: float = 0
+    decode_content: bool = True
+
+    def set_header(self, name: str, value: str) -> None:
+        self.headers[name.capitalize()] = value
+
+    def set_body(self, body: _TYPE_BODY | None) -> None:
+        self.body = body

Scripts/reporter_lib/py38+/urllib3/contrib/emscripten/response.py

@@ -0,0 +1,285 @@
+from __future__ import annotations
+
+import json as _json
+import logging
+import typing
+from contextlib import contextmanager
+from dataclasses import dataclass
+from http.client import HTTPException as HTTPException
+from io import BytesIO, IOBase
+
+from ...exceptions import InvalidHeader, TimeoutError
+from ...response import BaseHTTPResponse
+from ...util.retry import Retry
+from .request import EmscriptenRequest
+
+if typing.TYPE_CHECKING:
+    from ..._base_connection import BaseHTTPConnection, BaseHTTPSConnection
+
+log = logging.getLogger(__name__)
+
+
+@dataclass
+class EmscriptenResponse:
+    status_code: int
+    headers: dict[str, str]
+    body: IOBase | bytes
+    request: EmscriptenRequest
+
+
+class EmscriptenHttpResponseWrapper(BaseHTTPResponse):
+    def __init__(
+        self,
+        internal_response: EmscriptenResponse,
+        url: str | None = None,
+        connection: BaseHTTPConnection | BaseHTTPSConnection | None = None,
+    ):
+        self._pool = None  # set by pool class
+        self._body = None
+        self._response = internal_response
+        self._url = url
+        self._connection = connection
+        self._closed = False
+        super().__init__(
+            headers=internal_response.headers,
+            status=internal_response.status_code,
+            request_url=url,
+            version=0,
+            version_string="HTTP/?",
+            reason="",
+            decode_content=True,
+        )
+        self.length_remaining = self._init_length(self._response.request.method)
+        self.length_is_certain = False
+
+    @property
+    def url(self) -> str | None:
+        return self._url
+
+    @url.setter
+    def url(self, url: str | None) -> None:
+        self._url = url
+
+    @property
+    def connection(self) -> BaseHTTPConnection | BaseHTTPSConnection | None:
+        return self._connection
+
+    @property
+    def retries(self) -> Retry | None:
+        return self._retries
+
+    @retries.setter
+    def retries(self, retries: Retry | None) -> None:
+        # Override the request_url if retries has a redirect location.
+        self._retries = retries
+
+    def stream(
+        self, amt: int | None = 2**16, decode_content: bool | None = None
+    ) -> typing.Generator[bytes]:
+        """
+        A generator wrapper for the read() method. A call will block until
+        ``amt`` bytes have been read from the connection or until the
+        connection is closed.
+
+        :param amt:
+            How much of the content to read. The generator will return up to
+            much data per iteration, but may return less. This is particularly
+            likely when using compressed data. However, the empty string will
+            never be returned.
+
+        :param decode_content:
+            If True, will attempt to decode the body based on the
+            'content-encoding' header.
+        """
+        while True:
+            data = self.read(amt=amt, decode_content=decode_content)
+
+            if data:
+                yield data
+            else:
+                break
+
+    def _init_length(self, request_method: str | None) -> int | None:
+        length: int | None
+        content_length: str | None = self.headers.get("content-length")
+
+        if content_length is not None:
+            try:
+                # RFC 7230 section 3.3.2 specifies multiple content lengths can
+                # be sent in a single Content-Length header
+                # (e.g. Content-Length: 42, 42). This line ensures the values
+                # are all valid ints and that as long as the `set` length is 1,
+                # all values are the same. Otherwise, the header is invalid.
+                lengths = {int(val) for val in content_length.split(",")}
+                if len(lengths) > 1:
+                    raise InvalidHeader(
+                        "Content-Length contained multiple "
+                        "unmatching values (%s)" % content_length
+                    )
+                length = lengths.pop()
+            except ValueError:
+                length = None
+            else:
+                if length < 0:
+                    length = None
+
+        else:  # if content_length is None
+            length = None
+
+        # Check for responses that shouldn't include a body
+        if (
+            self.status in (204, 304)
+            or 100 <= self.status < 200
+            or request_method == "HEAD"
+        ):
+            length = 0
+
+        return length
+
+    def read(
+        self,
+        amt: int | None = None,
+        decode_content: bool | None = None,  # ignored because browser decodes always
+        cache_content: bool = False,
+    ) -> bytes:
+        if (
+            self._closed
+            or self._response is None
+            or (isinstance(self._response.body, IOBase) and self._response.body.closed)
+        ):
+            return b""
+
+        with self._error_catcher():
+            # body has been preloaded as a string by XmlHttpRequest
+            if not isinstance(self._response.body, IOBase):
+                self.length_remaining = len(self._response.body)
+                self.length_is_certain = True
+                # wrap body in IOStream
+                self._response.body = BytesIO(self._response.body)
+            if amt is not None and amt >= 0:
+                # don't cache partial content
+                cache_content = False
+                data = self._response.body.read(amt)
+                if self.length_remaining is not None:
+                    self.length_remaining = max(self.length_remaining - len(data), 0)
+                if (self.length_is_certain and self.length_remaining == 0) or len(
+                    data
+                ) < amt:
+                    # definitely finished reading, close response stream
+                    self._response.body.close()
+                return typing.cast(bytes, data)
+            else:  # read all we can (and cache it)
+                data = self._response.body.read()
+                if cache_content:
+                    self._body = data
+                if self.length_remaining is not None:
+                    self.length_remaining = max(self.length_remaining - len(data), 0)
+                if len(data) == 0 or (
+                    self.length_is_certain and self.length_remaining == 0
+                ):
+                    # definitely finished reading, close response stream
+                    self._response.body.close()
+                return typing.cast(bytes, data)
+
+    def read_chunked(
+        self,
+        amt: int | None = None,
+        decode_content: bool | None = None,
+    ) -> typing.Generator[bytes]:
+        # chunked is handled by browser
+        while True:
+            bytes = self.read(amt, decode_content)
+            if not bytes:
+                break
+            yield bytes
+
+    def release_conn(self) -> None:
+        if not self._pool or not self._connection:
+            return None
+
+        self._pool._put_conn(self._connection)
+        self._connection = None
+
+    def drain_conn(self) -> None:
+        self.close()
+
+    @property
+    def data(self) -> bytes:
+        if self._body:
+            return self._body
+        else:
+            return self.read(cache_content=True)
+
+    def json(self) -> typing.Any:
+        """
+        Deserializes the body of the HTTP response as a Python object.
+
+        The body of the HTTP response must be encoded using UTF-8, as per
+        `RFC 8529 Section 8.1 <https://www.rfc-editor.org/rfc/rfc8259#section-8.1>`_.
+
+        To use a custom JSON decoder pass the result of :attr:`HTTPResponse.data` to
+        your custom decoder instead.
+
+        If the body of the HTTP response is not decodable to UTF-8, a
+        `UnicodeDecodeError` will be raised. If the body of the HTTP response is not a
+        valid JSON document, a `json.JSONDecodeError` will be raised.
+
+        Read more :ref:`here <json_content>`.
+
+        :returns: The body of the HTTP response as a Python object.
+        """
+        data = self.data.decode("utf-8")
+        return _json.loads(data)
+
+    def close(self) -> None:
+        if not self._closed:
+            if isinstance(self._response.body, IOBase):
+                self._response.body.close()
+            if self._connection:
+                self._connection.close()
+                self._connection = None
+            self._closed = True
+
+    @contextmanager
+    def _error_catcher(self) -> typing.Generator[None]:
+        """
+        Catch Emscripten specific exceptions thrown by fetch.py,
+        instead re-raising urllib3 variants, so that low-level exceptions
+        are not leaked in the high-level api.
+
+        On exit, release the connection back to the pool.
+        """
+        from .fetch import _RequestError, _TimeoutError  # avoid circular import
+
+        clean_exit = False
+
+        try:
+            yield
+            # If no exception is thrown, we should avoid cleaning up
+            # unnecessarily.
+            clean_exit = True
+        except _TimeoutError as e:
+            raise TimeoutError(str(e))
+        except _RequestError as e:
+            raise HTTPException(str(e))
+        finally:
+            # If we didn't terminate cleanly, we need to throw away our
+            # connection.
+            if not clean_exit:
+                # The response may not be closed but we're not going to use it
+                # anymore so close it now
+                if (
+                    isinstance(self._response.body, IOBase)
+                    and not self._response.body.closed
+                ):
+                    self._response.body.close()
+                # release the connection back to the pool
+                self.release_conn()
+            else:
+                # If we have read everything from the response stream,
+                # return the connection back to the pool.
+                if (
+                    isinstance(self._response.body, IOBase)
+                    and self._response.body.closed
+                ):
+                    self.release_conn()

Scripts/reporter_lib/py38+/urllib3/contrib/pyopenssl.py

@@ -0,0 +1,554 @@
+"""
+Module for using pyOpenSSL as a TLS backend. This module was relevant before
+the standard library ``ssl`` module supported SNI, but now that we've dropped
+support for Python 2.7 all relevant Python versions support SNI so
+**this module is no longer recommended**.
+
+This needs the following packages installed:
+
+* `pyOpenSSL`_ (tested with 16.0.0)
+* `cryptography`_ (minimum 1.3.4, from pyopenssl)
+* `idna`_ (minimum 2.0)
+
+However, pyOpenSSL depends on cryptography, so while we use all three directly here we
+end up having relatively few packages required.
+
+You can install them with the following command:
+
+.. code-block:: bash
+
+    $ python -m pip install pyopenssl cryptography idna
+
+To activate certificate checking, call
+:func:`~urllib3.contrib.pyopenssl.inject_into_urllib3` from your Python code
+before you begin making HTTP requests. This can be done in a ``sitecustomize``
+module, or at any other time before your application begins using ``urllib3``,
+like this:
+
+.. code-block:: python
+
+    try:
+        import urllib3.contrib.pyopenssl
+        urllib3.contrib.pyopenssl.inject_into_urllib3()
+    except ImportError:
+        pass
+
+.. _pyopenssl: https://www.pyopenssl.org
+.. _cryptography: https://cryptography.io
+.. _idna: https://github.com/kjd/idna
+"""
+
+from __future__ import annotations
+
+import OpenSSL.SSL  # type: ignore[import-untyped]
+from cryptography import x509
+
+try:
+    from cryptography.x509 import UnsupportedExtension  # type: ignore[attr-defined]
+except ImportError:
+    # UnsupportedExtension is gone in cryptography >= 2.1.0
+    class UnsupportedExtension(Exception):  # type: ignore[no-redef]
+        pass
+
+
+import logging
+import ssl
+import typing
+from io import BytesIO
+from socket import socket as socket_cls
+from socket import timeout
+
+from .. import util
+
+if typing.TYPE_CHECKING:
+    from OpenSSL.crypto import X509  # type: ignore[import-untyped]
+
+
+__all__ = ["inject_into_urllib3", "extract_from_urllib3"]
+
+# Map from urllib3 to PyOpenSSL compatible parameter-values.
+_openssl_versions: dict[int, int] = {
+    util.ssl_.PROTOCOL_TLS: OpenSSL.SSL.SSLv23_METHOD,  # type: ignore[attr-defined]
+    util.ssl_.PROTOCOL_TLS_CLIENT: OpenSSL.SSL.SSLv23_METHOD,  # type: ignore[attr-defined]
+    ssl.PROTOCOL_TLSv1: OpenSSL.SSL.TLSv1_METHOD,
+}
+
+if hasattr(ssl, "PROTOCOL_TLSv1_1") and hasattr(OpenSSL.SSL, "TLSv1_1_METHOD"):
+    _openssl_versions[ssl.PROTOCOL_TLSv1_1] = OpenSSL.SSL.TLSv1_1_METHOD
+
+if hasattr(ssl, "PROTOCOL_TLSv1_2") and hasattr(OpenSSL.SSL, "TLSv1_2_METHOD"):
+    _openssl_versions[ssl.PROTOCOL_TLSv1_2] = OpenSSL.SSL.TLSv1_2_METHOD
+
+
+_stdlib_to_openssl_verify = {
+    ssl.CERT_NONE: OpenSSL.SSL.VERIFY_NONE,
+    ssl.CERT_OPTIONAL: OpenSSL.SSL.VERIFY_PEER,
+    ssl.CERT_REQUIRED: OpenSSL.SSL.VERIFY_PEER
+    + OpenSSL.SSL.VERIFY_FAIL_IF_NO_PEER_CERT,
+}
+_openssl_to_stdlib_verify = {v: k for k, v in _stdlib_to_openssl_verify.items()}
+
+# The SSLvX values are the most likely to be missing in the future
+# but we check them all just to be sure.
+_OP_NO_SSLv2_OR_SSLv3: int = getattr(OpenSSL.SSL, "OP_NO_SSLv2", 0) | getattr(
+    OpenSSL.SSL, "OP_NO_SSLv3", 0
+)
+_OP_NO_TLSv1: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1", 0)
+_OP_NO_TLSv1_1: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1_1", 0)
+_OP_NO_TLSv1_2: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1_2", 0)
+_OP_NO_TLSv1_3: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1_3", 0)
+
+_openssl_to_ssl_minimum_version: dict[int, int] = {
+    ssl.TLSVersion.MINIMUM_SUPPORTED: _OP_NO_SSLv2_OR_SSLv3,
+    ssl.TLSVersion.TLSv1: _OP_NO_SSLv2_OR_SSLv3,
+    ssl.TLSVersion.TLSv1_1: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1,
+    ssl.TLSVersion.TLSv1_2: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1 | _OP_NO_TLSv1_1,
+    ssl.TLSVersion.TLSv1_3: (
+        _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1 | _OP_NO_TLSv1_1 | _OP_NO_TLSv1_2
+    ),
+    ssl.TLSVersion.MAXIMUM_SUPPORTED: (
+        _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1 | _OP_NO_TLSv1_1 | _OP_NO_TLSv1_2
+    ),
+}
+_openssl_to_ssl_maximum_version: dict[int, int] = {
+    ssl.TLSVersion.MINIMUM_SUPPORTED: (
+        _OP_NO_SSLv2_OR_SSLv3
+        | _OP_NO_TLSv1
+        | _OP_NO_TLSv1_1
+        | _OP_NO_TLSv1_2
+        | _OP_NO_TLSv1_3
+    ),
+    ssl.TLSVersion.TLSv1: (
+        _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1_1 | _OP_NO_TLSv1_2 | _OP_NO_TLSv1_3
+    ),
+    ssl.TLSVersion.TLSv1_1: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1_2 | _OP_NO_TLSv1_3,
+    ssl.TLSVersion.TLSv1_2: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1_3,
+    ssl.TLSVersion.TLSv1_3: _OP_NO_SSLv2_OR_SSLv3,
+    ssl.TLSVersion.MAXIMUM_SUPPORTED: _OP_NO_SSLv2_OR_SSLv3,
+}
+
+# OpenSSL will only write 16K at a time
+SSL_WRITE_BLOCKSIZE = 16384
+
+orig_util_SSLContext = util.ssl_.SSLContext
+
+
+log = logging.getLogger(__name__)
+
+
+def inject_into_urllib3() -> None:
+    "Monkey-patch urllib3 with PyOpenSSL-backed SSL-support."
+
+    _validate_dependencies_met()
+
+    util.SSLContext = PyOpenSSLContext  # type: ignore[assignment]
+    util.ssl_.SSLContext = PyOpenSSLContext  # type: ignore[assignment]
+    util.IS_PYOPENSSL = True
+    util.ssl_.IS_PYOPENSSL = True
+
+
+def extract_from_urllib3() -> None:
+    "Undo monkey-patching by :func:`inject_into_urllib3`."
+
+    util.SSLContext = orig_util_SSLContext
+    util.ssl_.SSLContext = orig_util_SSLContext
+    util.IS_PYOPENSSL = False
+    util.ssl_.IS_PYOPENSSL = False
+
+
+def _validate_dependencies_met() -> None:
+    """
+    Verifies that PyOpenSSL's package-level dependencies have been met.
+    Throws `ImportError` if they are not met.
+    """
+    # Method added in `cryptography==1.1`; not available in older versions
+    from cryptography.x509.extensions import Extensions
+
+    if getattr(Extensions, "get_extension_for_class", None) is None:
+        raise ImportError(
+            "'cryptography' module missing required functionality.  "
+            "Try upgrading to v1.3.4 or newer."
+        )
+
+    # pyOpenSSL 0.14 and above use cryptography for OpenSSL bindings. The _x509
+    # attribute is only present on those versions.
+    from OpenSSL.crypto import X509
+
+    x509 = X509()
+    if getattr(x509, "_x509", None) is None:
+        raise ImportError(
+            "'pyOpenSSL' module missing required functionality. "
+            "Try upgrading to v0.14 or newer."
+        )
+
+
+def _dnsname_to_stdlib(name: str) -> str | None:
+    """
+    Converts a dNSName SubjectAlternativeName field to the form used by the
+    standard library on the given Python version.
+
+    Cryptography produces a dNSName as a unicode string that was idna-decoded
+    from ASCII bytes. We need to idna-encode that string to get it back, and
+    then on Python 3 we also need to convert to unicode via UTF-8 (the stdlib
+    uses PyUnicode_FromStringAndSize on it, which decodes via UTF-8).
+
+    If the name cannot be idna-encoded then we return None signalling that
+    the name given should be skipped.
+    """
+
+    def idna_encode(name: str) -> bytes | None:
+        """
+        Borrowed wholesale from the Python Cryptography Project. It turns out
+        that we can't just safely call `idna.encode`: it can explode for
+        wildcard names. This avoids that problem.
+        """
+        import idna
+
+        try:
+            for prefix in ["*.", "."]:
+                if name.startswith(prefix):
+                    name = name[len(prefix) :]
+                    return prefix.encode("ascii") + idna.encode(name)
+            return idna.encode(name)
+        except idna.core.IDNAError:
+            return None
+
+    # Don't send IPv6 addresses through the IDNA encoder.
+    if ":" in name:
+        return name
+
+    encoded_name = idna_encode(name)
+    if encoded_name is None:
+        return None
+    return encoded_name.decode("utf-8")
+
+
+def get_subj_alt_name(peer_cert: X509) -> list[tuple[str, str]]:
+    """
+    Given an PyOpenSSL certificate, provides all the subject alternative names.
+    """
+    cert = peer_cert.to_cryptography()
+
+    # We want to find the SAN extension. Ask Cryptography to locate it (it's
+    # faster than looping in Python)
+    try:
+        ext = cert.extensions.get_extension_for_class(x509.SubjectAlternativeName).value
+    except x509.ExtensionNotFound:
+        # No such extension, return the empty list.
+        return []
+    except (
+        x509.DuplicateExtension,
+        UnsupportedExtension,
+        x509.UnsupportedGeneralNameType,
+        UnicodeError,
+    ) as e:
+        # A problem has been found with the quality of the certificate. Assume
+        # no SAN field is present.
+        log.warning(
+            "A problem was encountered with the certificate that prevented "
+            "urllib3 from finding the SubjectAlternativeName field. This can "
+            "affect certificate validation. The error was %s",
+            e,
+        )
+        return []
+
+    # We want to return dNSName and iPAddress fields. We need to cast the IPs
+    # back to strings because the match_hostname function wants them as
+    # strings.
+    # Sadly the DNS names need to be idna encoded and then, on Python 3, UTF-8
+    # decoded. This is pretty frustrating, but that's what the standard library
+    # does with certificates, and so we need to attempt to do the same.
+    # We also want to skip over names which cannot be idna encoded.
+    names = [
+        ("DNS", name)
+        for name in map(_dnsname_to_stdlib, ext.get_values_for_type(x509.DNSName))
+        if name is not None
+    ]
+    names.extend(
+        ("IP Address", str(name)) for name in ext.get_values_for_type(x509.IPAddress)
+    )
+
+    return names
+
+
+class WrappedSocket:
+    """API-compatibility wrapper for Python OpenSSL's Connection-class."""
+
+    def __init__(
+        self,
+        connection: OpenSSL.SSL.Connection,
+        socket: socket_cls,
+        suppress_ragged_eofs: bool = True,
+    ) -> None:
+        self.connection = connection
+        self.socket = socket
+        self.suppress_ragged_eofs = suppress_ragged_eofs
+        self._io_refs = 0
+        self._closed = False
+
+    def fileno(self) -> int:
+        return self.socket.fileno()
+
+    # Copy-pasted from Python 3.5 source code
+    def _decref_socketios(self) -> None:
+        if self._io_refs > 0:
+            self._io_refs -= 1
+        if self._closed:
+            self.close()
+
+    def recv(self, *args: typing.Any, **kwargs: typing.Any) -> bytes:
+        try:
+            data = self.connection.recv(*args, **kwargs)
+        except OpenSSL.SSL.SysCallError as e:
+            if self.suppress_ragged_eofs and e.args == (-1, "Unexpected EOF"):
+                return b""
+            else:
+                raise OSError(e.args[0], str(e)) from e
+        except OpenSSL.SSL.ZeroReturnError:
+            if self.connection.get_shutdown() == OpenSSL.SSL.RECEIVED_SHUTDOWN:
+                return b""
+            else:
+                raise
+        except OpenSSL.SSL.WantReadError as e:
+            if not util.wait_for_read(self.socket, self.socket.gettimeout()):
+                raise timeout("The read operation timed out") from e
+            else:
+                return self.recv(*args, **kwargs)
+
+        # TLS 1.3 post-handshake authentication
+        except OpenSSL.SSL.Error as e:
+            raise ssl.SSLError(f"read error: {e!r}") from e
+        else:
+            return data  # type: ignore[no-any-return]
+
+    def recv_into(self, *args: typing.Any, **kwargs: typing.Any) -> int:
+        try:
+            return self.connection.recv_into(*args, **kwargs)  # type: ignore[no-any-return]
+        except OpenSSL.SSL.SysCallError as e:
+            if self.suppress_ragged_eofs and e.args == (-1, "Unexpected EOF"):
+                return 0
+            else:
+                raise OSError(e.args[0], str(e)) from e
+        except OpenSSL.SSL.ZeroReturnError:
+            if self.connection.get_shutdown() == OpenSSL.SSL.RECEIVED_SHUTDOWN:
+                return 0
+            else:
+                raise
+        except OpenSSL.SSL.WantReadError as e:
+            if not util.wait_for_read(self.socket, self.socket.gettimeout()):
+                raise timeout("The read operation timed out") from e
+            else:
+                return self.recv_into(*args, **kwargs)
+
+        # TLS 1.3 post-handshake authentication
+        except OpenSSL.SSL.Error as e:
+            raise ssl.SSLError(f"read error: {e!r}") from e
+
+    def settimeout(self, timeout: float) -> None:
+        return self.socket.settimeout(timeout)
+
+    def _send_until_done(self, data: bytes) -> int:
+        while True:
+            try:
+                return self.connection.send(data)  # type: ignore[no-any-return]
+            except OpenSSL.SSL.WantWriteError as e:
+                if not util.wait_for_write(self.socket, self.socket.gettimeout()):
+                    raise timeout() from e
+                continue
+            except OpenSSL.SSL.SysCallError as e:
+                raise OSError(e.args[0], str(e)) from e
+
+    def sendall(self, data: bytes) -> None:
+        total_sent = 0
+        while total_sent < len(data):
+            sent = self._send_until_done(
+                data[total_sent : total_sent + SSL_WRITE_BLOCKSIZE]
+            )
+            total_sent += sent
+
+    def shutdown(self, how: int) -> None:
+        try:
+            self.connection.shutdown()
+        except OpenSSL.SSL.Error as e:
+            raise ssl.SSLError(f"shutdown error: {e!r}") from e
+
+    def close(self) -> None:
+        self._closed = True
+        if self._io_refs <= 0:
+            self._real_close()
+
+    def _real_close(self) -> None:
+        try:
+            return self.connection.close()  # type: ignore[no-any-return]
+        except OpenSSL.SSL.Error:
+            return
+
+    def getpeercert(
+        self, binary_form: bool = False
+    ) -> dict[str, list[typing.Any]] | None:
+        x509 = self.connection.get_peer_certificate()
+
+        if not x509:
+            return x509  # type: ignore[no-any-return]
+
+        if binary_form:
+            return OpenSSL.crypto.dump_certificate(OpenSSL.crypto.FILETYPE_ASN1, x509)  # type: ignore[no-any-return]
+
+        return {
+            "subject": ((("commonName", x509.get_subject().CN),),),  # type: ignore[dict-item]
+            "subjectAltName": get_subj_alt_name(x509),
+        }
+
+    def version(self) -> str:
+        return self.connection.get_protocol_version_name()  # type: ignore[no-any-return]
+
+    def selected_alpn_protocol(self) -> str | None:
+        alpn_proto = self.connection.get_alpn_proto_negotiated()
+        return alpn_proto.decode() if alpn_proto else None
+
+
+WrappedSocket.makefile = socket_cls.makefile  # type: ignore[attr-defined]
+
+
+class PyOpenSSLContext:
+    """
+    I am a wrapper class for the PyOpenSSL ``Context`` object. I am responsible
+    for translating the interface of the standard library ``SSLContext`` object
+    to calls into PyOpenSSL.
+    """
+
+    def __init__(self, protocol: int) -> None:
+        self.protocol = _openssl_versions[protocol]
+        self._ctx = OpenSSL.SSL.Context(self.protocol)
+        self._options = 0
+        self.check_hostname = False
+        self._minimum_version: int = ssl.TLSVersion.MINIMUM_SUPPORTED
+        self._maximum_version: int = ssl.TLSVersion.MAXIMUM_SUPPORTED
+
+    @property
+    def options(self) -> int:
+        return self._options
+
+    @options.setter
+    def options(self, value: int) -> None:
+        self._options = value
+        self._set_ctx_options()
+
+    @property
+    def verify_mode(self) -> int:
+        return _openssl_to_stdlib_verify[self._ctx.get_verify_mode()]
+
+    @verify_mode.setter
+    def verify_mode(self, value: ssl.VerifyMode) -> None:
+        self._ctx.set_verify(_stdlib_to_openssl_verify[value], _verify_callback)
+
+    def set_default_verify_paths(self) -> None:
+        self._ctx.set_default_verify_paths()
+
+    def set_ciphers(self, ciphers: bytes | str) -> None:
+        if isinstance(ciphers, str):
+            ciphers = ciphers.encode("utf-8")
+        self._ctx.set_cipher_list(ciphers)
+
+    def load_verify_locations(
+        self,
+        cafile: str | None = None,
+        capath: str | None = None,
+        cadata: bytes | None = None,
+    ) -> None:
+        if cafile is not None:
+            cafile = cafile.encode("utf-8")  # type: ignore[assignment]
+        if capath is not None:
+            capath = capath.encode("utf-8")  # type: ignore[assignment]
+        try:
+            self._ctx.load_verify_locations(cafile, capath)
+            if cadata is not None:
+                self._ctx.load_verify_locations(BytesIO(cadata))
+        except OpenSSL.SSL.Error as e:
+            raise ssl.SSLError(f"unable to load trusted certificates: {e!r}") from e
+
+    def load_cert_chain(
+        self,
+        certfile: str,
+        keyfile: str | None = None,
+        password: str | None = None,
+    ) -> None:
+        try:
+            self._ctx.use_certificate_chain_file(certfile)
+            if password is not None:
+                if not isinstance(password, bytes):
+                    password = password.encode("utf-8")  # type: ignore[assignment]
+                self._ctx.set_passwd_cb(lambda *_: password)
+            self._ctx.use_privatekey_file(keyfile or certfile)
+        except OpenSSL.SSL.Error as e:
+            raise ssl.SSLError(f"Unable to load certificate chain: {e!r}") from e
+
+    def set_alpn_protocols(self, protocols: list[bytes | str]) -> None:
+        protocols = [util.util.to_bytes(p, "ascii") for p in protocols]
+        return self._ctx.set_alpn_protos(protocols)  # type: ignore[no-any-return]
+
+    def wrap_socket(
+        self,
+        sock: socket_cls,
+        server_side: bool = False,
+        do_handshake_on_connect: bool = True,
+        suppress_ragged_eofs: bool = True,
+        server_hostname: bytes | str | None = None,
+    ) -> WrappedSocket:
+        cnx = OpenSSL.SSL.Connection(self._ctx, sock)
+
+        # If server_hostname is an IP, don't use it for SNI, per RFC6066 Section 3
+        if server_hostname and not util.ssl_.is_ipaddress(server_hostname):
+            if isinstance(server_hostname, str):
+                server_hostname = server_hostname.encode("utf-8")
+            cnx.set_tlsext_host_name(server_hostname)
+
+        cnx.set_connect_state()
+
+        while True:
+            try:
+                cnx.do_handshake()
+            except OpenSSL.SSL.WantReadError as e:
+                if not util.wait_for_read(sock, sock.gettimeout()):
+                    raise timeout("select timed out") from e
+                continue
+            except OpenSSL.SSL.Error as e:
+                raise ssl.SSLError(f"bad handshake: {e!r}") from e
+            break
+
+        return WrappedSocket(cnx, sock)
+
+    def _set_ctx_options(self) -> None:
+        self._ctx.set_options(
+            self._options
+            | _openssl_to_ssl_minimum_version[self._minimum_version]
+            | _openssl_to_ssl_maximum_version[self._maximum_version]
+        )
+
+    @property
+    def minimum_version(self) -> int:
+        return self._minimum_version
+
+    @minimum_version.setter
+    def minimum_version(self, minimum_version: int) -> None:
+        self._minimum_version = minimum_version
+        self._set_ctx_options()
+
+    @property
+    def maximum_version(self) -> int:
+        return self._maximum_version
+
+    @maximum_version.setter
+    def maximum_version(self, maximum_version: int) -> None:
+        self._maximum_version = maximum_version
+        self._set_ctx_options()
+
+
+def _verify_callback(
+    cnx: OpenSSL.SSL.Connection,
+    x509: X509,
+    err_no: int,
+    err_depth: int,
+    return_code: int,
+) -> bool:
+    return err_no == 0

Scripts/reporter_lib/py38+/urllib3/contrib/socks.py

@@ -0,0 +1,228 @@
+"""
+This module contains provisional support for SOCKS proxies from within
+urllib3. This module supports SOCKS4, SOCKS4A (an extension of SOCKS4), and
+SOCKS5. To enable its functionality, either install PySocks or install this
+module with the ``socks`` extra.
+
+The SOCKS implementation supports the full range of urllib3 features. It also
+supports the following SOCKS features:
+
+- SOCKS4A (``proxy_url='socks4a://...``)
+- SOCKS4 (``proxy_url='socks4://...``)
+- SOCKS5 with remote DNS (``proxy_url='socks5h://...``)
+- SOCKS5 with local DNS (``proxy_url='socks5://...``)
+- Usernames and passwords for the SOCKS proxy
+
+.. note::
+   It is recommended to use ``socks5h://`` or ``socks4a://`` schemes in
+   your ``proxy_url`` to ensure that DNS resolution is done from the remote
+   server instead of client-side when connecting to a domain name.
+
+SOCKS4 supports IPv4 and domain names with the SOCKS4A extension. SOCKS5
+supports IPv4, IPv6, and domain names.
+
+When connecting to a SOCKS4 proxy the ``username`` portion of the ``proxy_url``
+will be sent as the ``userid`` section of the SOCKS request:
+
+.. code-block:: python
+
+    proxy_url="socks4a://<userid>@proxy-host"
+
+When connecting to a SOCKS5 proxy the ``username`` and ``password`` portion
+of the ``proxy_url`` will be sent as the username/password to authenticate
+with the proxy:
+
+.. code-block:: python
+
+    proxy_url="socks5h://<username>:<password>@proxy-host"
+
+"""
+
+from __future__ import annotations
+
+try:
+    import socks  # type: ignore[import-not-found]
+except ImportError:
+    import warnings
+
+    from ..exceptions import DependencyWarning
+
+    warnings.warn(
+        (
+            "SOCKS support in urllib3 requires the installation of optional "
+            "dependencies: specifically, PySocks.  For more information, see "
+            "https://urllib3.readthedocs.io/en/latest/advanced-usage.html#socks-proxies"
+        ),
+        DependencyWarning,
+    )
+    raise
+
+import typing
+from socket import timeout as SocketTimeout
+
+from ..connection import HTTPConnection, HTTPSConnection
+from ..connectionpool import HTTPConnectionPool, HTTPSConnectionPool
+from ..exceptions import ConnectTimeoutError, NewConnectionError
+from ..poolmanager import PoolManager
+from ..util.url import parse_url
+
+try:
+    import ssl
+except ImportError:
+    ssl = None  # type: ignore[assignment]
+
+
+class _TYPE_SOCKS_OPTIONS(typing.TypedDict):
+    socks_version: int
+    proxy_host: str | None
+    proxy_port: str | None
+    username: str | None
+    password: str | None
+    rdns: bool
+
+
+class SOCKSConnection(HTTPConnection):
+    """
+    A plain-text HTTP connection that connects via a SOCKS proxy.
+    """
+
+    def __init__(
+        self,
+        _socks_options: _TYPE_SOCKS_OPTIONS,
+        *args: typing.Any,
+        **kwargs: typing.Any,
+    ) -> None:
+        self._socks_options = _socks_options
+        super().__init__(*args, **kwargs)
+
+    def _new_conn(self) -> socks.socksocket:
+        """
+        Establish a new connection via the SOCKS proxy.
+        """
+        extra_kw: dict[str, typing.Any] = {}
+        if self.source_address:
+            extra_kw["source_address"] = self.source_address
+
+        if self.socket_options:
+            extra_kw["socket_options"] = self.socket_options
+
+        try:
+            conn = socks.create_connection(
+                (self.host, self.port),
+                proxy_type=self._socks_options["socks_version"],
+                proxy_addr=self._socks_options["proxy_host"],
+                proxy_port=self._socks_options["proxy_port"],
+                proxy_username=self._socks_options["username"],
+                proxy_password=self._socks_options["password"],
+                proxy_rdns=self._socks_options["rdns"],
+                timeout=self.timeout,
+                **extra_kw,
+            )
+
+        except SocketTimeout as e:
+            raise ConnectTimeoutError(
+                self,
+                f"Connection to {self.host} timed out. (connect timeout={self.timeout})",
+            ) from e
+
+        except socks.ProxyError as e:
+            # This is fragile as hell, but it seems to be the only way to raise
+            # useful errors here.
+            if e.socket_err:
+                error = e.socket_err
+                if isinstance(error, SocketTimeout):
+                    raise ConnectTimeoutError(
+                        self,
+                        f"Connection to {self.host} timed out. (connect timeout={self.timeout})",
+                    ) from e
+                else:
+                    # Adding `from e` messes with coverage somehow, so it's omitted.
+                    # See #2386.
+                    raise NewConnectionError(
+                        self, f"Failed to establish a new connection: {error}"
+                    )
+            else:
+                raise NewConnectionError(
+                    self, f"Failed to establish a new connection: {e}"
+                ) from e
+
+        except OSError as e:  # Defensive: PySocks should catch all these.
+            raise NewConnectionError(
+                self, f"Failed to establish a new connection: {e}"
+            ) from e
+
+        return conn
+
+
+# We don't need to duplicate the Verified/Unverified distinction from
+# urllib3/connection.py here because the HTTPSConnection will already have been
+# correctly set to either the Verified or Unverified form by that module. This
+# means the SOCKSHTTPSConnection will automatically be the correct type.
+class SOCKSHTTPSConnection(SOCKSConnection, HTTPSConnection):
+    pass
+
+
+class SOCKSHTTPConnectionPool(HTTPConnectionPool):
+    ConnectionCls = SOCKSConnection
+
+
+class SOCKSHTTPSConnectionPool(HTTPSConnectionPool):
+    ConnectionCls = SOCKSHTTPSConnection
+
+
+class SOCKSProxyManager(PoolManager):
+    """
+    A version of the urllib3 ProxyManager that routes connections via the
+    defined SOCKS proxy.
+    """
+
+    pool_classes_by_scheme = {
+        "http": SOCKSHTTPConnectionPool,
+        "https": SOCKSHTTPSConnectionPool,
+    }
+
+    def __init__(
+        self,
+        proxy_url: str,
+        username: str | None = None,
+        password: str | None = None,
+        num_pools: int = 10,
+        headers: typing.Mapping[str, str] | None = None,
+        **connection_pool_kw: typing.Any,
+    ):
+        parsed = parse_url(proxy_url)
+
+        if username is None and password is None and parsed.auth is not None:
+            split = parsed.auth.split(":")
+            if len(split) == 2:
+                username, password = split
+        if parsed.scheme == "socks5":
+            socks_version = socks.PROXY_TYPE_SOCKS5
+            rdns = False
+        elif parsed.scheme == "socks5h":
+            socks_version = socks.PROXY_TYPE_SOCKS5
+            rdns = True
+        elif parsed.scheme == "socks4":
+            socks_version = socks.PROXY_TYPE_SOCKS4
+            rdns = False
+        elif parsed.scheme == "socks4a":
+            socks_version = socks.PROXY_TYPE_SOCKS4
+            rdns = True
+        else:
+            raise ValueError(f"Unable to determine SOCKS version from {proxy_url}")
+
+        self.proxy_url = proxy_url
+
+        socks_options = {
+            "socks_version": socks_version,
+            "proxy_host": parsed.host,
+            "proxy_port": parsed.port,
+            "username": username,
+            "password": password,
+            "rdns": rdns,
+        }
+        connection_pool_kw["_socks_options"] = socks_options
+
+        super().__init__(num_pools, headers, **connection_pool_kw)
+
+        self.pool_classes_by_scheme = SOCKSProxyManager.pool_classes_by_scheme

Scripts/reporter_lib/py38+/urllib3/exceptions.py

@@ -0,0 +1,327 @@
+from __future__ import annotations
+
+import socket
+import typing
+import warnings
+from email.errors import MessageDefect
+from http.client import IncompleteRead as httplib_IncompleteRead
+
+if typing.TYPE_CHECKING:
+    from .connection import HTTPConnection
+    from .connectionpool import ConnectionPool
+    from .response import HTTPResponse
+    from .util.retry import Retry
+
+# Base Exceptions
+
+
+class HTTPError(Exception):
+    """Base exception used by this module."""
+
+
+class HTTPWarning(Warning):
+    """Base warning used by this module."""
+
+
+_TYPE_REDUCE_RESULT = tuple[typing.Callable[..., object], tuple[object, ...]]
+
+
+class PoolError(HTTPError):
+    """Base exception for errors caused within a pool."""
+
+    def __init__(self, pool: ConnectionPool, message: str) -> None:
+        self.pool = pool
+        super().__init__(f"{pool}: {message}")
+
+    def __reduce__(self) -> _TYPE_REDUCE_RESULT:
+        # For pickling purposes.
+        return self.__class__, (None, None)
+
+
+class RequestError(PoolError):
+    """Base exception for PoolErrors that have associated URLs."""
+
+    def __init__(self, pool: ConnectionPool, url: str, message: str) -> None:
+        self.url = url
+        super().__init__(pool, message)
+
+    def __reduce__(self) -> _TYPE_REDUCE_RESULT:
+        # For pickling purposes.
+        return self.__class__, (None, self.url, None)
+
+
+class SSLError(HTTPError):
+    """Raised when SSL certificate fails in an HTTPS connection."""
+
+
+class ProxyError(HTTPError):
+    """Raised when the connection to a proxy fails."""
+
+    # The original error is also available as __cause__.
+    original_error: Exception
+
+    def __init__(self, message: str, error: Exception) -> None:
+        super().__init__(message, error)
+        self.original_error = error
+
+
+class DecodeError(HTTPError):
+    """Raised when automatic decoding based on Content-Type fails."""
+
+
+class ProtocolError(HTTPError):
+    """Raised when something unexpected happens mid-request/response."""
+
+
+#: Renamed to ProtocolError but aliased for backwards compatibility.
+ConnectionError = ProtocolError
+
+
+# Leaf Exceptions
+
+
+class MaxRetryError(RequestError):
+    """Raised when the maximum number of retries is exceeded.
+
+    :param pool: The connection pool
+    :type pool: :class:`~urllib3.connectionpool.HTTPConnectionPool`
+    :param str url: The requested Url
+    :param reason: The underlying error
+    :type reason: :class:`Exception`
+
+    """
+
+    def __init__(
+        self, pool: ConnectionPool, url: str, reason: Exception | None = None
+    ) -> None:
+        self.reason = reason
+
+        message = f"Max retries exceeded with url: {url} (Caused by {reason!r})"
+
+        super().__init__(pool, url, message)
+
+
+class HostChangedError(RequestError):
+    """Raised when an existing pool gets a request for a foreign host."""
+
+    def __init__(
+        self, pool: ConnectionPool, url: str, retries: Retry | int = 3
+    ) -> None:
+        message = f"Tried to open a foreign host with url: {url}"
+        super().__init__(pool, url, message)
+        self.retries = retries
+
+
+class TimeoutStateError(HTTPError):
+    """Raised when passing an invalid state to a timeout"""
+
+
+class TimeoutError(HTTPError):
+    """Raised when a socket timeout error occurs.
+
+    Catching this error will catch both :exc:`ReadTimeoutErrors
+    <ReadTimeoutError>` and :exc:`ConnectTimeoutErrors <ConnectTimeoutError>`.
+    """
+
+
+class ReadTimeoutError(TimeoutError, RequestError):
+    """Raised when a socket timeout occurs while receiving data from a server"""
+
+
+# This timeout error does not have a URL attached and needs to inherit from the
+# base HTTPError
+class ConnectTimeoutError(TimeoutError):
+    """Raised when a socket timeout occurs while connecting to a server"""
+
+
+class NewConnectionError(ConnectTimeoutError, HTTPError):
+    """Raised when we fail to establish a new connection. Usually ECONNREFUSED."""
+
+    def __init__(self, conn: HTTPConnection, message: str) -> None:
+        self.conn = conn
+        super().__init__(f"{conn}: {message}")
+
+    def __reduce__(self) -> _TYPE_REDUCE_RESULT:
+        # For pickling purposes.
+        return self.__class__, (None, None)
+
+    @property
+    def pool(self) -> HTTPConnection:
+        warnings.warn(
+            "The 'pool' property is deprecated and will be removed "
+            "in urllib3 v2.1.0. Use 'conn' instead.",
+            DeprecationWarning,
+            stacklevel=2,
+        )
+
+        return self.conn
+
+
+class NameResolutionError(NewConnectionError):
+    """Raised when host name resolution fails."""
+
+    def __init__(self, host: str, conn: HTTPConnection, reason: socket.gaierror):
+        message = f"Failed to resolve '{host}' ({reason})"
+        super().__init__(conn, message)
+
+    def __reduce__(self) -> _TYPE_REDUCE_RESULT:
+        # For pickling purposes.
+        return self.__class__, (None, None, None)
+
+
+class EmptyPoolError(PoolError):
+    """Raised when a pool runs out of connections and no more are allowed."""
+
+
+class FullPoolError(PoolError):
+    """Raised when we try to add a connection to a full pool in blocking mode."""
+
+
+class ClosedPoolError(PoolError):
+    """Raised when a request enters a pool after the pool has been closed."""
+
+
+class LocationValueError(ValueError, HTTPError):
+    """Raised when there is something wrong with a given URL input."""
+
+
+class LocationParseError(LocationValueError):
+    """Raised when get_host or similar fails to parse the URL input."""
+
+    def __init__(self, location: str) -> None:
+        message = f"Failed to parse: {location}"
+        super().__init__(message)
+
+        self.location = location
+
+
+class URLSchemeUnknown(LocationValueError):
+    """Raised when a URL input has an unsupported scheme."""
+
+    def __init__(self, scheme: str):
+        message = f"Not supported URL scheme {scheme}"
+        super().__init__(message)
+
+        self.scheme = scheme
+
+
+class ResponseError(HTTPError):
+    """Used as a container for an error reason supplied in a MaxRetryError."""
+
+    GENERIC_ERROR = "too many error responses"
+    SPECIFIC_ERROR = "too many {status_code} error responses"
+
+
+class SecurityWarning(HTTPWarning):
+    """Warned when performing security reducing actions"""
+
+
+class InsecureRequestWarning(SecurityWarning):
+    """Warned when making an unverified HTTPS request."""
+
+
+class NotOpenSSLWarning(SecurityWarning):
+    """Warned when using unsupported SSL library"""
+
+
+class SystemTimeWarning(SecurityWarning):
+    """Warned when system time is suspected to be wrong"""
+
+
+class InsecurePlatformWarning(SecurityWarning):
+    """Warned when certain TLS/SSL configuration is not available on a platform."""
+
+
+class DependencyWarning(HTTPWarning):
+    """
+    Warned when an attempt is made to import a module with missing optional
+    dependencies.
+    """
+
+
+class ResponseNotChunked(ProtocolError, ValueError):
+    """Response needs to be chunked in order to read it as chunks."""
+
+
+class BodyNotHttplibCompatible(HTTPError):
+    """
+    Body should be :class:`http.client.HTTPResponse` like
+    (have an fp attribute which returns raw chunks) for read_chunked().
+    """
+
+
+class IncompleteRead(HTTPError, httplib_IncompleteRead):
+    """
+    Response length doesn't match expected Content-Length
+
+    Subclass of :class:`http.client.IncompleteRead` to allow int value
+    for ``partial`` to avoid creating large objects on streamed reads.
+    """
+
+    partial: int  # type: ignore[assignment]
+    expected: int
+
+    def __init__(self, partial: int, expected: int) -> None:
+        self.partial = partial
+        self.expected = expected
+
+    def __repr__(self) -> str:
+        return "IncompleteRead(%i bytes read, %i more expected)" % (
+            self.partial,
+            self.expected,
+        )
+
+
+class InvalidChunkLength(HTTPError, httplib_IncompleteRead):
+    """Invalid chunk length in a chunked response."""
+
+    def __init__(self, response: HTTPResponse, length: bytes) -> None:
+        self.partial: int = response.tell()  # type: ignore[assignment]
+        self.expected: int | None = response.length_remaining
+        self.response = response
+        self.length = length
+
+    def __repr__(self) -> str:
+        return "InvalidChunkLength(got length %r, %i bytes read)" % (
+            self.length,
+            self.partial,
+        )
+
+
+class InvalidHeader(HTTPError):
+    """The header provided was somehow invalid."""
+
+
+class ProxySchemeUnknown(AssertionError, URLSchemeUnknown):
+    """ProxyManager does not support the supplied scheme"""
+
+    # TODO(t-8ch): Stop inheriting from AssertionError in v2.0.
+
+    def __init__(self, scheme: str | None) -> None:
+        # 'localhost' is here because our URL parser parses
+        # localhost:8080 -> scheme=localhost, remove if we fix this.
+        if scheme == "localhost":
+            scheme = None
+        if scheme is None:
+            message = "Proxy URL had no scheme, should start with http:// or https://"
+        else:
+            message = f"Proxy URL had unsupported scheme {scheme}, should use http:// or https://"
+        super().__init__(message)
+
+
+class ProxySchemeUnsupported(ValueError):
+    """Fetching HTTPS resources through HTTPS proxies is unsupported"""
+
+
+class HeaderParsingError(HTTPError):
+    """Raised by assert_header_parsing, but we convert it to a log.warning statement."""
+
+    def __init__(
+        self, defects: list[MessageDefect], unparsed_data: bytes | str | None
+    ) -> None:
+        message = f"{defects or 'Unknown'}, unparsed data: {unparsed_data!r}"
+        super().__init__(message)
+
+
+class UnrewindableBodyError(HTTPError):
+    """urllib3 encountered an error when trying to rewind a body"""

Scripts/reporter_lib/py38+/urllib3/fields.py

@@ -0,0 +1,341 @@
+from __future__ import annotations
+
+import email.utils
+import mimetypes
+import typing
+
+_TYPE_FIELD_VALUE = typing.Union[str, bytes]
+_TYPE_FIELD_VALUE_TUPLE = typing.Union[
+    _TYPE_FIELD_VALUE,
+    tuple[str, _TYPE_FIELD_VALUE],
+    tuple[str, _TYPE_FIELD_VALUE, str],
+]
+
+
+def guess_content_type(
+    filename: str | None, default: str = "application/octet-stream"
+) -> str:
+    """
+    Guess the "Content-Type" of a file.
+
+    :param filename:
+        The filename to guess the "Content-Type" of using :mod:`mimetypes`.
+    :param default:
+        If no "Content-Type" can be guessed, default to `default`.
+    """
+    if filename:
+        return mimetypes.guess_type(filename)[0] or default
+    return default
+
+
+def format_header_param_rfc2231(name: str, value: _TYPE_FIELD_VALUE) -> str:
+    """
+    Helper function to format and quote a single header parameter using the
+    strategy defined in RFC 2231.
+
+    Particularly useful for header parameters which might contain
+    non-ASCII values, like file names. This follows
+    `RFC 2388 Section 4.4 <https://tools.ietf.org/html/rfc2388#section-4.4>`_.
+
+    :param name:
+        The name of the parameter, a string expected to be ASCII only.
+    :param value:
+        The value of the parameter, provided as ``bytes`` or `str``.
+    :returns:
+        An RFC-2231-formatted unicode string.
+
+    .. deprecated:: 2.0.0
+        Will be removed in urllib3 v2.1.0. This is not valid for
+        ``multipart/form-data`` header parameters.
+    """
+    import warnings
+
+    warnings.warn(
+        "'format_header_param_rfc2231' is deprecated and will be "
+        "removed in urllib3 v2.1.0. This is not valid for "
+        "multipart/form-data header parameters.",
+        DeprecationWarning,
+        stacklevel=2,
+    )
+
+    if isinstance(value, bytes):
+        value = value.decode("utf-8")
+
+    if not any(ch in value for ch in '"\\\r\n'):
+        result = f'{name}="{value}"'
+        try:
+            result.encode("ascii")
+        except (UnicodeEncodeError, UnicodeDecodeError):
+            pass
+        else:
+            return result
+
+    value = email.utils.encode_rfc2231(value, "utf-8")
+    value = f"{name}*={value}"
+
+    return value
+
+
+def format_multipart_header_param(name: str, value: _TYPE_FIELD_VALUE) -> str:
+    """
+    Format and quote a single multipart header parameter.
+
+    This follows the `WHATWG HTML Standard`_ as of 2021/06/10, matching
+    the behavior of current browser and curl versions. Values are
+    assumed to be UTF-8. The ``\\n``, ``\\r``, and ``"`` characters are
+    percent encoded.
+
+    .. _WHATWG HTML Standard:
+        https://html.spec.whatwg.org/multipage/
+        form-control-infrastructure.html#multipart-form-data
+
+    :param name:
+        The name of the parameter, an ASCII-only ``str``.
+    :param value:
+        The value of the parameter, a ``str`` or UTF-8 encoded
+        ``bytes``.
+    :returns:
+        A string ``name="value"`` with the escaped value.
+
+    .. versionchanged:: 2.0.0
+        Matches the WHATWG HTML Standard as of 2021/06/10. Control
+        characters are no longer percent encoded.
+
+    .. versionchanged:: 2.0.0
+        Renamed from ``format_header_param_html5`` and
+        ``format_header_param``. The old names will be removed in
+        urllib3 v2.1.0.
+    """
+    if isinstance(value, bytes):
+        value = value.decode("utf-8")
+
+    # percent encode \n \r "
+    value = value.translate({10: "%0A", 13: "%0D", 34: "%22"})
+    return f'{name}="{value}"'
+
+
+def format_header_param_html5(name: str, value: _TYPE_FIELD_VALUE) -> str:
+    """
+    .. deprecated:: 2.0.0
+        Renamed to :func:`format_multipart_header_param`. Will be
+        removed in urllib3 v2.1.0.
+    """
+    import warnings
+
+    warnings.warn(
+        "'format_header_param_html5' has been renamed to "
+        "'format_multipart_header_param'. The old name will be "
+        "removed in urllib3 v2.1.0.",
+        DeprecationWarning,
+        stacklevel=2,
+    )
+    return format_multipart_header_param(name, value)
+
+
+def format_header_param(name: str, value: _TYPE_FIELD_VALUE) -> str:
+    """
+    .. deprecated:: 2.0.0
+        Renamed to :func:`format_multipart_header_param`. Will be
+        removed in urllib3 v2.1.0.
+    """
+    import warnings
+
+    warnings.warn(
+        "'format_header_param' has been renamed to "
+        "'format_multipart_header_param'. The old name will be "
+        "removed in urllib3 v2.1.0.",
+        DeprecationWarning,
+        stacklevel=2,
+    )
+    return format_multipart_header_param(name, value)
+
+
+class RequestField:
+    """
+    A data container for request body parameters.
+
+    :param name:
+        The name of this request field. Must be unicode.
+    :param data:
+        The data/value body.
+    :param filename:
+        An optional filename of the request field. Must be unicode.
+    :param headers:
+        An optional dict-like object of headers to initially use for the field.
+
+    .. versionchanged:: 2.0.0
+        The ``header_formatter`` parameter is deprecated and will
+        be removed in urllib3 v2.1.0.
+    """
+
+    def __init__(
+        self,
+        name: str,
+        data: _TYPE_FIELD_VALUE,
+        filename: str | None = None,
+        headers: typing.Mapping[str, str] | None = None,
+        header_formatter: typing.Callable[[str, _TYPE_FIELD_VALUE], str] | None = None,
+    ):
+        self._name = name
+        self._filename = filename
+        self.data = data
+        self.headers: dict[str, str | None] = {}
+        if headers:
+            self.headers = dict(headers)
+
+        if header_formatter is not None:
+            import warnings
+
+            warnings.warn(
+                "The 'header_formatter' parameter is deprecated and "
+                "will be removed in urllib3 v2.1.0.",
+                DeprecationWarning,
+                stacklevel=2,
+            )
+            self.header_formatter = header_formatter
+        else:
+            self.header_formatter = format_multipart_header_param
+
+    @classmethod
+    def from_tuples(
+        cls,
+        fieldname: str,
+        value: _TYPE_FIELD_VALUE_TUPLE,
+        header_formatter: typing.Callable[[str, _TYPE_FIELD_VALUE], str] | None = None,
+    ) -> RequestField:
+        """
+        A :class:`~urllib3.fields.RequestField` factory from old-style tuple parameters.
+
+        Supports constructing :class:`~urllib3.fields.RequestField` from
+        parameter of key/value strings AND key/filetuple. A filetuple is a
+        (filename, data, MIME type) tuple where the MIME type is optional.
+        For example::
+
+            'foo': 'bar',
+            'fakefile': ('foofile.txt', 'contents of foofile'),
+            'realfile': ('barfile.txt', open('realfile').read()),
+            'typedfile': ('bazfile.bin', open('bazfile').read(), 'image/jpeg'),
+            'nonamefile': 'contents of nonamefile field',
+
+        Field names and filenames must be unicode.
+        """
+        filename: str | None
+        content_type: str | None
+        data: _TYPE_FIELD_VALUE
+
+        if isinstance(value, tuple):
+            if len(value) == 3:
+                filename, data, content_type = value
+            else:
+                filename, data = value
+                content_type = guess_content_type(filename)
+        else:
+            filename = None
+            content_type = None
+            data = value
+
+        request_param = cls(
+            fieldname, data, filename=filename, header_formatter=header_formatter
+        )
+        request_param.make_multipart(content_type=content_type)
+
+        return request_param
+
+    def _render_part(self, name: str, value: _TYPE_FIELD_VALUE) -> str:
+        """
+        Override this method to change how each multipart header
+        parameter is formatted. By default, this calls
+        :func:`format_multipart_header_param`.
+
+        :param name:
+            The name of the parameter, an ASCII-only ``str``.
+        :param value:
+            The value of the parameter, a ``str`` or UTF-8 encoded
+            ``bytes``.
+
+        :meta public:
+        """
+        return self.header_formatter(name, value)
+
+    def _render_parts(
+        self,
+        header_parts: (
+            dict[str, _TYPE_FIELD_VALUE | None]
+            | typing.Sequence[tuple[str, _TYPE_FIELD_VALUE | None]]
+        ),
+    ) -> str:
+        """
+        Helper function to format and quote a single header.
+
+        Useful for single headers that are composed of multiple items. E.g.,
+        'Content-Disposition' fields.
+
+        :param header_parts:
+            A sequence of (k, v) tuples or a :class:`dict` of (k, v) to format
+            as `k1="v1"; k2="v2"; ...`.
+        """
+        iterable: typing.Iterable[tuple[str, _TYPE_FIELD_VALUE | None]]
+
+        parts = []
+        if isinstance(header_parts, dict):
+            iterable = header_parts.items()
+        else:
+            iterable = header_parts
+
+        for name, value in iterable:
+            if value is not None:
+                parts.append(self._render_part(name, value))
+
+        return "; ".join(parts)
+
+    def render_headers(self) -> str:
+        """
+        Renders the headers for this request field.
+        """
+        lines = []
+
+        sort_keys = ["Content-Disposition", "Content-Type", "Content-Location"]
+        for sort_key in sort_keys:
+            if self.headers.get(sort_key, False):
+                lines.append(f"{sort_key}: {self.headers[sort_key]}")
+
+        for header_name, header_value in self.headers.items():
+            if header_name not in sort_keys:
+                if header_value:
+                    lines.append(f"{header_name}: {header_value}")
+
+        lines.append("\r\n")
+        return "\r\n".join(lines)
+
+    def make_multipart(
+        self,
+        content_disposition: str | None = None,
+        content_type: str | None = None,
+        content_location: str | None = None,
+    ) -> None:
+        """
+        Makes this request field into a multipart request field.
+
+        This method overrides "Content-Disposition", "Content-Type" and
+        "Content-Location" headers to the request parameter.
+
+        :param content_disposition:
+            The 'Content-Disposition' of the request body. Defaults to 'form-data'
+        :param content_type:
+            The 'Content-Type' of the request body.
+        :param content_location:
+            The 'Content-Location' of the request body.
+
+        """
+        content_disposition = (content_disposition or "form-data") + "; ".join(
+            [
+                "",
+                self._render_parts(
+                    (("name", self._name), ("filename", self._filename))
+                ),
+            ]
+        )
+
+        self.headers["Content-Disposition"] = content_disposition
+        self.headers["Content-Type"] = content_type
+        self.headers["Content-Location"] = content_location

Scripts/reporter_lib/py38+/urllib3/filepost.py

@@ -0,0 +1,89 @@
+from __future__ import annotations
+
+import binascii
+import codecs
+import os
+import typing
+from io import BytesIO
+
+from .fields import _TYPE_FIELD_VALUE_TUPLE, RequestField
+
+writer = codecs.lookup("utf-8")[3]
+
+_TYPE_FIELDS_SEQUENCE = typing.Sequence[
+    typing.Union[tuple[str, _TYPE_FIELD_VALUE_TUPLE], RequestField]
+]
+_TYPE_FIELDS = typing.Union[
+    _TYPE_FIELDS_SEQUENCE,
+    typing.Mapping[str, _TYPE_FIELD_VALUE_TUPLE],
+]
+
+
+def choose_boundary() -> str:
+    """
+    Our embarrassingly-simple replacement for mimetools.choose_boundary.
+    """
+    return binascii.hexlify(os.urandom(16)).decode()
+
+
+def iter_field_objects(fields: _TYPE_FIELDS) -> typing.Iterable[RequestField]:
+    """
+    Iterate over fields.
+
+    Supports list of (k, v) tuples and dicts, and lists of
+    :class:`~urllib3.fields.RequestField`.
+
+    """
+    iterable: typing.Iterable[RequestField | tuple[str, _TYPE_FIELD_VALUE_TUPLE]]
+
+    if isinstance(fields, typing.Mapping):
+        iterable = fields.items()
+    else:
+        iterable = fields
+
+    for field in iterable:
+        if isinstance(field, RequestField):
+            yield field
+        else:
+            yield RequestField.from_tuples(*field)
+
+
+def encode_multipart_formdata(
+    fields: _TYPE_FIELDS, boundary: str | None = None
+) -> tuple[bytes, str]:
+    """
+    Encode a dictionary of ``fields`` using the multipart/form-data MIME format.
+
+    :param fields:
+        Dictionary of fields or list of (key, :class:`~urllib3.fields.RequestField`).
+        Values are processed by :func:`urllib3.fields.RequestField.from_tuples`.
+
+    :param boundary:
+        If not specified, then a random boundary will be generated using
+        :func:`urllib3.filepost.choose_boundary`.
+    """
+    body = BytesIO()
+    if boundary is None:
+        boundary = choose_boundary()
+
+    for field in iter_field_objects(fields):
+        body.write(f"--{boundary}\r\n".encode("latin-1"))
+
+        writer(body).write(field.render_headers())
+        data = field.data
+
+        if isinstance(data, int):
+            data = str(data)  # Backwards compatibility
+
+        if isinstance(data, str):
+            writer(body).write(data)
+        else:
+            body.write(data)
+
+        body.write(b"\r\n")
+
+    body.write(f"--{boundary}--\r\n".encode("latin-1"))
+
+    content_type = f"multipart/form-data; boundary={boundary}"
+
+    return body.getvalue(), content_type

Scripts/reporter_lib/py38+/urllib3/http2/__init__.py

@@ -0,0 +1,53 @@
+from __future__ import annotations
+
+from importlib.metadata import version
+
+__all__ = [
+    "inject_into_urllib3",
+    "extract_from_urllib3",
+]
+
+import typing
+
+orig_HTTPSConnection: typing.Any = None
+
+
+def inject_into_urllib3() -> None:
+    # First check if h2 version is valid
+    h2_version = version("h2")
+    if not h2_version.startswith("4."):
+        raise ImportError(
+            "urllib3 v2 supports h2 version 4.x.x, currently "
+            f"the 'h2' module is compiled with {h2_version!r}. "
+            "See: https://github.com/urllib3/urllib3/issues/3290"
+        )
+
+    # Import here to avoid circular dependencies.
+    from .. import connection as urllib3_connection
+    from .. import util as urllib3_util
+    from ..connectionpool import HTTPSConnectionPool
+    from ..util import ssl_ as urllib3_util_ssl
+    from .connection import HTTP2Connection
+
+    global orig_HTTPSConnection
+    orig_HTTPSConnection = urllib3_connection.HTTPSConnection
+
+    HTTPSConnectionPool.ConnectionCls = HTTP2Connection
+    urllib3_connection.HTTPSConnection = HTTP2Connection  # type: ignore[misc]
+
+    # TODO: Offer 'http/1.1' as well, but for testing purposes this is handy.
+    urllib3_util.ALPN_PROTOCOLS = ["h2"]
+    urllib3_util_ssl.ALPN_PROTOCOLS = ["h2"]
+
+
+def extract_from_urllib3() -> None:
+    from .. import connection as urllib3_connection
+    from .. import util as urllib3_util
+    from ..connectionpool import HTTPSConnectionPool
+    from ..util import ssl_ as urllib3_util_ssl
+
+    HTTPSConnectionPool.ConnectionCls = orig_HTTPSConnection
+    urllib3_connection.HTTPSConnection = orig_HTTPSConnection  # type: ignore[misc]
+
+    urllib3_util.ALPN_PROTOCOLS = ["http/1.1"]
+    urllib3_util_ssl.ALPN_PROTOCOLS = ["http/1.1"]

Scripts/reporter_lib/py38+/urllib3/http2/connection.py

@@ -0,0 +1,356 @@
+from __future__ import annotations
+
+import logging
+import re
+import threading
+import types
+import typing
+
+import h2.config  # type: ignore[import-untyped]
+import h2.connection  # type: ignore[import-untyped]
+import h2.events  # type: ignore[import-untyped]
+
+from .._base_connection import _TYPE_BODY
+from .._collections import HTTPHeaderDict
+from ..connection import HTTPSConnection, _get_default_user_agent
+from ..exceptions import ConnectionError
+from ..response import BaseHTTPResponse
+
+orig_HTTPSConnection = HTTPSConnection
+
+T = typing.TypeVar("T")
+
+log = logging.getLogger(__name__)
+
+RE_IS_LEGAL_HEADER_NAME = re.compile(rb"^[!#$%&'*+\-.^_`|~0-9a-z]+$")
+RE_IS_ILLEGAL_HEADER_VALUE = re.compile(rb"[\0\x00\x0a\x0d\r\n]|^[ \r\n\t]|[ \r\n\t]$")
+
+
+def _is_legal_header_name(name: bytes) -> bool:
+    """
+    "An implementation that validates fields according to the definitions in Sections
+    5.1 and 5.5 of [HTTP] only needs an additional check that field names do not
+    include uppercase characters." (https://httpwg.org/specs/rfc9113.html#n-field-validity)
+
+    `http.client._is_legal_header_name` does not validate the field name according to the
+    HTTP 1.1 spec, so we do that here, in addition to checking for uppercase characters.
+
+    This does not allow for the `:` character in the header name, so should not
+    be used to validate pseudo-headers.
+    """
+    return bool(RE_IS_LEGAL_HEADER_NAME.match(name))
+
+
+def _is_illegal_header_value(value: bytes) -> bool:
+    """
+    "A field value MUST NOT contain the zero value (ASCII NUL, 0x00), line feed
+    (ASCII LF, 0x0a), or carriage return (ASCII CR, 0x0d) at any position. A field
+    value MUST NOT start or end with an ASCII whitespace character (ASCII SP or HTAB,
+    0x20 or 0x09)." (https://httpwg.org/specs/rfc9113.html#n-field-validity)
+    """
+    return bool(RE_IS_ILLEGAL_HEADER_VALUE.search(value))
+
+
+class _LockedObject(typing.Generic[T]):
+    """
+    A wrapper class that hides a specific object behind a lock.
+    The goal here is to provide a simple way to protect access to an object
+    that cannot safely be simultaneously accessed from multiple threads. The
+    intended use of this class is simple: take hold of it with a context
+    manager, which returns the protected object.
+    """
+
+    __slots__ = (
+        "lock",
+        "_obj",
+    )
+
+    def __init__(self, obj: T):
+        self.lock = threading.RLock()
+        self._obj = obj
+
+    def __enter__(self) -> T:
+        self.lock.acquire()
+        return self._obj
+
+    def __exit__(
+        self,
+        exc_type: type[BaseException] | None,
+        exc_val: BaseException | None,
+        exc_tb: types.TracebackType | None,
+    ) -> None:
+        self.lock.release()
+
+
+class HTTP2Connection(HTTPSConnection):
+    def __init__(
+        self, host: str, port: int | None = None, **kwargs: typing.Any
+    ) -> None:
+        self._h2_conn = self._new_h2_conn()
+        self._h2_stream: int | None = None
+        self._headers: list[tuple[bytes, bytes]] = []
+
+        if "proxy" in kwargs or "proxy_config" in kwargs:  # Defensive:
+            raise NotImplementedError("Proxies aren't supported with HTTP/2")
+
+        super().__init__(host, port, **kwargs)
+
+        if self._tunnel_host is not None:
+            raise NotImplementedError("Tunneling isn't supported with HTTP/2")
+
+    def _new_h2_conn(self) -> _LockedObject[h2.connection.H2Connection]:
+        config = h2.config.H2Configuration(client_side=True)
+        return _LockedObject(h2.connection.H2Connection(config=config))
+
+    def connect(self) -> None:
+        super().connect()
+        with self._h2_conn as conn:
+            conn.initiate_connection()
+            if data_to_send := conn.data_to_send():
+                self.sock.sendall(data_to_send)
+
+    def putrequest(  # type: ignore[override]
+        self,
+        method: str,
+        url: str,
+        **kwargs: typing.Any,
+    ) -> None:
+        """putrequest
+        This deviates from the HTTPConnection method signature since we never need to override
+        sending accept-encoding headers or the host header.
+        """
+        if "skip_host" in kwargs:
+            raise NotImplementedError("`skip_host` isn't supported")
+        if "skip_accept_encoding" in kwargs:
+            raise NotImplementedError("`skip_accept_encoding` isn't supported")
+
+        self._request_url = url or "/"
+        self._validate_path(url)  # type: ignore[attr-defined]
+
+        if ":" in self.host:
+            authority = f"[{self.host}]:{self.port or 443}"
+        else:
+            authority = f"{self.host}:{self.port or 443}"
+
+        self._headers.append((b":scheme", b"https"))
+        self._headers.append((b":method", method.encode()))
+        self._headers.append((b":authority", authority.encode()))
+        self._headers.append((b":path", url.encode()))
+
+        with self._h2_conn as conn:
+            self._h2_stream = conn.get_next_available_stream_id()
+
+    def putheader(self, header: str | bytes, *values: str | bytes) -> None:
+        # TODO SKIPPABLE_HEADERS from urllib3 are ignored.
+        header = header.encode() if isinstance(header, str) else header
+        header = header.lower()  # A lot of upstream code uses capitalized headers.
+        if not _is_legal_header_name(header):
+            raise ValueError(f"Illegal header name {str(header)}")
+
+        for value in values:
+            value = value.encode() if isinstance(value, str) else value
+            if _is_illegal_header_value(value):
+                raise ValueError(f"Illegal header value {str(value)}")
+            self._headers.append((header, value))
+
+    def endheaders(self, message_body: typing.Any = None) -> None:  # type: ignore[override]
+        if self._h2_stream is None:
+            raise ConnectionError("Must call `putrequest` first.")
+
+        with self._h2_conn as conn:
+            conn.send_headers(
+                stream_id=self._h2_stream,
+                headers=self._headers,
+                end_stream=(message_body is None),
+            )
+            if data_to_send := conn.data_to_send():
+                self.sock.sendall(data_to_send)
+        self._headers = []  # Reset headers for the next request.
+
+    def send(self, data: typing.Any) -> None:
+        """Send data to the server.
+        `data` can be: `str`, `bytes`, an iterable, or file-like objects
+        that support a .read() method.
+        """
+        if self._h2_stream is None:
+            raise ConnectionError("Must call `putrequest` first.")
+
+        with self._h2_conn as conn:
+            if data_to_send := conn.data_to_send():
+                self.sock.sendall(data_to_send)
+
+            if hasattr(data, "read"):  # file-like objects
+                while True:
+                    chunk = data.read(self.blocksize)
+                    if not chunk:
+                        break
+                    if isinstance(chunk, str):
+                        chunk = chunk.encode()  # pragma: no cover
+                    conn.send_data(self._h2_stream, chunk, end_stream=False)
+                    if data_to_send := conn.data_to_send():
+                        self.sock.sendall(data_to_send)
+                conn.end_stream(self._h2_stream)
+                return
+
+            if isinstance(data, str):  # str -> bytes
+                data = data.encode()
+
+            try:
+                if isinstance(data, bytes):
+                    conn.send_data(self._h2_stream, data, end_stream=True)
+                    if data_to_send := conn.data_to_send():
+                        self.sock.sendall(data_to_send)
+                else:
+                    for chunk in data:
+                        conn.send_data(self._h2_stream, chunk, end_stream=False)
+                        if data_to_send := conn.data_to_send():
+                            self.sock.sendall(data_to_send)
+                    conn.end_stream(self._h2_stream)
+            except TypeError:
+                raise TypeError(
+                    "`data` should be str, bytes, iterable, or file. got %r"
+                    % type(data)
+                )
+
+    def set_tunnel(
+        self,
+        host: str,
+        port: int | None = None,
+        headers: typing.Mapping[str, str] | None = None,
+        scheme: str = "http",
+    ) -> None:
+        raise NotImplementedError(
+            "HTTP/2 does not support setting up a tunnel through a proxy"
+        )
+
+    def getresponse(  # type: ignore[override]
+        self,
+    ) -> HTTP2Response:
+        status = None
+        data = bytearray()
+        with self._h2_conn as conn:
+            end_stream = False
+            while not end_stream:
+                # TODO: Arbitrary read value.
+                if received_data := self.sock.recv(65535):
+                    events = conn.receive_data(received_data)
+                    for event in events:
+                        if isinstance(event, h2.events.ResponseReceived):
+                            headers = HTTPHeaderDict()
+                            for header, value in event.headers:
+                                if header == b":status":
+                                    status = int(value.decode())
+                                else:
+                                    headers.add(
+                                        header.decode("ascii"), value.decode("ascii")
+                                    )
+
+                        elif isinstance(event, h2.events.DataReceived):
+                            data += event.data
+                            conn.acknowledge_received_data(
+                                event.flow_controlled_length, event.stream_id
+                            )
+
+                        elif isinstance(event, h2.events.StreamEnded):
+                            end_stream = True
+
+                if data_to_send := conn.data_to_send():
+                    self.sock.sendall(data_to_send)
+
+        assert status is not None
+        return HTTP2Response(
+            status=status,
+            headers=headers,
+            request_url=self._request_url,
+            data=bytes(data),
+        )
+
+    def request(  # type: ignore[override]
+        self,
+        method: str,
+        url: str,
+        body: _TYPE_BODY | None = None,
+        headers: typing.Mapping[str, str] | None = None,
+        *,
+        preload_content: bool = True,
+        decode_content: bool = True,
+        enforce_content_length: bool = True,
+        **kwargs: typing.Any,
+    ) -> None:
+        """Send an HTTP/2 request"""
+        if "chunked" in kwargs:
+            # TODO this is often present from upstream.
+            # raise NotImplementedError("`chunked` isn't supported with HTTP/2")
+            pass
+
+        if self.sock is not None:
+            self.sock.settimeout(self.timeout)
+
+        self.putrequest(method, url)
+
+        headers = headers or {}
+        for k, v in headers.items():
+            if k.lower() == "transfer-encoding" and v == "chunked":
+                continue
+            else:
+                self.putheader(k, v)
+
+        if b"user-agent" not in dict(self._headers):
+            self.putheader(b"user-agent", _get_default_user_agent())
+
+        if body:
+            self.endheaders(message_body=body)
+            self.send(body)
+        else:
+            self.endheaders()
+
+    def close(self) -> None:
+        with self._h2_conn as conn:
+            try:
+                conn.close_connection()
+                if data := conn.data_to_send():
+                    self.sock.sendall(data)
+            except Exception:
+                pass
+
+        # Reset all our HTTP/2 connection state.
+        self._h2_conn = self._new_h2_conn()
+        self._h2_stream = None
+        self._headers = []
+
+        super().close()
+
+
+class HTTP2Response(BaseHTTPResponse):
+    # TODO: This is a woefully incomplete response object, but works for non-streaming.
+    def __init__(
+        self,
+        status: int,
+        headers: HTTPHeaderDict,
+        request_url: str,
+        data: bytes,
+        decode_content: bool = False,  # TODO: support decoding
+    ) -> None:
+        super().__init__(
+            status=status,
+            headers=headers,
+            # Following CPython, we map HTTP versions to major * 10 + minor integers
+            version=20,
+            version_string="HTTP/2",
+            # No reason phrase in HTTP/2
+            reason=None,
+            decode_content=decode_content,
+            request_url=request_url,
+        )
+        self._data = data
+        self.length_remaining = 0
+
+    @property
+    def data(self) -> bytes:
+        return self._data
+
+    def get_redirect_location(self) -> None:
+        return None
+
+    def close(self) -> None:
+        pass

Scripts/reporter_lib/py38+/urllib3/http2/probe.py

@@ -0,0 +1,87 @@
+from __future__ import annotations
+
+import threading
+
+
+class _HTTP2ProbeCache:
+    __slots__ = (
+        "_lock",
+        "_cache_locks",
+        "_cache_values",
+    )
+
+    def __init__(self) -> None:
+        self._lock = threading.Lock()
+        self._cache_locks: dict[tuple[str, int], threading.RLock] = {}
+        self._cache_values: dict[tuple[str, int], bool | None] = {}
+
+    def acquire_and_get(self, host: str, port: int) -> bool | None:
+        # By the end of this block we know that
+        # _cache_[values,locks] is available.
+        value = None
+        with self._lock:
+            key = (host, port)
+            try:
+                value = self._cache_values[key]
+                # If it's a known value we return right away.
+                if value is not None:
+                    return value
+            except KeyError:
+                self._cache_locks[key] = threading.RLock()
+                self._cache_values[key] = None
+
+        # If the value is unknown, we acquire the lock to signal
+        # to the requesting thread that the probe is in progress
+        # or that the current thread needs to return their findings.
+        key_lock = self._cache_locks[key]
+        key_lock.acquire()
+        try:
+            # If the by the time we get the lock the value has been
+            # updated we want to return the updated value.
+            value = self._cache_values[key]
+
+        # In case an exception like KeyboardInterrupt is raised here.
+        except BaseException as e:  # Defensive:
+            assert not isinstance(e, KeyError)  # KeyError shouldn't be possible.
+            key_lock.release()
+            raise
+
+        return value
+
+    def set_and_release(
+        self, host: str, port: int, supports_http2: bool | None
+    ) -> None:
+        key = (host, port)
+        key_lock = self._cache_locks[key]
+        with key_lock:  # Uses an RLock, so can be locked again from same thread.
+            if supports_http2 is None and self._cache_values[key] is not None:
+                raise ValueError(
+                    "Cannot reset HTTP/2 support for origin after value has been set."
+                )  # Defensive: not expected in normal usage
+
+        self._cache_values[key] = supports_http2
+        key_lock.release()
+
+    def _values(self) -> dict[tuple[str, int], bool | None]:
+        """This function is for testing purposes only. Gets the current state of the probe cache"""
+        with self._lock:
+            return {k: v for k, v in self._cache_values.items()}
+
+    def _reset(self) -> None:
+        """This function is for testing purposes only. Reset the cache values"""
+        with self._lock:
+            self._cache_locks = {}
+            self._cache_values = {}
+
+
+_HTTP2_PROBE_CACHE = _HTTP2ProbeCache()
+
+set_and_release = _HTTP2_PROBE_CACHE.set_and_release
+acquire_and_get = _HTTP2_PROBE_CACHE.acquire_and_get
+_values = _HTTP2_PROBE_CACHE._values
+_reset = _HTTP2_PROBE_CACHE._reset
+
+__all__ = [
+    "set_and_release",
+    "acquire_and_get",
+]

Scripts/reporter_lib/py38+/urllib3/poolmanager.py

@@ -0,0 +1,637 @@
+from __future__ import annotations
+
+import functools
+import logging
+import typing
+import warnings
+from types import TracebackType
+from urllib.parse import urljoin
+
+from ._collections import HTTPHeaderDict, RecentlyUsedContainer
+from ._request_methods import RequestMethods
+from .connection import ProxyConfig
+from .connectionpool import HTTPConnectionPool, HTTPSConnectionPool, port_by_scheme
+from .exceptions import (
+    LocationValueError,
+    MaxRetryError,
+    ProxySchemeUnknown,
+    URLSchemeUnknown,
+)
+from .response import BaseHTTPResponse
+from .util.connection import _TYPE_SOCKET_OPTIONS
+from .util.proxy import connection_requires_http_tunnel
+from .util.retry import Retry
+from .util.timeout import Timeout
+from .util.url import Url, parse_url
+
+if typing.TYPE_CHECKING:
+    import ssl
+
+    from typing_extensions import Self
+
+__all__ = ["PoolManager", "ProxyManager", "proxy_from_url"]
+
+
+log = logging.getLogger(__name__)
+
+SSL_KEYWORDS = (
+    "key_file",
+    "cert_file",
+    "cert_reqs",
+    "ca_certs",
+    "ca_cert_data",
+    "ssl_version",
+    "ssl_minimum_version",
+    "ssl_maximum_version",
+    "ca_cert_dir",
+    "ssl_context",
+    "key_password",
+    "server_hostname",
+)
+# Default value for `blocksize` - a new parameter introduced to
+# http.client.HTTPConnection & http.client.HTTPSConnection in Python 3.7
+_DEFAULT_BLOCKSIZE = 16384
+
+
+class PoolKey(typing.NamedTuple):
+    """
+    All known keyword arguments that could be provided to the pool manager, its
+    pools, or the underlying connections.
+
+    All custom key schemes should include the fields in this key at a minimum.
+    """
+
+    key_scheme: str
+    key_host: str
+    key_port: int | None
+    key_timeout: Timeout | float | int | None
+    key_retries: Retry | bool | int | None
+    key_block: bool | None
+    key_source_address: tuple[str, int] | None
+    key_key_file: str | None
+    key_key_password: str | None
+    key_cert_file: str | None
+    key_cert_reqs: str | None
+    key_ca_certs: str | None
+    key_ca_cert_data: str | bytes | None
+    key_ssl_version: int | str | None
+    key_ssl_minimum_version: ssl.TLSVersion | None
+    key_ssl_maximum_version: ssl.TLSVersion | None
+    key_ca_cert_dir: str | None
+    key_ssl_context: ssl.SSLContext | None
+    key_maxsize: int | None
+    key_headers: frozenset[tuple[str, str]] | None
+    key__proxy: Url | None
+    key__proxy_headers: frozenset[tuple[str, str]] | None
+    key__proxy_config: ProxyConfig | None
+    key_socket_options: _TYPE_SOCKET_OPTIONS | None
+    key__socks_options: frozenset[tuple[str, str]] | None
+    key_assert_hostname: bool | str | None
+    key_assert_fingerprint: str | None
+    key_server_hostname: str | None
+    key_blocksize: int | None
+
+
+def _default_key_normalizer(
+    key_class: type[PoolKey], request_context: dict[str, typing.Any]
+) -> PoolKey:
+    """
+    Create a pool key out of a request context dictionary.
+
+    According to RFC 3986, both the scheme and host are case-insensitive.
+    Therefore, this function normalizes both before constructing the pool
+    key for an HTTPS request. If you wish to change this behaviour, provide
+    alternate callables to ``key_fn_by_scheme``.
+
+    :param key_class:
+        The class to use when constructing the key. This should be a namedtuple
+        with the ``scheme`` and ``host`` keys at a minimum.
+    :type  key_class: namedtuple
+    :param request_context:
+        A dictionary-like object that contain the context for a request.
+    :type  request_context: dict
+
+    :return: A namedtuple that can be used as a connection pool key.
+    :rtype:  PoolKey
+    """
+    # Since we mutate the dictionary, make a copy first
+    context = request_context.copy()
+    context["scheme"] = context["scheme"].lower()
+    context["host"] = context["host"].lower()
+
+    # These are both dictionaries and need to be transformed into frozensets
+    for key in ("headers", "_proxy_headers", "_socks_options"):
+        if key in context and context[key] is not None:
+            context[key] = frozenset(context[key].items())
+
+    # The socket_options key may be a list and needs to be transformed into a
+    # tuple.
+    socket_opts = context.get("socket_options")
+    if socket_opts is not None:
+        context["socket_options"] = tuple(socket_opts)
+
+    # Map the kwargs to the names in the namedtuple - this is necessary since
+    # namedtuples can't have fields starting with '_'.
+    for key in list(context.keys()):
+        context["key_" + key] = context.pop(key)
+
+    # Default to ``None`` for keys missing from the context
+    for field in key_class._fields:
+        if field not in context:
+            context[field] = None
+
+    # Default key_blocksize to _DEFAULT_BLOCKSIZE if missing from the context
+    if context.get("key_blocksize") is None:
+        context["key_blocksize"] = _DEFAULT_BLOCKSIZE
+
+    return key_class(**context)
+
+
+#: A dictionary that maps a scheme to a callable that creates a pool key.
+#: This can be used to alter the way pool keys are constructed, if desired.
+#: Each PoolManager makes a copy of this dictionary so they can be configured
+#: globally here, or individually on the instance.
+key_fn_by_scheme = {
+    "http": functools.partial(_default_key_normalizer, PoolKey),
+    "https": functools.partial(_default_key_normalizer, PoolKey),
+}
+
+pool_classes_by_scheme = {"http": HTTPConnectionPool, "https": HTTPSConnectionPool}
+
+
+class PoolManager(RequestMethods):
+    """
+    Allows for arbitrary requests while transparently keeping track of
+    necessary connection pools for you.
+
+    :param num_pools:
+        Number of connection pools to cache before discarding the least
+        recently used pool.
+
+    :param headers:
+        Headers to include with all requests, unless other headers are given
+        explicitly.
+
+    :param \\**connection_pool_kw:
+        Additional parameters are used to create fresh
+        :class:`urllib3.connectionpool.ConnectionPool` instances.
+
+    Example:
+
+    .. code-block:: python
+
+        import urllib3
+
+        http = urllib3.PoolManager(num_pools=2)
+
+        resp1 = http.request("GET", "https://google.com/")
+        resp2 = http.request("GET", "https://google.com/mail")
+        resp3 = http.request("GET", "https://yahoo.com/")
+
+        print(len(http.pools))
+        # 2
+
+    """
+
+    proxy: Url | None = None
+    proxy_config: ProxyConfig | None = None
+
+    def __init__(
+        self,
+        num_pools: int = 10,
+        headers: typing.Mapping[str, str] | None = None,
+        **connection_pool_kw: typing.Any,
+    ) -> None:
+        super().__init__(headers)
+        self.connection_pool_kw = connection_pool_kw
+
+        self.pools: RecentlyUsedContainer[PoolKey, HTTPConnectionPool]
+        self.pools = RecentlyUsedContainer(num_pools)
+
+        # Locally set the pool classes and keys so other PoolManagers can
+        # override them.
+        self.pool_classes_by_scheme = pool_classes_by_scheme
+        self.key_fn_by_scheme = key_fn_by_scheme.copy()
+
+    def __enter__(self) -> Self:
+        return self
+
+    def __exit__(
+        self,
+        exc_type: type[BaseException] | None,
+        exc_val: BaseException | None,
+        exc_tb: TracebackType | None,
+    ) -> typing.Literal[False]:
+        self.clear()
+        # Return False to re-raise any potential exceptions
+        return False
+
+    def _new_pool(
+        self,
+        scheme: str,
+        host: str,
+        port: int,
+        request_context: dict[str, typing.Any] | None = None,
+    ) -> HTTPConnectionPool:
+        """
+        Create a new :class:`urllib3.connectionpool.ConnectionPool` based on host, port, scheme, and
+        any additional pool keyword arguments.
+
+        If ``request_context`` is provided, it is provided as keyword arguments
+        to the pool class used. This method is used to actually create the
+        connection pools handed out by :meth:`connection_from_url` and
+        companion methods. It is intended to be overridden for customization.
+        """
+        pool_cls: type[HTTPConnectionPool] = self.pool_classes_by_scheme[scheme]
+        if request_context is None:
+            request_context = self.connection_pool_kw.copy()
+
+        # Default blocksize to _DEFAULT_BLOCKSIZE if missing or explicitly
+        # set to 'None' in the request_context.
+        if request_context.get("blocksize") is None:
+            request_context["blocksize"] = _DEFAULT_BLOCKSIZE
+
+        # Although the context has everything necessary to create the pool,
+        # this function has historically only used the scheme, host, and port
+        # in the positional args. When an API change is acceptable these can
+        # be removed.
+        for key in ("scheme", "host", "port"):
+            request_context.pop(key, None)
+
+        if scheme == "http":
+            for kw in SSL_KEYWORDS:
+                request_context.pop(kw, None)
+
+        return pool_cls(host, port, **request_context)
+
+    def clear(self) -> None:
+        """
+        Empty our store of pools and direct them all to close.
+
+        This will not affect in-flight connections, but they will not be
+        re-used after completion.
+        """
+        self.pools.clear()
+
+    def connection_from_host(
+        self,
+        host: str | None,
+        port: int | None = None,
+        scheme: str | None = "http",
+        pool_kwargs: dict[str, typing.Any] | None = None,
+    ) -> HTTPConnectionPool:
+        """
+        Get a :class:`urllib3.connectionpool.ConnectionPool` based on the host, port, and scheme.
+
+        If ``port`` isn't given, it will be derived from the ``scheme`` using
+        ``urllib3.connectionpool.port_by_scheme``. If ``pool_kwargs`` is
+        provided, it is merged with the instance's ``connection_pool_kw``
+        variable and used to create the new connection pool, if one is
+        needed.
+        """
+
+        if not host:
+            raise LocationValueError("No host specified.")
+
+        request_context = self._merge_pool_kwargs(pool_kwargs)
+        request_context["scheme"] = scheme or "http"
+        if not port:
+            port = port_by_scheme.get(request_context["scheme"].lower(), 80)
+        request_context["port"] = port
+        request_context["host"] = host
+
+        return self.connection_from_context(request_context)
+
+    def connection_from_context(
+        self, request_context: dict[str, typing.Any]
+    ) -> HTTPConnectionPool:
+        """
+        Get a :class:`urllib3.connectionpool.ConnectionPool` based on the request context.
+
+        ``request_context`` must at least contain the ``scheme`` key and its
+        value must be a key in ``key_fn_by_scheme`` instance variable.
+        """
+        if "strict" in request_context:
+            warnings.warn(
+                "The 'strict' parameter is no longer needed on Python 3+. "
+                "This will raise an error in urllib3 v2.1.0.",
+                DeprecationWarning,
+            )
+            request_context.pop("strict")
+
+        scheme = request_context["scheme"].lower()
+        pool_key_constructor = self.key_fn_by_scheme.get(scheme)
+        if not pool_key_constructor:
+            raise URLSchemeUnknown(scheme)
+        pool_key = pool_key_constructor(request_context)
+
+        return self.connection_from_pool_key(pool_key, request_context=request_context)
+
+    def connection_from_pool_key(
+        self, pool_key: PoolKey, request_context: dict[str, typing.Any]
+    ) -> HTTPConnectionPool:
+        """
+        Get a :class:`urllib3.connectionpool.ConnectionPool` based on the provided pool key.
+
+        ``pool_key`` should be a namedtuple that only contains immutable
+        objects. At a minimum it must have the ``scheme``, ``host``, and
+        ``port`` fields.
+        """
+        with self.pools.lock:
+            # If the scheme, host, or port doesn't match existing open
+            # connections, open a new ConnectionPool.
+            pool = self.pools.get(pool_key)
+            if pool:
+                return pool
+
+            # Make a fresh ConnectionPool of the desired type
+            scheme = request_context["scheme"]
+            host = request_context["host"]
+            port = request_context["port"]
+            pool = self._new_pool(scheme, host, port, request_context=request_context)
+            self.pools[pool_key] = pool
+
+        return pool
+
+    def connection_from_url(
+        self, url: str, pool_kwargs: dict[str, typing.Any] | None = None
+    ) -> HTTPConnectionPool:
+        """
+        Similar to :func:`urllib3.connectionpool.connection_from_url`.
+
+        If ``pool_kwargs`` is not provided and a new pool needs to be
+        constructed, ``self.connection_pool_kw`` is used to initialize
+        the :class:`urllib3.connectionpool.ConnectionPool`. If ``pool_kwargs``
+        is provided, it is used instead. Note that if a new pool does not
+        need to be created for the request, the provided ``pool_kwargs`` are
+        not used.
+        """
+        u = parse_url(url)
+        return self.connection_from_host(
+            u.host, port=u.port, scheme=u.scheme, pool_kwargs=pool_kwargs
+        )
+
+    def _merge_pool_kwargs(
+        self, override: dict[str, typing.Any] | None
+    ) -> dict[str, typing.Any]:
+        """
+        Merge a dictionary of override values for self.connection_pool_kw.
+
+        This does not modify self.connection_pool_kw and returns a new dict.
+        Any keys in the override dictionary with a value of ``None`` are
+        removed from the merged dictionary.
+        """
+        base_pool_kwargs = self.connection_pool_kw.copy()
+        if override:
+            for key, value in override.items():
+                if value is None:
+                    try:
+                        del base_pool_kwargs[key]
+                    except KeyError:
+                        pass
+                else:
+                    base_pool_kwargs[key] = value
+        return base_pool_kwargs
+
+    def _proxy_requires_url_absolute_form(self, parsed_url: Url) -> bool:
+        """
+        Indicates if the proxy requires the complete destination URL in the
+        request.  Normally this is only needed when not using an HTTP CONNECT
+        tunnel.
+        """
+        if self.proxy is None:
+            return False
+
+        return not connection_requires_http_tunnel(
+            self.proxy, self.proxy_config, parsed_url.scheme
+        )
+
+    def urlopen(  # type: ignore[override]
+        self, method: str, url: str, redirect: bool = True, **kw: typing.Any
+    ) -> BaseHTTPResponse:
+        """
+        Same as :meth:`urllib3.HTTPConnectionPool.urlopen`
+        with custom cross-host redirect logic and only sends the request-uri
+        portion of the ``url``.
+
+        The given ``url`` parameter must be absolute, such that an appropriate
+        :class:`urllib3.connectionpool.ConnectionPool` can be chosen for it.
+        """
+        u = parse_url(url)
+
+        if u.scheme is None:
+            warnings.warn(
+                "URLs without a scheme (ie 'https://') are deprecated and will raise an error "
+                "in a future version of urllib3. To avoid this DeprecationWarning ensure all URLs "
+                "start with 'https://' or 'http://'. Read more in this issue: "
+                "https://github.com/urllib3/urllib3/issues/2920",
+                category=DeprecationWarning,
+                stacklevel=2,
+            )
+
+        conn = self.connection_from_host(u.host, port=u.port, scheme=u.scheme)
+
+        kw["assert_same_host"] = False
+        kw["redirect"] = False
+
+        if "headers" not in kw:
+            kw["headers"] = self.headers
+
+        if self._proxy_requires_url_absolute_form(u):
+            response = conn.urlopen(method, url, **kw)
+        else:
+            response = conn.urlopen(method, u.request_uri, **kw)
+
+        redirect_location = redirect and response.get_redirect_location()
+        if not redirect_location:
+            return response
+
+        # Support relative URLs for redirecting.
+        redirect_location = urljoin(url, redirect_location)
+
+        if response.status == 303:
+            # Change the method according to RFC 9110, Section 15.4.4.
+            method = "GET"
+            # And lose the body not to transfer anything sensitive.
+            kw["body"] = None
+            kw["headers"] = HTTPHeaderDict(kw["headers"])._prepare_for_method_change()
+
+        retries = kw.get("retries")
+        if not isinstance(retries, Retry):
+            retries = Retry.from_int(retries, redirect=redirect)
+
+        # Strip headers marked as unsafe to forward to the redirected location.
+        # Check remove_headers_on_redirect to avoid a potential network call within
+        # conn.is_same_host() which may use socket.gethostbyname() in the future.
+        if retries.remove_headers_on_redirect and not conn.is_same_host(
+            redirect_location
+        ):
+            new_headers = kw["headers"].copy()
+            for header in kw["headers"]:
+                if header.lower() in retries.remove_headers_on_redirect:
+                    new_headers.pop(header, None)
+            kw["headers"] = new_headers
+
+        try:
+            retries = retries.increment(method, url, response=response, _pool=conn)
+        except MaxRetryError:
+            if retries.raise_on_redirect:
+                response.drain_conn()
+                raise
+            return response
+
+        kw["retries"] = retries
+        kw["redirect"] = redirect
+
+        log.info("Redirecting %s -> %s", url, redirect_location)
+
+        response.drain_conn()
+        return self.urlopen(method, redirect_location, **kw)
+
+
+class ProxyManager(PoolManager):
+    """
+    Behaves just like :class:`PoolManager`, but sends all requests through
+    the defined proxy, using the CONNECT method for HTTPS URLs.
+
+    :param proxy_url:
+        The URL of the proxy to be used.
+
+    :param proxy_headers:
+        A dictionary containing headers that will be sent to the proxy. In case
+        of HTTP they are being sent with each request, while in the
+        HTTPS/CONNECT case they are sent only once. Could be used for proxy
+        authentication.
+
+    :param proxy_ssl_context:
+        The proxy SSL context is used to establish the TLS connection to the
+        proxy when using HTTPS proxies.
+
+    :param use_forwarding_for_https:
+        (Defaults to False) If set to True will forward requests to the HTTPS
+        proxy to be made on behalf of the client instead of creating a TLS
+        tunnel via the CONNECT method. **Enabling this flag means that request
+        and response headers and content will be visible from the HTTPS proxy**
+        whereas tunneling keeps request and response headers and content
+        private.  IP address, target hostname, SNI, and port are always visible
+        to an HTTPS proxy even when this flag is disabled.
+
+    :param proxy_assert_hostname:
+        The hostname of the certificate to verify against.
+
+    :param proxy_assert_fingerprint:
+        The fingerprint of the certificate to verify against.
+
+    Example:
+
+    .. code-block:: python
+
+        import urllib3
+
+        proxy = urllib3.ProxyManager("https://localhost:3128/")
+
+        resp1 = proxy.request("GET", "https://google.com/")
+        resp2 = proxy.request("GET", "https://httpbin.org/")
+
+        print(len(proxy.pools))
+        # 1
+
+        resp3 = proxy.request("GET", "https://httpbin.org/")
+        resp4 = proxy.request("GET", "https://twitter.com/")
+
+        print(len(proxy.pools))
+        # 3
+
+    """
+
+    def __init__(
+        self,
+        proxy_url: str,
+        num_pools: int = 10,
+        headers: typing.Mapping[str, str] | None = None,
+        proxy_headers: typing.Mapping[str, str] | None = None,
+        proxy_ssl_context: ssl.SSLContext | None = None,
+        use_forwarding_for_https: bool = False,
+        proxy_assert_hostname: None | str | typing.Literal[False] = None,
+        proxy_assert_fingerprint: str | None = None,
+        **connection_pool_kw: typing.Any,
+    ) -> None:
+        if isinstance(proxy_url, HTTPConnectionPool):
+            str_proxy_url = f"{proxy_url.scheme}://{proxy_url.host}:{proxy_url.port}"
+        else:
+            str_proxy_url = proxy_url
+        proxy = parse_url(str_proxy_url)
+
+        if proxy.scheme not in ("http", "https"):
+            raise ProxySchemeUnknown(proxy.scheme)
+
+        if not proxy.port:
+            port = port_by_scheme.get(proxy.scheme, 80)
+            proxy = proxy._replace(port=port)
+
+        self.proxy = proxy
+        self.proxy_headers = proxy_headers or {}
+        self.proxy_ssl_context = proxy_ssl_context
+        self.proxy_config = ProxyConfig(
+            proxy_ssl_context,
+            use_forwarding_for_https,
+            proxy_assert_hostname,
+            proxy_assert_fingerprint,
+        )
+
+        connection_pool_kw["_proxy"] = self.proxy
+        connection_pool_kw["_proxy_headers"] = self.proxy_headers
+        connection_pool_kw["_proxy_config"] = self.proxy_config
+
+        super().__init__(num_pools, headers, **connection_pool_kw)
+
+    def connection_from_host(
+        self,
+        host: str | None,
+        port: int | None = None,
+        scheme: str | None = "http",
+        pool_kwargs: dict[str, typing.Any] | None = None,
+    ) -> HTTPConnectionPool:
+        if scheme == "https":
+            return super().connection_from_host(
+                host, port, scheme, pool_kwargs=pool_kwargs
+            )
+
+        return super().connection_from_host(
+            self.proxy.host, self.proxy.port, self.proxy.scheme, pool_kwargs=pool_kwargs  # type: ignore[union-attr]
+        )
+
+    def _set_proxy_headers(
+        self, url: str, headers: typing.Mapping[str, str] | None = None
+    ) -> typing.Mapping[str, str]:
+        """
+        Sets headers needed by proxies: specifically, the Accept and Host
+        headers. Only sets headers not provided by the user.
+        """
+        headers_ = {"Accept": "*/*"}
+
+        netloc = parse_url(url).netloc
+        if netloc:
+            headers_["Host"] = netloc
+
+        if headers:
+            headers_.update(headers)
+        return headers_
+
+    def urlopen(  # type: ignore[override]
+        self, method: str, url: str, redirect: bool = True, **kw: typing.Any
+    ) -> BaseHTTPResponse:
+        "Same as HTTP(S)ConnectionPool.urlopen, ``url`` must be absolute."
+        u = parse_url(url)
+        if not connection_requires_http_tunnel(self.proxy, self.proxy_config, u.scheme):
+            # For connections using HTTP CONNECT, httplib sets the necessary
+            # headers on the CONNECT to the proxy. If we're not using CONNECT,
+            # we'll definitely need to set 'Host' at the very least.
+            headers = kw.get("headers", self.headers)
+            kw["headers"] = self._set_proxy_headers(url, headers)
+
+        return super().urlopen(method, url, redirect=redirect, **kw)
+
+
+def proxy_from_url(url: str, **kw: typing.Any) -> ProxyManager:
+    return ProxyManager(proxy_url=url, **kw)

Scripts/reporter_lib/py38+/urllib3/py.typed

@@ -0,0 +1,2 @@
+# Instruct type checkers to look for inline type annotations in this package.
+# See PEP 561.

Scripts/reporter_lib/py38+/urllib3/util/__init__.py

@@ -0,0 +1,42 @@
+# For backwards compatibility, provide imports that used to be here.
+from __future__ import annotations
+
+from .connection import is_connection_dropped
+from .request import SKIP_HEADER, SKIPPABLE_HEADERS, make_headers
+from .response import is_fp_closed
+from .retry import Retry
+from .ssl_ import (
+    ALPN_PROTOCOLS,
+    IS_PYOPENSSL,
+    SSLContext,
+    assert_fingerprint,
+    create_urllib3_context,
+    resolve_cert_reqs,
+    resolve_ssl_version,
+    ssl_wrap_socket,
+)
+from .timeout import Timeout
+from .url import Url, parse_url
+from .wait import wait_for_read, wait_for_write
+
+__all__ = (
+    "IS_PYOPENSSL",
+    "SSLContext",
+    "ALPN_PROTOCOLS",
+    "Retry",
+    "Timeout",
+    "Url",
+    "assert_fingerprint",
+    "create_urllib3_context",
+    "is_connection_dropped",
+    "is_fp_closed",
+    "parse_url",
+    "make_headers",
+    "resolve_cert_reqs",
+    "resolve_ssl_version",
+    "ssl_wrap_socket",
+    "wait_for_read",
+    "wait_for_write",
+    "SKIP_HEADER",
+    "SKIPPABLE_HEADERS",
+)

Scripts/reporter_lib/py38+/urllib3/util/connection.py

@@ -0,0 +1,137 @@
+from __future__ import annotations
+
+import socket
+import typing
+
+from ..exceptions import LocationParseError
+from .timeout import _DEFAULT_TIMEOUT, _TYPE_TIMEOUT
+
+_TYPE_SOCKET_OPTIONS = list[tuple[int, int, typing.Union[int, bytes]]]
+
+if typing.TYPE_CHECKING:
+    from .._base_connection import BaseHTTPConnection
+
+
+def is_connection_dropped(conn: BaseHTTPConnection) -> bool:  # Platform-specific
+    """
+    Returns True if the connection is dropped and should be closed.
+    :param conn: :class:`urllib3.connection.HTTPConnection` object.
+    """
+    return not conn.is_connected
+
+
+# This function is copied from socket.py in the Python 2.7 standard
+# library test suite. Added to its signature is only `socket_options`.
+# One additional modification is that we avoid binding to IPv6 servers
+# discovered in DNS if the system doesn't have IPv6 functionality.
+def create_connection(
+    address: tuple[str, int],
+    timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
+    source_address: tuple[str, int] | None = None,
+    socket_options: _TYPE_SOCKET_OPTIONS | None = None,
+) -> socket.socket:
+    """Connect to *address* and return the socket object.
+
+    Convenience function.  Connect to *address* (a 2-tuple ``(host,
+    port)``) and return the socket object.  Passing the optional
+    *timeout* parameter will set the timeout on the socket instance
+    before attempting to connect.  If no *timeout* is supplied, the
+    global default timeout setting returned by :func:`socket.getdefaulttimeout`
+    is used.  If *source_address* is set it must be a tuple of (host, port)
+    for the socket to bind as a source address before making the connection.
+    An host of '' or port 0 tells the OS to use the default.
+    """
+
+    host, port = address
+    if host.startswith("["):
+        host = host.strip("[]")
+    err = None
+
+    # Using the value from allowed_gai_family() in the context of getaddrinfo lets
+    # us select whether to work with IPv4 DNS records, IPv6 records, or both.
+    # The original create_connection function always returns all records.
+    family = allowed_gai_family()
+
+    try:
+        host.encode("idna")
+    except UnicodeError:
+        raise LocationParseError(f"'{host}', label empty or too long") from None
+
+    for res in socket.getaddrinfo(host, port, family, socket.SOCK_STREAM):
+        af, socktype, proto, canonname, sa = res
+        sock = None
+        try:
+            sock = socket.socket(af, socktype, proto)
+
+            # If provided, set socket level options before connecting.
+            _set_socket_options(sock, socket_options)
+
+            if timeout is not _DEFAULT_TIMEOUT:
+                sock.settimeout(timeout)
+            if source_address:
+                sock.bind(source_address)
+            sock.connect(sa)
+            # Break explicitly a reference cycle
+            err = None
+            return sock
+
+        except OSError as _:
+            err = _
+            if sock is not None:
+                sock.close()
+
+    if err is not None:
+        try:
+            raise err
+        finally:
+            # Break explicitly a reference cycle
+            err = None
+    else:
+        raise OSError("getaddrinfo returns an empty list")
+
+
+def _set_socket_options(
+    sock: socket.socket, options: _TYPE_SOCKET_OPTIONS | None
+) -> None:
+    if options is None:
+        return
+
+    for opt in options:
+        sock.setsockopt(*opt)
+
+
+def allowed_gai_family() -> socket.AddressFamily:
+    """This function is designed to work in the context of
+    getaddrinfo, where family=socket.AF_UNSPEC is the default and
+    will perform a DNS search for both IPv6 and IPv4 records."""
+
+    family = socket.AF_INET
+    if HAS_IPV6:
+        family = socket.AF_UNSPEC
+    return family
+
+
+def _has_ipv6(host: str) -> bool:
+    """Returns True if the system can bind an IPv6 address."""
+    sock = None
+    has_ipv6 = False
+
+    if socket.has_ipv6:
+        # has_ipv6 returns true if cPython was compiled with IPv6 support.
+        # It does not tell us if the system has IPv6 support enabled. To
+        # determine that we must bind to an IPv6 address.
+        # https://github.com/urllib3/urllib3/pull/611
+        # https://bugs.python.org/issue658327
+        try:
+            sock = socket.socket(socket.AF_INET6)
+            sock.bind((host, 0))
+            has_ipv6 = True
+        except Exception:
+            pass
+
+    if sock:
+        sock.close()
+    return has_ipv6
+
+
+HAS_IPV6 = _has_ipv6("::1")

Scripts/reporter_lib/py38+/urllib3/util/proxy.py

@@ -0,0 +1,43 @@
+from __future__ import annotations
+
+import typing
+
+from .url import Url
+
+if typing.TYPE_CHECKING:
+    from ..connection import ProxyConfig
+
+
+def connection_requires_http_tunnel(
+    proxy_url: Url | None = None,
+    proxy_config: ProxyConfig | None = None,
+    destination_scheme: str | None = None,
+) -> bool:
+    """
+    Returns True if the connection requires an HTTP CONNECT through the proxy.
+
+    :param URL proxy_url:
+        URL of the proxy.
+    :param ProxyConfig proxy_config:
+        Proxy configuration from poolmanager.py
+    :param str destination_scheme:
+        The scheme of the destination. (i.e https, http, etc)
+    """
+    # If we're not using a proxy, no way to use a tunnel.
+    if proxy_url is None:
+        return False
+
+    # HTTP destinations never require tunneling, we always forward.
+    if destination_scheme == "http":
+        return False
+
+    # Support for forwarding with HTTPS proxies and HTTPS destinations.
+    if (
+        proxy_url.scheme == "https"
+        and proxy_config
+        and proxy_config.use_forwarding_for_https
+    ):
+        return False
+
+    # Otherwise always use a tunnel.
+    return True

Scripts/reporter_lib/py38+/urllib3/util/request.py

@@ -0,0 +1,258 @@
+from __future__ import annotations
+
+import io
+import typing
+from base64 import b64encode
+from enum import Enum
+
+from ..exceptions import UnrewindableBodyError
+from .util import to_bytes
+
+if typing.TYPE_CHECKING:
+    from typing import Final
+
+# Pass as a value within ``headers`` to skip
+# emitting some HTTP headers that are added automatically.
+# The only headers that are supported are ``Accept-Encoding``,
+# ``Host``, and ``User-Agent``.
+SKIP_HEADER = "@@@SKIP_HEADER@@@"
+SKIPPABLE_HEADERS = frozenset(["accept-encoding", "host", "user-agent"])
+
+ACCEPT_ENCODING = "gzip,deflate"
+try:
+    try:
+        import brotlicffi as _unused_module_brotli  # type: ignore[import-not-found] # noqa: F401
+    except ImportError:
+        import brotli as _unused_module_brotli  # type: ignore[import-not-found] # noqa: F401
+except ImportError:
+    pass
+else:
+    ACCEPT_ENCODING += ",br"
+try:
+    import zstandard as _unused_module_zstd  # noqa: F401
+except ImportError:
+    pass
+else:
+    ACCEPT_ENCODING += ",zstd"
+
+
+class _TYPE_FAILEDTELL(Enum):
+    token = 0
+
+
+_FAILEDTELL: Final[_TYPE_FAILEDTELL] = _TYPE_FAILEDTELL.token
+
+_TYPE_BODY_POSITION = typing.Union[int, _TYPE_FAILEDTELL]
+
+# When sending a request with these methods we aren't expecting
+# a body so don't need to set an explicit 'Content-Length: 0'
+# The reason we do this in the negative instead of tracking methods
+# which 'should' have a body is because unknown methods should be
+# treated as if they were 'POST' which *does* expect a body.
+_METHODS_NOT_EXPECTING_BODY = {"GET", "HEAD", "DELETE", "TRACE", "OPTIONS", "CONNECT"}
+
+
+def make_headers(
+    keep_alive: bool | None = None,
+    accept_encoding: bool | list[str] | str | None = None,
+    user_agent: str | None = None,
+    basic_auth: str | None = None,
+    proxy_basic_auth: str | None = None,
+    disable_cache: bool | None = None,
+) -> dict[str, str]:
+    """
+    Shortcuts for generating request headers.
+
+    :param keep_alive:
+        If ``True``, adds 'connection: keep-alive' header.
+
+    :param accept_encoding:
+        Can be a boolean, list, or string.
+        ``True`` translates to 'gzip,deflate'.  If the dependencies for
+        Brotli (either the ``brotli`` or ``brotlicffi`` package) and/or Zstandard
+        (the ``zstandard`` package) algorithms are installed, then their encodings are
+        included in the string ('br' and 'zstd', respectively).
+        List will get joined by comma.
+        String will be used as provided.
+
+    :param user_agent:
+        String representing the user-agent you want, such as
+        "python-urllib3/0.6"
+
+    :param basic_auth:
+        Colon-separated username:password string for 'authorization: basic ...'
+        auth header.
+
+    :param proxy_basic_auth:
+        Colon-separated username:password string for 'proxy-authorization: basic ...'
+        auth header.
+
+    :param disable_cache:
+        If ``True``, adds 'cache-control: no-cache' header.
+
+    Example:
+
+    .. code-block:: python
+
+        import urllib3
+
+        print(urllib3.util.make_headers(keep_alive=True, user_agent="Batman/1.0"))
+        # {'connection': 'keep-alive', 'user-agent': 'Batman/1.0'}
+        print(urllib3.util.make_headers(accept_encoding=True))
+        # {'accept-encoding': 'gzip,deflate'}
+    """
+    headers: dict[str, str] = {}
+    if accept_encoding:
+        if isinstance(accept_encoding, str):
+            pass
+        elif isinstance(accept_encoding, list):
+            accept_encoding = ",".join(accept_encoding)
+        else:
+            accept_encoding = ACCEPT_ENCODING
+        headers["accept-encoding"] = accept_encoding
+
+    if user_agent:
+        headers["user-agent"] = user_agent
+
+    if keep_alive:
+        headers["connection"] = "keep-alive"
+
+    if basic_auth:
+        headers["authorization"] = (
+            f"Basic {b64encode(basic_auth.encode('latin-1')).decode()}"
+        )
+
+    if proxy_basic_auth:
+        headers["proxy-authorization"] = (
+            f"Basic {b64encode(proxy_basic_auth.encode('latin-1')).decode()}"
+        )
+
+    if disable_cache:
+        headers["cache-control"] = "no-cache"
+
+    return headers
+
+
+def set_file_position(
+    body: typing.Any, pos: _TYPE_BODY_POSITION | None
+) -> _TYPE_BODY_POSITION | None:
+    """
+    If a position is provided, move file to that point.
+    Otherwise, we'll attempt to record a position for future use.
+    """
+    if pos is not None:
+        rewind_body(body, pos)
+    elif getattr(body, "tell", None) is not None:
+        try:
+            pos = body.tell()
+        except OSError:
+            # This differentiates from None, allowing us to catch
+            # a failed `tell()` later when trying to rewind the body.
+            pos = _FAILEDTELL
+
+    return pos
+
+
+def rewind_body(body: typing.IO[typing.AnyStr], body_pos: _TYPE_BODY_POSITION) -> None:
+    """
+    Attempt to rewind body to a certain position.
+    Primarily used for request redirects and retries.
+
+    :param body:
+        File-like object that supports seek.
+
+    :param int pos:
+        Position to seek to in file.
+    """
+    body_seek = getattr(body, "seek", None)
+    if body_seek is not None and isinstance(body_pos, int):
+        try:
+            body_seek(body_pos)
+        except OSError as e:
+            raise UnrewindableBodyError(
+                "An error occurred when rewinding request body for redirect/retry."
+            ) from e
+    elif body_pos is _FAILEDTELL:
+        raise UnrewindableBodyError(
+            "Unable to record file position for rewinding "
+            "request body during a redirect/retry."
+        )
+    else:
+        raise ValueError(
+            f"body_pos must be of type integer, instead it was {type(body_pos)}."
+        )
+
+
+class ChunksAndContentLength(typing.NamedTuple):
+    chunks: typing.Iterable[bytes] | None
+    content_length: int | None
+
+
+def body_to_chunks(
+    body: typing.Any | None, method: str, blocksize: int
+) -> ChunksAndContentLength:
+    """Takes the HTTP request method, body, and blocksize and
+    transforms them into an iterable of chunks to pass to
+    socket.sendall() and an optional 'Content-Length' header.
+
+    A 'Content-Length' of 'None' indicates the length of the body
+    can't be determined so should use 'Transfer-Encoding: chunked'
+    for framing instead.
+    """
+
+    chunks: typing.Iterable[bytes] | None
+    content_length: int | None
+
+    # No body, we need to make a recommendation on 'Content-Length'
+    # based on whether that request method is expected to have
+    # a body or not.
+    if body is None:
+        chunks = None
+        if method.upper() not in _METHODS_NOT_EXPECTING_BODY:
+            content_length = 0
+        else:
+            content_length = None
+
+    # Bytes or strings become bytes
+    elif isinstance(body, (str, bytes)):
+        chunks = (to_bytes(body),)
+        content_length = len(chunks[0])
+
+    # File-like object, TODO: use seek() and tell() for length?
+    elif hasattr(body, "read"):
+
+        def chunk_readable() -> typing.Iterable[bytes]:
+            nonlocal body, blocksize
+            encode = isinstance(body, io.TextIOBase)
+            while True:
+                datablock = body.read(blocksize)
+                if not datablock:
+                    break
+                if encode:
+                    datablock = datablock.encode("utf-8")
+                yield datablock
+
+        chunks = chunk_readable()
+        content_length = None
+
+    # Otherwise we need to start checking via duck-typing.
+    else:
+        try:
+            # Check if the body implements the buffer API.
+            mv = memoryview(body)
+        except TypeError:
+            try:
+                # Check if the body is an iterable
+                chunks = iter(body)
+                content_length = None
+            except TypeError:
+                raise TypeError(
+                    f"'body' must be a bytes-like object, file-like "
+                    f"object, or iterable. Instead was {body!r}"
+                ) from None
+        else:
+            # Since it implements the buffer API can be passed directly to socket.sendall()
+            chunks = (body,)
+            content_length = mv.nbytes
+
+    return ChunksAndContentLength(chunks=chunks, content_length=content_length)

Scripts/reporter_lib/py38+/urllib3/util/response.py

@@ -0,0 +1,101 @@
+from __future__ import annotations
+
+import http.client as httplib
+from email.errors import MultipartInvariantViolationDefect, StartBoundaryNotFoundDefect
+
+from ..exceptions import HeaderParsingError
+
+
+def is_fp_closed(obj: object) -> bool:
+    """
+    Checks whether a given file-like object is closed.
+
+    :param obj:
+        The file-like object to check.
+    """
+
+    try:
+        # Check `isclosed()` first, in case Python3 doesn't set `closed`.
+        # GH Issue #928
+        return obj.isclosed()  # type: ignore[no-any-return, attr-defined]
+    except AttributeError:
+        pass
+
+    try:
+        # Check via the official file-like-object way.
+        return obj.closed  # type: ignore[no-any-return, attr-defined]
+    except AttributeError:
+        pass
+
+    try:
+        # Check if the object is a container for another file-like object that
+        # gets released on exhaustion (e.g. HTTPResponse).
+        return obj.fp is None  # type: ignore[attr-defined]
+    except AttributeError:
+        pass
+
+    raise ValueError("Unable to determine whether fp is closed.")
+
+
+def assert_header_parsing(headers: httplib.HTTPMessage) -> None:
+    """
+    Asserts whether all headers have been successfully parsed.
+    Extracts encountered errors from the result of parsing headers.
+
+    Only works on Python 3.
+
+    :param http.client.HTTPMessage headers: Headers to verify.
+
+    :raises urllib3.exceptions.HeaderParsingError:
+        If parsing errors are found.
+    """
+
+    # This will fail silently if we pass in the wrong kind of parameter.
+    # To make debugging easier add an explicit check.
+    if not isinstance(headers, httplib.HTTPMessage):
+        raise TypeError(f"expected httplib.Message, got {type(headers)}.")
+
+    unparsed_data = None
+
+    # get_payload is actually email.message.Message.get_payload;
+    # we're only interested in the result if it's not a multipart message
+    if not headers.is_multipart():
+        payload = headers.get_payload()
+
+        if isinstance(payload, (bytes, str)):
+            unparsed_data = payload
+
+    # httplib is assuming a response body is available
+    # when parsing headers even when httplib only sends
+    # header data to parse_headers() This results in
+    # defects on multipart responses in particular.
+    # See: https://github.com/urllib3/urllib3/issues/800
+
+    # So we ignore the following defects:
+    # - StartBoundaryNotFoundDefect:
+    #     The claimed start boundary was never found.
+    # - MultipartInvariantViolationDefect:
+    #     A message claimed to be a multipart but no subparts were found.
+    defects = [
+        defect
+        for defect in headers.defects
+        if not isinstance(
+            defect, (StartBoundaryNotFoundDefect, MultipartInvariantViolationDefect)
+        )
+    ]
+
+    if defects or unparsed_data:
+        raise HeaderParsingError(defects=defects, unparsed_data=unparsed_data)
+
+
+def is_response_to_head(response: httplib.HTTPResponse) -> bool:
+    """
+    Checks whether the request of a response has been a HEAD-request.
+
+    :param http.client.HTTPResponse response:
+        Response to check if the originating request
+        used 'HEAD' as a method.
+    """
+    # FIXME: Can we do this somehow without accessing private httplib _method?
+    method_str = response._method  # type: str  # type: ignore[attr-defined]
+    return method_str.upper() == "HEAD"

Scripts/reporter_lib/py38+/urllib3/util/retry.py

@@ -0,0 +1,533 @@
+from __future__ import annotations
+
+import email
+import logging
+import random
+import re
+import time
+import typing
+from itertools import takewhile
+from types import TracebackType
+
+from ..exceptions import (
+    ConnectTimeoutError,
+    InvalidHeader,
+    MaxRetryError,
+    ProtocolError,
+    ProxyError,
+    ReadTimeoutError,
+    ResponseError,
+)
+from .util import reraise
+
+if typing.TYPE_CHECKING:
+    from typing_extensions import Self
+
+    from ..connectionpool import ConnectionPool
+    from ..response import BaseHTTPResponse
+
+log = logging.getLogger(__name__)
+
+
+# Data structure for representing the metadata of requests that result in a retry.
+class RequestHistory(typing.NamedTuple):
+    method: str | None
+    url: str | None
+    error: Exception | None
+    status: int | None
+    redirect_location: str | None
+
+
+class Retry:
+    """Retry configuration.
+
+    Each retry attempt will create a new Retry object with updated values, so
+    they can be safely reused.
+
+    Retries can be defined as a default for a pool:
+
+    .. code-block:: python
+
+        retries = Retry(connect=5, read=2, redirect=5)
+        http = PoolManager(retries=retries)
+        response = http.request("GET", "https://example.com/")
+
+    Or per-request (which overrides the default for the pool):
+
+    .. code-block:: python
+
+        response = http.request("GET", "https://example.com/", retries=Retry(10))
+
+    Retries can be disabled by passing ``False``:
+
+    .. code-block:: python
+
+        response = http.request("GET", "https://example.com/", retries=False)
+
+    Errors will be wrapped in :class:`~urllib3.exceptions.MaxRetryError` unless
+    retries are disabled, in which case the causing exception will be raised.
+
+    :param int total:
+        Total number of retries to allow. Takes precedence over other counts.
+
+        Set to ``None`` to remove this constraint and fall back on other
+        counts.
+
+        Set to ``0`` to fail on the first retry.
+
+        Set to ``False`` to disable and imply ``raise_on_redirect=False``.
+
+    :param int connect:
+        How many connection-related errors to retry on.
+
+        These are errors raised before the request is sent to the remote server,
+        which we assume has not triggered the server to process the request.
+
+        Set to ``0`` to fail on the first retry of this type.
+
+    :param int read:
+        How many times to retry on read errors.
+
+        These errors are raised after the request was sent to the server, so the
+        request may have side-effects.
+
+        Set to ``0`` to fail on the first retry of this type.
+
+    :param int redirect:
+        How many redirects to perform. Limit this to avoid infinite redirect
+        loops.
+
+        A redirect is a HTTP response with a status code 301, 302, 303, 307 or
+        308.
+
+        Set to ``0`` to fail on the first retry of this type.
+
+        Set to ``False`` to disable and imply ``raise_on_redirect=False``.
+
+    :param int status:
+        How many times to retry on bad status codes.
+
+        These are retries made on responses, where status code matches
+        ``status_forcelist``.
+
+        Set to ``0`` to fail on the first retry of this type.
+
+    :param int other:
+        How many times to retry on other errors.
+
+        Other errors are errors that are not connect, read, redirect or status errors.
+        These errors might be raised after the request was sent to the server, so the
+        request might have side-effects.
+
+        Set to ``0`` to fail on the first retry of this type.
+
+        If ``total`` is not set, it's a good idea to set this to 0 to account
+        for unexpected edge cases and avoid infinite retry loops.
+
+    :param Collection allowed_methods:
+        Set of uppercased HTTP method verbs that we should retry on.
+
+        By default, we only retry on methods which are considered to be
+        idempotent (multiple requests with the same parameters end with the
+        same state). See :attr:`Retry.DEFAULT_ALLOWED_METHODS`.
+
+        Set to a ``None`` value to retry on any verb.
+
+    :param Collection status_forcelist:
+        A set of integer HTTP status codes that we should force a retry on.
+        A retry is initiated if the request method is in ``allowed_methods``
+        and the response status code is in ``status_forcelist``.
+
+        By default, this is disabled with ``None``.
+
+    :param float backoff_factor:
+        A backoff factor to apply between attempts after the second try
+        (most errors are resolved immediately by a second try without a
+        delay). urllib3 will sleep for::
+
+            {backoff factor} * (2 ** ({number of previous retries}))
+
+        seconds. If `backoff_jitter` is non-zero, this sleep is extended by::
+
+            random.uniform(0, {backoff jitter})
+
+        seconds. For example, if the backoff_factor is 0.1, then :func:`Retry.sleep` will
+        sleep for [0.0s, 0.2s, 0.4s, 0.8s, ...] between retries. No backoff will ever
+        be longer than `backoff_max`.
+
+        By default, backoff is disabled (factor set to 0).
+
+    :param bool raise_on_redirect: Whether, if the number of redirects is
+        exhausted, to raise a MaxRetryError, or to return a response with a
+        response code in the 3xx range.
+
+    :param bool raise_on_status: Similar meaning to ``raise_on_redirect``:
+        whether we should raise an exception, or return a response,
+        if status falls in ``status_forcelist`` range and retries have
+        been exhausted.
+
+    :param tuple history: The history of the request encountered during
+        each call to :meth:`~Retry.increment`. The list is in the order
+        the requests occurred. Each list item is of class :class:`RequestHistory`.
+
+    :param bool respect_retry_after_header:
+        Whether to respect Retry-After header on status codes defined as
+        :attr:`Retry.RETRY_AFTER_STATUS_CODES` or not.
+
+    :param Collection remove_headers_on_redirect:
+        Sequence of headers to remove from the request when a response
+        indicating a redirect is returned before firing off the redirected
+        request.
+    """
+
+    #: Default methods to be used for ``allowed_methods``
+    DEFAULT_ALLOWED_METHODS = frozenset(
+        ["HEAD", "GET", "PUT", "DELETE", "OPTIONS", "TRACE"]
+    )
+
+    #: Default status codes to be used for ``status_forcelist``
+    RETRY_AFTER_STATUS_CODES = frozenset([413, 429, 503])
+
+    #: Default headers to be used for ``remove_headers_on_redirect``
+    DEFAULT_REMOVE_HEADERS_ON_REDIRECT = frozenset(
+        ["Cookie", "Authorization", "Proxy-Authorization"]
+    )
+
+    #: Default maximum backoff time.
+    DEFAULT_BACKOFF_MAX = 120
+
+    # Backward compatibility; assigned outside of the class.
+    DEFAULT: typing.ClassVar[Retry]
+
+    def __init__(
+        self,
+        total: bool | int | None = 10,
+        connect: int | None = None,
+        read: int | None = None,
+        redirect: bool | int | None = None,
+        status: int | None = None,
+        other: int | None = None,
+        allowed_methods: typing.Collection[str] | None = DEFAULT_ALLOWED_METHODS,
+        status_forcelist: typing.Collection[int] | None = None,
+        backoff_factor: float = 0,
+        backoff_max: float = DEFAULT_BACKOFF_MAX,
+        raise_on_redirect: bool = True,
+        raise_on_status: bool = True,
+        history: tuple[RequestHistory, ...] | None = None,
+        respect_retry_after_header: bool = True,
+        remove_headers_on_redirect: typing.Collection[
+            str
+        ] = DEFAULT_REMOVE_HEADERS_ON_REDIRECT,
+        backoff_jitter: float = 0.0,
+    ) -> None:
+        self.total = total
+        self.connect = connect
+        self.read = read
+        self.status = status
+        self.other = other
+
+        if redirect is False or total is False:
+            redirect = 0
+            raise_on_redirect = False
+
+        self.redirect = redirect
+        self.status_forcelist = status_forcelist or set()
+        self.allowed_methods = allowed_methods
+        self.backoff_factor = backoff_factor
+        self.backoff_max = backoff_max
+        self.raise_on_redirect = raise_on_redirect
+        self.raise_on_status = raise_on_status
+        self.history = history or ()
+        self.respect_retry_after_header = respect_retry_after_header
+        self.remove_headers_on_redirect = frozenset(
+            h.lower() for h in remove_headers_on_redirect
+        )
+        self.backoff_jitter = backoff_jitter
+
+    def new(self, **kw: typing.Any) -> Self:
+        params = dict(
+            total=self.total,
+            connect=self.connect,
+            read=self.read,
+            redirect=self.redirect,
+            status=self.status,
+            other=self.other,
+            allowed_methods=self.allowed_methods,
+            status_forcelist=self.status_forcelist,
+            backoff_factor=self.backoff_factor,
+            backoff_max=self.backoff_max,
+            raise_on_redirect=self.raise_on_redirect,
+            raise_on_status=self.raise_on_status,
+            history=self.history,
+            remove_headers_on_redirect=self.remove_headers_on_redirect,
+            respect_retry_after_header=self.respect_retry_after_header,
+            backoff_jitter=self.backoff_jitter,
+        )
+
+        params.update(kw)
+        return type(self)(**params)  # type: ignore[arg-type]
+
+    @classmethod
+    def from_int(
+        cls,
+        retries: Retry | bool | int | None,
+        redirect: bool | int | None = True,
+        default: Retry | bool | int | None = None,
+    ) -> Retry:
+        """Backwards-compatibility for the old retries format."""
+        if retries is None:
+            retries = default if default is not None else cls.DEFAULT
+
+        if isinstance(retries, Retry):
+            return retries
+
+        redirect = bool(redirect) and None
+        new_retries = cls(retries, redirect=redirect)
+        log.debug("Converted retries value: %r -> %r", retries, new_retries)
+        return new_retries
+
+    def get_backoff_time(self) -> float:
+        """Formula for computing the current backoff
+
+        :rtype: float
+        """
+        # We want to consider only the last consecutive errors sequence (Ignore redirects).
+        consecutive_errors_len = len(
+            list(
+                takewhile(lambda x: x.redirect_location is None, reversed(self.history))
+            )
+        )
+        if consecutive_errors_len <= 1:
+            return 0
+
+        backoff_value = self.backoff_factor * (2 ** (consecutive_errors_len - 1))
+        if self.backoff_jitter != 0.0:
+            backoff_value += random.random() * self.backoff_jitter
+        return float(max(0, min(self.backoff_max, backoff_value)))
+
+    def parse_retry_after(self, retry_after: str) -> float:
+        seconds: float
+        # Whitespace: https://tools.ietf.org/html/rfc7230#section-3.2.4
+        if re.match(r"^\s*[0-9]+\s*$", retry_after):
+            seconds = int(retry_after)
+        else:
+            retry_date_tuple = email.utils.parsedate_tz(retry_after)
+            if retry_date_tuple is None:
+                raise InvalidHeader(f"Invalid Retry-After header: {retry_after}")
+
+            retry_date = email.utils.mktime_tz(retry_date_tuple)
+            seconds = retry_date - time.time()
+
+        seconds = max(seconds, 0)
+
+        return seconds
+
+    def get_retry_after(self, response: BaseHTTPResponse) -> float | None:
+        """Get the value of Retry-After in seconds."""
+
+        retry_after = response.headers.get("Retry-After")
+
+        if retry_after is None:
+            return None
+
+        return self.parse_retry_after(retry_after)
+
+    def sleep_for_retry(self, response: BaseHTTPResponse) -> bool:
+        retry_after = self.get_retry_after(response)
+        if retry_after:
+            time.sleep(retry_after)
+            return True
+
+        return False
+
+    def _sleep_backoff(self) -> None:
+        backoff = self.get_backoff_time()
+        if backoff <= 0:
+            return
+        time.sleep(backoff)
+
+    def sleep(self, response: BaseHTTPResponse | None = None) -> None:
+        """Sleep between retry attempts.
+
+        This method will respect a server's ``Retry-After`` response header
+        and sleep the duration of the time requested. If that is not present, it
+        will use an exponential backoff. By default, the backoff factor is 0 and
+        this method will return immediately.
+        """
+
+        if self.respect_retry_after_header and response:
+            slept = self.sleep_for_retry(response)
+            if slept:
+                return
+
+        self._sleep_backoff()
+
+    def _is_connection_error(self, err: Exception) -> bool:
+        """Errors when we're fairly sure that the server did not receive the
+        request, so it should be safe to retry.
+        """
+        if isinstance(err, ProxyError):
+            err = err.original_error
+        return isinstance(err, ConnectTimeoutError)
+
+    def _is_read_error(self, err: Exception) -> bool:
+        """Errors that occur after the request has been started, so we should
+        assume that the server began processing it.
+        """
+        return isinstance(err, (ReadTimeoutError, ProtocolError))
+
+    def _is_method_retryable(self, method: str) -> bool:
+        """Checks if a given HTTP method should be retried upon, depending if
+        it is included in the allowed_methods
+        """
+        if self.allowed_methods and method.upper() not in self.allowed_methods:
+            return False
+        return True
+
+    def is_retry(
+        self, method: str, status_code: int, has_retry_after: bool = False
+    ) -> bool:
+        """Is this method/status code retryable? (Based on allowlists and control
+        variables such as the number of total retries to allow, whether to
+        respect the Retry-After header, whether this header is present, and
+        whether the returned status code is on the list of status codes to
+        be retried upon on the presence of the aforementioned header)
+        """
+        if not self._is_method_retryable(method):
+            return False
+
+        if self.status_forcelist and status_code in self.status_forcelist:
+            return True
+
+        return bool(
+            self.total
+            and self.respect_retry_after_header
+            and has_retry_after
+            and (status_code in self.RETRY_AFTER_STATUS_CODES)
+        )
+
+    def is_exhausted(self) -> bool:
+        """Are we out of retries?"""
+        retry_counts = [
+            x
+            for x in (
+                self.total,
+                self.connect,
+                self.read,
+                self.redirect,
+                self.status,
+                self.other,
+            )
+            if x
+        ]
+        if not retry_counts:
+            return False
+
+        return min(retry_counts) < 0
+
+    def increment(
+        self,
+        method: str | None = None,
+        url: str | None = None,
+        response: BaseHTTPResponse | None = None,
+        error: Exception | None = None,
+        _pool: ConnectionPool | None = None,
+        _stacktrace: TracebackType | None = None,
+    ) -> Self:
+        """Return a new Retry object with incremented retry counters.
+
+        :param response: A response object, or None, if the server did not
+            return a response.
+        :type response: :class:`~urllib3.response.BaseHTTPResponse`
+        :param Exception error: An error encountered during the request, or
+            None if the response was received successfully.
+
+        :return: A new ``Retry`` object.
+        """
+        if self.total is False and error:
+            # Disabled, indicate to re-raise the error.
+            raise reraise(type(error), error, _stacktrace)
+
+        total = self.total
+        if total is not None:
+            total -= 1
+
+        connect = self.connect
+        read = self.read
+        redirect = self.redirect
+        status_count = self.status
+        other = self.other
+        cause = "unknown"
+        status = None
+        redirect_location = None
+
+        if error and self._is_connection_error(error):
+            # Connect retry?
+            if connect is False:
+                raise reraise(type(error), error, _stacktrace)
+            elif connect is not None:
+                connect -= 1
+
+        elif error and self._is_read_error(error):
+            # Read retry?
+            if read is False or method is None or not self._is_method_retryable(method):
+                raise reraise(type(error), error, _stacktrace)
+            elif read is not None:
+                read -= 1
+
+        elif error:
+            # Other retry?
+            if other is not None:
+                other -= 1
+
+        elif response and response.get_redirect_location():
+            # Redirect retry?
+            if redirect is not None:
+                redirect -= 1
+            cause = "too many redirects"
+            response_redirect_location = response.get_redirect_location()
+            if response_redirect_location:
+                redirect_location = response_redirect_location
+            status = response.status
+
+        else:
+            # Incrementing because of a server error like a 500 in
+            # status_forcelist and the given method is in the allowed_methods
+            cause = ResponseError.GENERIC_ERROR
+            if response and response.status:
+                if status_count is not None:
+                    status_count -= 1
+                cause = ResponseError.SPECIFIC_ERROR.format(status_code=response.status)
+                status = response.status
+
+        history = self.history + (
+            RequestHistory(method, url, error, status, redirect_location),
+        )
+
+        new_retry = self.new(
+            total=total,
+            connect=connect,
+            read=read,
+            redirect=redirect,
+            status=status_count,
+            other=other,
+            history=history,
+        )
+
+        if new_retry.is_exhausted():
+            reason = error or ResponseError(cause)
+            raise MaxRetryError(_pool, url, reason) from reason  # type: ignore[arg-type]
+
+        log.debug("Incremented Retry for (url='%s'): %r", url, new_retry)
+
+        return new_retry
+
+    def __repr__(self) -> str:
+        return (
+            f"{type(self).__name__}(total={self.total}, connect={self.connect}, "
+            f"read={self.read}, redirect={self.redirect}, status={self.status})"
+        )
+
+
+# For backwards compatibility (equivalent to pre-v1.9):
+Retry.DEFAULT = Retry(3)

Scripts/reporter_lib/py38+/urllib3/util/ssl_.py

@@ -0,0 +1,504 @@
+from __future__ import annotations
+
+import hashlib
+import hmac
+import os
+import socket
+import sys
+import typing
+import warnings
+from binascii import unhexlify
+
+from ..exceptions import ProxySchemeUnsupported, SSLError
+from .url import _BRACELESS_IPV6_ADDRZ_RE, _IPV4_RE
+
+SSLContext = None
+SSLTransport = None
+HAS_NEVER_CHECK_COMMON_NAME = False
+IS_PYOPENSSL = False
+ALPN_PROTOCOLS = ["http/1.1"]
+
+_TYPE_VERSION_INFO = tuple[int, int, int, str, int]
+
+# Maps the length of a digest to a possible hash function producing this digest
+HASHFUNC_MAP = {
+    length: getattr(hashlib, algorithm, None)
+    for length, algorithm in ((32, "md5"), (40, "sha1"), (64, "sha256"))
+}
+
+
+def _is_bpo_43522_fixed(
+    implementation_name: str,
+    version_info: _TYPE_VERSION_INFO,
+    pypy_version_info: _TYPE_VERSION_INFO | None,
+) -> bool:
+    """Return True for CPython 3.9.3+ or 3.10+ and PyPy 7.3.8+ where
+    setting SSLContext.hostname_checks_common_name to False works.
+
+    Outside of CPython and PyPy we don't know which implementations work
+    or not so we conservatively use our hostname matching as we know that works
+    on all implementations.
+
+    https://github.com/urllib3/urllib3/issues/2192#issuecomment-821832963
+    https://foss.heptapod.net/pypy/pypy/-/issues/3539
+    """
+    if implementation_name == "pypy":
+        # https://foss.heptapod.net/pypy/pypy/-/issues/3129
+        return pypy_version_info >= (7, 3, 8)  # type: ignore[operator]
+    elif implementation_name == "cpython":
+        major_minor = version_info[:2]
+        micro = version_info[2]
+        return (major_minor == (3, 9) and micro >= 3) or major_minor >= (3, 10)
+    else:  # Defensive:
+        return False
+
+
+def _is_has_never_check_common_name_reliable(
+    openssl_version: str,
+    openssl_version_number: int,
+    implementation_name: str,
+    version_info: _TYPE_VERSION_INFO,
+    pypy_version_info: _TYPE_VERSION_INFO | None,
+) -> bool:
+    # As of May 2023, all released versions of LibreSSL fail to reject certificates with
+    # only common names, see https://github.com/urllib3/urllib3/pull/3024
+    is_openssl = openssl_version.startswith("OpenSSL ")
+    # Before fixing OpenSSL issue #14579, the SSL_new() API was not copying hostflags
+    # like X509_CHECK_FLAG_NEVER_CHECK_SUBJECT, which tripped up CPython.
+    # https://github.com/openssl/openssl/issues/14579
+    # This was released in OpenSSL 1.1.1l+ (>=0x101010cf)
+    is_openssl_issue_14579_fixed = openssl_version_number >= 0x101010CF
+
+    return is_openssl and (
+        is_openssl_issue_14579_fixed
+        or _is_bpo_43522_fixed(implementation_name, version_info, pypy_version_info)
+    )
+
+
+if typing.TYPE_CHECKING:
+    from ssl import VerifyMode
+    from typing import TypedDict
+
+    from .ssltransport import SSLTransport as SSLTransportType
+
+    class _TYPE_PEER_CERT_RET_DICT(TypedDict, total=False):
+        subjectAltName: tuple[tuple[str, str], ...]
+        subject: tuple[tuple[tuple[str, str], ...], ...]
+        serialNumber: str
+
+
+# Mapping from 'ssl.PROTOCOL_TLSX' to 'TLSVersion.X'
+_SSL_VERSION_TO_TLS_VERSION: dict[int, int] = {}
+
+try:  # Do we have ssl at all?
+    import ssl
+    from ssl import (  # type: ignore[assignment]
+        CERT_REQUIRED,
+        HAS_NEVER_CHECK_COMMON_NAME,
+        OP_NO_COMPRESSION,
+        OP_NO_TICKET,
+        OPENSSL_VERSION,
+        OPENSSL_VERSION_NUMBER,
+        PROTOCOL_TLS,
+        PROTOCOL_TLS_CLIENT,
+        OP_NO_SSLv2,
+        OP_NO_SSLv3,
+        SSLContext,
+        TLSVersion,
+    )
+
+    PROTOCOL_SSLv23 = PROTOCOL_TLS
+
+    # Setting SSLContext.hostname_checks_common_name = False didn't work before CPython
+    # 3.9.3, and 3.10 (but OK on PyPy) or OpenSSL 1.1.1l+
+    if HAS_NEVER_CHECK_COMMON_NAME and not _is_has_never_check_common_name_reliable(
+        OPENSSL_VERSION,
+        OPENSSL_VERSION_NUMBER,
+        sys.implementation.name,
+        sys.version_info,
+        sys.pypy_version_info if sys.implementation.name == "pypy" else None,  # type: ignore[attr-defined]
+    ):
+        HAS_NEVER_CHECK_COMMON_NAME = False
+
+    # Need to be careful here in case old TLS versions get
+    # removed in future 'ssl' module implementations.
+    for attr in ("TLSv1", "TLSv1_1", "TLSv1_2"):
+        try:
+            _SSL_VERSION_TO_TLS_VERSION[getattr(ssl, f"PROTOCOL_{attr}")] = getattr(
+                TLSVersion, attr
+            )
+        except AttributeError:  # Defensive:
+            continue
+
+    from .ssltransport import SSLTransport  # type: ignore[assignment]
+except ImportError:
+    OP_NO_COMPRESSION = 0x20000  # type: ignore[assignment]
+    OP_NO_TICKET = 0x4000  # type: ignore[assignment]
+    OP_NO_SSLv2 = 0x1000000  # type: ignore[assignment]
+    OP_NO_SSLv3 = 0x2000000  # type: ignore[assignment]
+    PROTOCOL_SSLv23 = PROTOCOL_TLS = 2  # type: ignore[assignment]
+    PROTOCOL_TLS_CLIENT = 16  # type: ignore[assignment]
+
+
+_TYPE_PEER_CERT_RET = typing.Union["_TYPE_PEER_CERT_RET_DICT", bytes, None]
+
+
+def assert_fingerprint(cert: bytes | None, fingerprint: str) -> None:
+    """
+    Checks if given fingerprint matches the supplied certificate.
+
+    :param cert:
+        Certificate as bytes object.
+    :param fingerprint:
+        Fingerprint as string of hexdigits, can be interspersed by colons.
+    """
+
+    if cert is None:
+        raise SSLError("No certificate for the peer.")
+
+    fingerprint = fingerprint.replace(":", "").lower()
+    digest_length = len(fingerprint)
+    if digest_length not in HASHFUNC_MAP:
+        raise SSLError(f"Fingerprint of invalid length: {fingerprint}")
+    hashfunc = HASHFUNC_MAP.get(digest_length)
+    if hashfunc is None:
+        raise SSLError(
+            f"Hash function implementation unavailable for fingerprint length: {digest_length}"
+        )
+
+    # We need encode() here for py32; works on py2 and p33.
+    fingerprint_bytes = unhexlify(fingerprint.encode())
+
+    cert_digest = hashfunc(cert).digest()
+
+    if not hmac.compare_digest(cert_digest, fingerprint_bytes):
+        raise SSLError(
+            f'Fingerprints did not match. Expected "{fingerprint}", got "{cert_digest.hex()}"'
+        )
+
+
+def resolve_cert_reqs(candidate: None | int | str) -> VerifyMode:
+    """
+    Resolves the argument to a numeric constant, which can be passed to
+    the wrap_socket function/method from the ssl module.
+    Defaults to :data:`ssl.CERT_REQUIRED`.
+    If given a string it is assumed to be the name of the constant in the
+    :mod:`ssl` module or its abbreviation.
+    (So you can specify `REQUIRED` instead of `CERT_REQUIRED`.
+    If it's neither `None` nor a string we assume it is already the numeric
+    constant which can directly be passed to wrap_socket.
+    """
+    if candidate is None:
+        return CERT_REQUIRED
+
+    if isinstance(candidate, str):
+        res = getattr(ssl, candidate, None)
+        if res is None:
+            res = getattr(ssl, "CERT_" + candidate)
+        return res  # type: ignore[no-any-return]
+
+    return candidate  # type: ignore[return-value]
+
+
+def resolve_ssl_version(candidate: None | int | str) -> int:
+    """
+    like resolve_cert_reqs
+    """
+    if candidate is None:
+        return PROTOCOL_TLS
+
+    if isinstance(candidate, str):
+        res = getattr(ssl, candidate, None)
+        if res is None:
+            res = getattr(ssl, "PROTOCOL_" + candidate)
+        return typing.cast(int, res)
+
+    return candidate
+
+
+def create_urllib3_context(
+    ssl_version: int | None = None,
+    cert_reqs: int | None = None,
+    options: int | None = None,
+    ciphers: str | None = None,
+    ssl_minimum_version: int | None = None,
+    ssl_maximum_version: int | None = None,
+) -> ssl.SSLContext:
+    """Creates and configures an :class:`ssl.SSLContext` instance for use with urllib3.
+
+    :param ssl_version:
+        The desired protocol version to use. This will default to
+        PROTOCOL_SSLv23 which will negotiate the highest protocol that both
+        the server and your installation of OpenSSL support.
+
+        This parameter is deprecated instead use 'ssl_minimum_version'.
+    :param ssl_minimum_version:
+        The minimum version of TLS to be used. Use the 'ssl.TLSVersion' enum for specifying the value.
+    :param ssl_maximum_version:
+        The maximum version of TLS to be used. Use the 'ssl.TLSVersion' enum for specifying the value.
+        Not recommended to set to anything other than 'ssl.TLSVersion.MAXIMUM_SUPPORTED' which is the
+        default value.
+    :param cert_reqs:
+        Whether to require the certificate verification. This defaults to
+        ``ssl.CERT_REQUIRED``.
+    :param options:
+        Specific OpenSSL options. These default to ``ssl.OP_NO_SSLv2``,
+        ``ssl.OP_NO_SSLv3``, ``ssl.OP_NO_COMPRESSION``, and ``ssl.OP_NO_TICKET``.
+    :param ciphers:
+        Which cipher suites to allow the server to select. Defaults to either system configured
+        ciphers if OpenSSL 1.1.1+, otherwise uses a secure default set of ciphers.
+    :returns:
+        Constructed SSLContext object with specified options
+    :rtype: SSLContext
+    """
+    if SSLContext is None:
+        raise TypeError("Can't create an SSLContext object without an ssl module")
+
+    # This means 'ssl_version' was specified as an exact value.
+    if ssl_version not in (None, PROTOCOL_TLS, PROTOCOL_TLS_CLIENT):
+        # Disallow setting 'ssl_version' and 'ssl_minimum|maximum_version'
+        # to avoid conflicts.
+        if ssl_minimum_version is not None or ssl_maximum_version is not None:
+            raise ValueError(
+                "Can't specify both 'ssl_version' and either "
+                "'ssl_minimum_version' or 'ssl_maximum_version'"
+            )
+
+        # 'ssl_version' is deprecated and will be removed in the future.
+        else:
+            # Use 'ssl_minimum_version' and 'ssl_maximum_version' instead.
+            ssl_minimum_version = _SSL_VERSION_TO_TLS_VERSION.get(
+                ssl_version, TLSVersion.MINIMUM_SUPPORTED
+            )
+            ssl_maximum_version = _SSL_VERSION_TO_TLS_VERSION.get(
+                ssl_version, TLSVersion.MAXIMUM_SUPPORTED
+            )
+
+            # This warning message is pushing users to use 'ssl_minimum_version'
+            # instead of both min/max. Best practice is to only set the minimum version and
+            # keep the maximum version to be it's default value: 'TLSVersion.MAXIMUM_SUPPORTED'
+            warnings.warn(
+                "'ssl_version' option is deprecated and will be "
+                "removed in urllib3 v2.1.0. Instead use 'ssl_minimum_version'",
+                category=DeprecationWarning,
+                stacklevel=2,
+            )
+
+    # PROTOCOL_TLS is deprecated in Python 3.10 so we always use PROTOCOL_TLS_CLIENT
+    context = SSLContext(PROTOCOL_TLS_CLIENT)
+
+    if ssl_minimum_version is not None:
+        context.minimum_version = ssl_minimum_version
+    else:  # Python <3.10 defaults to 'MINIMUM_SUPPORTED' so explicitly set TLSv1.2 here
+        context.minimum_version = TLSVersion.TLSv1_2
+
+    if ssl_maximum_version is not None:
+        context.maximum_version = ssl_maximum_version
+
+    # Unless we're given ciphers defer to either system ciphers in
+    # the case of OpenSSL 1.1.1+ or use our own secure default ciphers.
+    if ciphers:
+        context.set_ciphers(ciphers)
+
+    # Setting the default here, as we may have no ssl module on import
+    cert_reqs = ssl.CERT_REQUIRED if cert_reqs is None else cert_reqs
+
+    if options is None:
+        options = 0
+        # SSLv2 is easily broken and is considered harmful and dangerous
+        options |= OP_NO_SSLv2
+        # SSLv3 has several problems and is now dangerous
+        options |= OP_NO_SSLv3
+        # Disable compression to prevent CRIME attacks for OpenSSL 1.0+
+        # (issue #309)
+        options |= OP_NO_COMPRESSION
+        # TLSv1.2 only. Unless set explicitly, do not request tickets.
+        # This may save some bandwidth on wire, and although the ticket is encrypted,
+        # there is a risk associated with it being on wire,
+        # if the server is not rotating its ticketing keys properly.
+        options |= OP_NO_TICKET
+
+    context.options |= options
+
+    # Enable post-handshake authentication for TLS 1.3, see GH #1634. PHA is
+    # necessary for conditional client cert authentication with TLS 1.3.
+    # The attribute is None for OpenSSL <= 1.1.0 or does not exist when using
+    # an SSLContext created by pyOpenSSL.
+    if getattr(context, "post_handshake_auth", None) is not None:
+        context.post_handshake_auth = True
+
+    # The order of the below lines setting verify_mode and check_hostname
+    # matter due to safe-guards SSLContext has to prevent an SSLContext with
+    # check_hostname=True, verify_mode=NONE/OPTIONAL.
+    # We always set 'check_hostname=False' for pyOpenSSL so we rely on our own
+    # 'ssl.match_hostname()' implementation.
+    if cert_reqs == ssl.CERT_REQUIRED and not IS_PYOPENSSL:
+        context.verify_mode = cert_reqs
+        context.check_hostname = True
+    else:
+        context.check_hostname = False
+        context.verify_mode = cert_reqs
+
+    try:
+        context.hostname_checks_common_name = False
+    except AttributeError:  # Defensive: for CPython < 3.9.3; for PyPy < 7.3.8
+        pass
+
+    sslkeylogfile = os.environ.get("SSLKEYLOGFILE")
+    if sslkeylogfile:
+        context.keylog_filename = sslkeylogfile
+
+    return context
+
+
+@typing.overload
+def ssl_wrap_socket(
+    sock: socket.socket,
+    keyfile: str | None = ...,
+    certfile: str | None = ...,
+    cert_reqs: int | None = ...,
+    ca_certs: str | None = ...,
+    server_hostname: str | None = ...,
+    ssl_version: int | None = ...,
+    ciphers: str | None = ...,
+    ssl_context: ssl.SSLContext | None = ...,
+    ca_cert_dir: str | None = ...,
+    key_password: str | None = ...,
+    ca_cert_data: None | str | bytes = ...,
+    tls_in_tls: typing.Literal[False] = ...,
+) -> ssl.SSLSocket: ...
+
+
+@typing.overload
+def ssl_wrap_socket(
+    sock: socket.socket,
+    keyfile: str | None = ...,
+    certfile: str | None = ...,
+    cert_reqs: int | None = ...,
+    ca_certs: str | None = ...,
+    server_hostname: str | None = ...,
+    ssl_version: int | None = ...,
+    ciphers: str | None = ...,
+    ssl_context: ssl.SSLContext | None = ...,
+    ca_cert_dir: str | None = ...,
+    key_password: str | None = ...,
+    ca_cert_data: None | str | bytes = ...,
+    tls_in_tls: bool = ...,
+) -> ssl.SSLSocket | SSLTransportType: ...
+
+
+def ssl_wrap_socket(
+    sock: socket.socket,
+    keyfile: str | None = None,
+    certfile: str | None = None,
+    cert_reqs: int | None = None,
+    ca_certs: str | None = None,
+    server_hostname: str | None = None,
+    ssl_version: int | None = None,
+    ciphers: str | None = None,
+    ssl_context: ssl.SSLContext | None = None,
+    ca_cert_dir: str | None = None,
+    key_password: str | None = None,
+    ca_cert_data: None | str | bytes = None,
+    tls_in_tls: bool = False,
+) -> ssl.SSLSocket | SSLTransportType:
+    """
+    All arguments except for server_hostname, ssl_context, tls_in_tls, ca_cert_data and
+    ca_cert_dir have the same meaning as they do when using
+    :func:`ssl.create_default_context`, :meth:`ssl.SSLContext.load_cert_chain`,
+    :meth:`ssl.SSLContext.set_ciphers` and :meth:`ssl.SSLContext.wrap_socket`.
+
+    :param server_hostname:
+        When SNI is supported, the expected hostname of the certificate
+    :param ssl_context:
+        A pre-made :class:`SSLContext` object. If none is provided, one will
+        be created using :func:`create_urllib3_context`.
+    :param ciphers:
+        A string of ciphers we wish the client to support.
+    :param ca_cert_dir:
+        A directory containing CA certificates in multiple separate files, as
+        supported by OpenSSL's -CApath flag or the capath argument to
+        SSLContext.load_verify_locations().
+    :param key_password:
+        Optional password if the keyfile is encrypted.
+    :param ca_cert_data:
+        Optional string containing CA certificates in PEM format suitable for
+        passing as the cadata parameter to SSLContext.load_verify_locations()
+    :param tls_in_tls:
+        Use SSLTransport to wrap the existing socket.
+    """
+    context = ssl_context
+    if context is None:
+        # Note: This branch of code and all the variables in it are only used in tests.
+        # We should consider deprecating and removing this code.
+        context = create_urllib3_context(ssl_version, cert_reqs, ciphers=ciphers)
+
+    if ca_certs or ca_cert_dir or ca_cert_data:
+        try:
+            context.load_verify_locations(ca_certs, ca_cert_dir, ca_cert_data)
+        except OSError as e:
+            raise SSLError(e) from e
+
+    elif ssl_context is None and hasattr(context, "load_default_certs"):
+        # try to load OS default certs; works well on Windows.
+        context.load_default_certs()
+
+    # Attempt to detect if we get the goofy behavior of the
+    # keyfile being encrypted and OpenSSL asking for the
+    # passphrase via the terminal and instead error out.
+    if keyfile and key_password is None and _is_key_file_encrypted(keyfile):
+        raise SSLError("Client private key is encrypted, password is required")
+
+    if certfile:
+        if key_password is None:
+            context.load_cert_chain(certfile, keyfile)
+        else:
+            context.load_cert_chain(certfile, keyfile, key_password)
+
+    context.set_alpn_protocols(ALPN_PROTOCOLS)
+
+    ssl_sock = _ssl_wrap_socket_impl(sock, context, tls_in_tls, server_hostname)
+    return ssl_sock
+
+
+def is_ipaddress(hostname: str | bytes) -> bool:
+    """Detects whether the hostname given is an IPv4 or IPv6 address.
+    Also detects IPv6 addresses with Zone IDs.
+
+    :param str hostname: Hostname to examine.
+    :return: True if the hostname is an IP address, False otherwise.
+    """
+    if isinstance(hostname, bytes):
+        # IDN A-label bytes are ASCII compatible.
+        hostname = hostname.decode("ascii")
+    return bool(_IPV4_RE.match(hostname) or _BRACELESS_IPV6_ADDRZ_RE.match(hostname))
+
+
+def _is_key_file_encrypted(key_file: str) -> bool:
+    """Detects if a key file is encrypted or not."""
+    with open(key_file) as f:
+        for line in f:
+            # Look for Proc-Type: 4,ENCRYPTED
+            if "ENCRYPTED" in line:
+                return True
+
+    return False
+
+
+def _ssl_wrap_socket_impl(
+    sock: socket.socket,
+    ssl_context: ssl.SSLContext,
+    tls_in_tls: bool,
+    server_hostname: str | None = None,
+) -> ssl.SSLSocket | SSLTransportType:
+    if tls_in_tls:
+        if not SSLTransport:
+            # Import error, ssl is not available.
+            raise ProxySchemeUnsupported(
+                "TLS in TLS requires support for the 'ssl' module"
+            )
+
+        SSLTransport._validate_ssl_context_for_tls_in_tls(ssl_context)
+        return SSLTransport(sock, ssl_context, server_hostname)
+
+    return ssl_context.wrap_socket(sock, server_hostname=server_hostname)

Scripts/reporter_lib/py38+/urllib3/util/ssl_match_hostname.py

@@ -0,0 +1,159 @@
+"""The match_hostname() function from Python 3.5, essential when using SSL."""
+
+# Note: This file is under the PSF license as the code comes from the python
+# stdlib.   http://docs.python.org/3/license.html
+# It is modified to remove commonName support.
+
+from __future__ import annotations
+
+import ipaddress
+import re
+import typing
+from ipaddress import IPv4Address, IPv6Address
+
+if typing.TYPE_CHECKING:
+    from .ssl_ import _TYPE_PEER_CERT_RET_DICT
+
+__version__ = "3.5.0.1"
+
+
+class CertificateError(ValueError):
+    pass
+
+
+def _dnsname_match(
+    dn: typing.Any, hostname: str, max_wildcards: int = 1
+) -> typing.Match[str] | None | bool:
+    """Matching according to RFC 6125, section 6.4.3
+
+    http://tools.ietf.org/html/rfc6125#section-6.4.3
+    """
+    pats = []
+    if not dn:
+        return False
+
+    # Ported from python3-syntax:
+    # leftmost, *remainder = dn.split(r'.')
+    parts = dn.split(r".")
+    leftmost = parts[0]
+    remainder = parts[1:]
+
+    wildcards = leftmost.count("*")
+    if wildcards > max_wildcards:
+        # Issue #17980: avoid denials of service by refusing more
+        # than one wildcard per fragment.  A survey of established
+        # policy among SSL implementations showed it to be a
+        # reasonable choice.
+        raise CertificateError(
+            "too many wildcards in certificate DNS name: " + repr(dn)
+        )
+
+    # speed up common case w/o wildcards
+    if not wildcards:
+        return bool(dn.lower() == hostname.lower())
+
+    # RFC 6125, section 6.4.3, subitem 1.
+    # The client SHOULD NOT attempt to match a presented identifier in which
+    # the wildcard character comprises a label other than the left-most label.
+    if leftmost == "*":
+        # When '*' is a fragment by itself, it matches a non-empty dotless
+        # fragment.
+        pats.append("[^.]+")
+    elif leftmost.startswith("xn--") or hostname.startswith("xn--"):
+        # RFC 6125, section 6.4.3, subitem 3.
+        # The client SHOULD NOT attempt to match a presented identifier
+        # where the wildcard character is embedded within an A-label or
+        # U-label of an internationalized domain name.
+        pats.append(re.escape(leftmost))
+    else:
+        # Otherwise, '*' matches any dotless string, e.g. www*
+        pats.append(re.escape(leftmost).replace(r"\*", "[^.]*"))
+
+    # add the remaining fragments, ignore any wildcards
+    for frag in remainder:
+        pats.append(re.escape(frag))
+
+    pat = re.compile(r"\A" + r"\.".join(pats) + r"\Z", re.IGNORECASE)
+    return pat.match(hostname)
+
+
+def _ipaddress_match(ipname: str, host_ip: IPv4Address | IPv6Address) -> bool:
+    """Exact matching of IP addresses.
+
+    RFC 9110 section 4.3.5: "A reference identity of IP-ID contains the decoded
+    bytes of the IP address. An IP version 4 address is 4 octets, and an IP
+    version 6 address is 16 octets. [...] A reference identity of type IP-ID
+    matches if the address is identical to an iPAddress value of the
+    subjectAltName extension of the certificate."
+    """
+    # OpenSSL may add a trailing newline to a subjectAltName's IP address
+    # Divergence from upstream: ipaddress can't handle byte str
+    ip = ipaddress.ip_address(ipname.rstrip())
+    return bool(ip.packed == host_ip.packed)
+
+
+def match_hostname(
+    cert: _TYPE_PEER_CERT_RET_DICT | None,
+    hostname: str,
+    hostname_checks_common_name: bool = False,
+) -> None:
+    """Verify that *cert* (in decoded format as returned by
+    SSLSocket.getpeercert()) matches the *hostname*.  RFC 2818 and RFC 6125
+    rules are followed, but IP addresses are not accepted for *hostname*.
+
+    CertificateError is raised on failure. On success, the function
+    returns nothing.
+    """
+    if not cert:
+        raise ValueError(
+            "empty or no certificate, match_hostname needs a "
+            "SSL socket or SSL context with either "
+            "CERT_OPTIONAL or CERT_REQUIRED"
+        )
+    try:
+        # Divergence from upstream: ipaddress can't handle byte str
+        #
+        # The ipaddress module shipped with Python < 3.9 does not support
+        # scoped IPv6 addresses so we unconditionally strip the Zone IDs for
+        # now. Once we drop support for Python 3.9 we can remove this branch.
+        if "%" in hostname:
+            host_ip = ipaddress.ip_address(hostname[: hostname.rfind("%")])
+        else:
+            host_ip = ipaddress.ip_address(hostname)
+
+    except ValueError:
+        # Not an IP address (common case)
+        host_ip = None
+    dnsnames = []
+    san: tuple[tuple[str, str], ...] = cert.get("subjectAltName", ())
+    key: str
+    value: str
+    for key, value in san:
+        if key == "DNS":
+            if host_ip is None and _dnsname_match(value, hostname):
+                return
+            dnsnames.append(value)
+        elif key == "IP Address":
+            if host_ip is not None and _ipaddress_match(value, host_ip):
+                return
+            dnsnames.append(value)
+
+    # We only check 'commonName' if it's enabled and we're not verifying
+    # an IP address. IP addresses aren't valid within 'commonName'.
+    if hostname_checks_common_name and host_ip is None and not dnsnames:
+        for sub in cert.get("subject", ()):
+            for key, value in sub:
+                if key == "commonName":
+                    if _dnsname_match(value, hostname):
+                        return
+                    dnsnames.append(value)
+
+    if len(dnsnames) > 1:
+        raise CertificateError(
+            "hostname %r "
+            "doesn't match either of %s" % (hostname, ", ".join(map(repr, dnsnames)))
+        )
+    elif len(dnsnames) == 1:
+        raise CertificateError(f"hostname {hostname!r} doesn't match {dnsnames[0]!r}")
+    else:
+        raise CertificateError("no appropriate subjectAltName fields were found")

Scripts/reporter_lib/py38+/urllib3/util/ssltransport.py

@@ -0,0 +1,271 @@
+from __future__ import annotations
+
+import io
+import socket
+import ssl
+import typing
+
+from ..exceptions import ProxySchemeUnsupported
+
+if typing.TYPE_CHECKING:
+    from typing_extensions import Self
+
+    from .ssl_ import _TYPE_PEER_CERT_RET, _TYPE_PEER_CERT_RET_DICT
+
+
+_WriteBuffer = typing.Union[bytearray, memoryview]
+_ReturnValue = typing.TypeVar("_ReturnValue")
+
+SSL_BLOCKSIZE = 16384
+
+
+class SSLTransport:
+    """
+    The SSLTransport wraps an existing socket and establishes an SSL connection.
+
+    Contrary to Python's implementation of SSLSocket, it allows you to chain
+    multiple TLS connections together. It's particularly useful if you need to
+    implement TLS within TLS.
+
+    The class supports most of the socket API operations.
+    """
+
+    @staticmethod
+    def _validate_ssl_context_for_tls_in_tls(ssl_context: ssl.SSLContext) -> None:
+        """
+        Raises a ProxySchemeUnsupported if the provided ssl_context can't be used
+        for TLS in TLS.
+
+        The only requirement is that the ssl_context provides the 'wrap_bio'
+        methods.
+        """
+
+        if not hasattr(ssl_context, "wrap_bio"):
+            raise ProxySchemeUnsupported(
+                "TLS in TLS requires SSLContext.wrap_bio() which isn't "
+                "available on non-native SSLContext"
+            )
+
+    def __init__(
+        self,
+        socket: socket.socket,
+        ssl_context: ssl.SSLContext,
+        server_hostname: str | None = None,
+        suppress_ragged_eofs: bool = True,
+    ) -> None:
+        """
+        Create an SSLTransport around socket using the provided ssl_context.
+        """
+        self.incoming = ssl.MemoryBIO()
+        self.outgoing = ssl.MemoryBIO()
+
+        self.suppress_ragged_eofs = suppress_ragged_eofs
+        self.socket = socket
+
+        self.sslobj = ssl_context.wrap_bio(
+            self.incoming, self.outgoing, server_hostname=server_hostname
+        )
+
+        # Perform initial handshake.
+        self._ssl_io_loop(self.sslobj.do_handshake)
+
+    def __enter__(self) -> Self:
+        return self
+
+    def __exit__(self, *_: typing.Any) -> None:
+        self.close()
+
+    def fileno(self) -> int:
+        return self.socket.fileno()
+
+    def read(self, len: int = 1024, buffer: typing.Any | None = None) -> int | bytes:
+        return self._wrap_ssl_read(len, buffer)
+
+    def recv(self, buflen: int = 1024, flags: int = 0) -> int | bytes:
+        if flags != 0:
+            raise ValueError("non-zero flags not allowed in calls to recv")
+        return self._wrap_ssl_read(buflen)
+
+    def recv_into(
+        self,
+        buffer: _WriteBuffer,
+        nbytes: int | None = None,
+        flags: int = 0,
+    ) -> None | int | bytes:
+        if flags != 0:
+            raise ValueError("non-zero flags not allowed in calls to recv_into")
+        if nbytes is None:
+            nbytes = len(buffer)
+        return self.read(nbytes, buffer)
+
+    def sendall(self, data: bytes, flags: int = 0) -> None:
+        if flags != 0:
+            raise ValueError("non-zero flags not allowed in calls to sendall")
+        count = 0
+        with memoryview(data) as view, view.cast("B") as byte_view:
+            amount = len(byte_view)
+            while count < amount:
+                v = self.send(byte_view[count:])
+                count += v
+
+    def send(self, data: bytes, flags: int = 0) -> int:
+        if flags != 0:
+            raise ValueError("non-zero flags not allowed in calls to send")
+        return self._ssl_io_loop(self.sslobj.write, data)
+
+    def makefile(
+        self,
+        mode: str,
+        buffering: int | None = None,
+        *,
+        encoding: str | None = None,
+        errors: str | None = None,
+        newline: str | None = None,
+    ) -> typing.BinaryIO | typing.TextIO | socket.SocketIO:
+        """
+        Python's httpclient uses makefile and buffered io when reading HTTP
+        messages and we need to support it.
+
+        This is unfortunately a copy and paste of socket.py makefile with small
+        changes to point to the socket directly.
+        """
+        if not set(mode) <= {"r", "w", "b"}:
+            raise ValueError(f"invalid mode {mode!r} (only r, w, b allowed)")
+
+        writing = "w" in mode
+        reading = "r" in mode or not writing
+        assert reading or writing
+        binary = "b" in mode
+        rawmode = ""
+        if reading:
+            rawmode += "r"
+        if writing:
+            rawmode += "w"
+        raw = socket.SocketIO(self, rawmode)  # type: ignore[arg-type]
+        self.socket._io_refs += 1  # type: ignore[attr-defined]
+        if buffering is None:
+            buffering = -1
+        if buffering < 0:
+            buffering = io.DEFAULT_BUFFER_SIZE
+        if buffering == 0:
+            if not binary:
+                raise ValueError("unbuffered streams must be binary")
+            return raw
+        buffer: typing.BinaryIO
+        if reading and writing:
+            buffer = io.BufferedRWPair(raw, raw, buffering)  # type: ignore[assignment]
+        elif reading:
+            buffer = io.BufferedReader(raw, buffering)
+        else:
+            assert writing
+            buffer = io.BufferedWriter(raw, buffering)
+        if binary:
+            return buffer
+        text = io.TextIOWrapper(buffer, encoding, errors, newline)
+        text.mode = mode  # type: ignore[misc]
+        return text
+
+    def unwrap(self) -> None:
+        self._ssl_io_loop(self.sslobj.unwrap)
+
+    def close(self) -> None:
+        self.socket.close()
+
+    @typing.overload
+    def getpeercert(
+        self, binary_form: typing.Literal[False] = ...
+    ) -> _TYPE_PEER_CERT_RET_DICT | None: ...
+
+    @typing.overload
+    def getpeercert(self, binary_form: typing.Literal[True]) -> bytes | None: ...
+
+    def getpeercert(self, binary_form: bool = False) -> _TYPE_PEER_CERT_RET:
+        return self.sslobj.getpeercert(binary_form)  # type: ignore[return-value]
+
+    def version(self) -> str | None:
+        return self.sslobj.version()
+
+    def cipher(self) -> tuple[str, str, int] | None:
+        return self.sslobj.cipher()
+
+    def selected_alpn_protocol(self) -> str | None:
+        return self.sslobj.selected_alpn_protocol()
+
+    def shared_ciphers(self) -> list[tuple[str, str, int]] | None:
+        return self.sslobj.shared_ciphers()
+
+    def compression(self) -> str | None:
+        return self.sslobj.compression()
+
+    def settimeout(self, value: float | None) -> None:
+        self.socket.settimeout(value)
+
+    def gettimeout(self) -> float | None:
+        return self.socket.gettimeout()
+
+    def _decref_socketios(self) -> None:
+        self.socket._decref_socketios()  # type: ignore[attr-defined]
+
+    def _wrap_ssl_read(self, len: int, buffer: bytearray | None = None) -> int | bytes:
+        try:
+            return self._ssl_io_loop(self.sslobj.read, len, buffer)
+        except ssl.SSLError as e:
+            if e.errno == ssl.SSL_ERROR_EOF and self.suppress_ragged_eofs:
+                return 0  # eof, return 0.
+            else:
+                raise
+
+    # func is sslobj.do_handshake or sslobj.unwrap
+    @typing.overload
+    def _ssl_io_loop(self, func: typing.Callable[[], None]) -> None: ...
+
+    # func is sslobj.write, arg1 is data
+    @typing.overload
+    def _ssl_io_loop(self, func: typing.Callable[[bytes], int], arg1: bytes) -> int: ...
+
+    # func is sslobj.read, arg1 is len, arg2 is buffer
+    @typing.overload
+    def _ssl_io_loop(
+        self,
+        func: typing.Callable[[int, bytearray | None], bytes],
+        arg1: int,
+        arg2: bytearray | None,
+    ) -> bytes: ...
+
+    def _ssl_io_loop(
+        self,
+        func: typing.Callable[..., _ReturnValue],
+        arg1: None | bytes | int = None,
+        arg2: bytearray | None = None,
+    ) -> _ReturnValue:
+        """Performs an I/O loop between incoming/outgoing and the socket."""
+        should_loop = True
+        ret = None
+
+        while should_loop:
+            errno = None
+            try:
+                if arg1 is None and arg2 is None:
+                    ret = func()
+                elif arg2 is None:
+                    ret = func(arg1)
+                else:
+                    ret = func(arg1, arg2)
+            except ssl.SSLError as e:
+                if e.errno not in (ssl.SSL_ERROR_WANT_READ, ssl.SSL_ERROR_WANT_WRITE):
+                    # WANT_READ, and WANT_WRITE are expected, others are not.
+                    raise e
+                errno = e.errno
+
+            buf = self.outgoing.read()
+            self.socket.sendall(buf)
+
+            if errno is None:
+                should_loop = False
+            elif errno == ssl.SSL_ERROR_WANT_READ:
+                buf = self.socket.recv(SSL_BLOCKSIZE)
+                if buf:
+                    self.incoming.write(buf)
+                else:
+                    self.incoming.write_eof()
+        return typing.cast(_ReturnValue, ret)

Scripts/reporter_lib/py38+/urllib3/util/timeout.py

@@ -0,0 +1,275 @@
+from __future__ import annotations
+
+import time
+import typing
+from enum import Enum
+from socket import getdefaulttimeout
+
+from ..exceptions import TimeoutStateError
+
+if typing.TYPE_CHECKING:
+    from typing import Final
+
+
+class _TYPE_DEFAULT(Enum):
+    # This value should never be passed to socket.settimeout() so for safety we use a -1.
+    # socket.settimout() raises a ValueError for negative values.
+    token = -1
+
+
+_DEFAULT_TIMEOUT: Final[_TYPE_DEFAULT] = _TYPE_DEFAULT.token
+
+_TYPE_TIMEOUT = typing.Optional[typing.Union[float, _TYPE_DEFAULT]]
+
+
+class Timeout:
+    """Timeout configuration.
+
+    Timeouts can be defined as a default for a pool:
+
+    .. code-block:: python
+
+        import urllib3
+
+        timeout = urllib3.util.Timeout(connect=2.0, read=7.0)
+
+        http = urllib3.PoolManager(timeout=timeout)
+
+        resp = http.request("GET", "https://example.com/")
+
+        print(resp.status)
+
+    Or per-request (which overrides the default for the pool):
+
+    .. code-block:: python
+
+       response = http.request("GET", "https://example.com/", timeout=Timeout(10))
+
+    Timeouts can be disabled by setting all the parameters to ``None``:
+
+    .. code-block:: python
+
+       no_timeout = Timeout(connect=None, read=None)
+       response = http.request("GET", "https://example.com/", timeout=no_timeout)
+
+
+    :param total:
+        This combines the connect and read timeouts into one; the read timeout
+        will be set to the time leftover from the connect attempt. In the
+        event that both a connect timeout and a total are specified, or a read
+        timeout and a total are specified, the shorter timeout will be applied.
+
+        Defaults to None.
+
+    :type total: int, float, or None
+
+    :param connect:
+        The maximum amount of time (in seconds) to wait for a connection
+        attempt to a server to succeed. Omitting the parameter will default the
+        connect timeout to the system default, probably `the global default
+        timeout in socket.py
+        <http://hg.python.org/cpython/file/603b4d593758/Lib/socket.py#l535>`_.
+        None will set an infinite timeout for connection attempts.
+
+    :type connect: int, float, or None
+
+    :param read:
+        The maximum amount of time (in seconds) to wait between consecutive
+        read operations for a response from the server. Omitting the parameter
+        will default the read timeout to the system default, probably `the
+        global default timeout in socket.py
+        <http://hg.python.org/cpython/file/603b4d593758/Lib/socket.py#l535>`_.
+        None will set an infinite timeout.
+
+    :type read: int, float, or None
+
+    .. note::
+
+        Many factors can affect the total amount of time for urllib3 to return
+        an HTTP response.
+
+        For example, Python's DNS resolver does not obey the timeout specified
+        on the socket. Other factors that can affect total request time include
+        high CPU load, high swap, the program running at a low priority level,
+        or other behaviors.
+
+        In addition, the read and total timeouts only measure the time between
+        read operations on the socket connecting the client and the server,
+        not the total amount of time for the request to return a complete
+        response. For most requests, the timeout is raised because the server
+        has not sent the first byte in the specified time. This is not always
+        the case; if a server streams one byte every fifteen seconds, a timeout
+        of 20 seconds will not trigger, even though the request will take
+        several minutes to complete.
+    """
+
+    #: A sentinel object representing the default timeout value
+    DEFAULT_TIMEOUT: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT
+
+    def __init__(
+        self,
+        total: _TYPE_TIMEOUT = None,
+        connect: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
+        read: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
+    ) -> None:
+        self._connect = self._validate_timeout(connect, "connect")
+        self._read = self._validate_timeout(read, "read")
+        self.total = self._validate_timeout(total, "total")
+        self._start_connect: float | None = None
+
+    def __repr__(self) -> str:
+        return f"{type(self).__name__}(connect={self._connect!r}, read={self._read!r}, total={self.total!r})"
+
+    # __str__ provided for backwards compatibility
+    __str__ = __repr__
+
+    @staticmethod
+    def resolve_default_timeout(timeout: _TYPE_TIMEOUT) -> float | None:
+        return getdefaulttimeout() if timeout is _DEFAULT_TIMEOUT else timeout
+
+    @classmethod
+    def _validate_timeout(cls, value: _TYPE_TIMEOUT, name: str) -> _TYPE_TIMEOUT:
+        """Check that a timeout attribute is valid.
+
+        :param value: The timeout value to validate
+        :param name: The name of the timeout attribute to validate. This is
+            used to specify in error messages.
+        :return: The validated and casted version of the given value.
+        :raises ValueError: If it is a numeric value less than or equal to
+            zero, or the type is not an integer, float, or None.
+        """
+        if value is None or value is _DEFAULT_TIMEOUT:
+            return value
+
+        if isinstance(value, bool):
+            raise ValueError(
+                "Timeout cannot be a boolean value. It must "
+                "be an int, float or None."
+            )
+        try:
+            float(value)
+        except (TypeError, ValueError):
+            raise ValueError(
+                "Timeout value %s was %s, but it must be an "
+                "int, float or None." % (name, value)
+            ) from None
+
+        try:
+            if value <= 0:
+                raise ValueError(
+                    "Attempted to set %s timeout to %s, but the "
+                    "timeout cannot be set to a value less "
+                    "than or equal to 0." % (name, value)
+                )
+        except TypeError:
+            raise ValueError(
+                "Timeout value %s was %s, but it must be an "
+                "int, float or None." % (name, value)
+            ) from None
+
+        return value
+
+    @classmethod
+    def from_float(cls, timeout: _TYPE_TIMEOUT) -> Timeout:
+        """Create a new Timeout from a legacy timeout value.
+
+        The timeout value used by httplib.py sets the same timeout on the
+        connect(), and recv() socket requests. This creates a :class:`Timeout`
+        object that sets the individual timeouts to the ``timeout`` value
+        passed to this function.
+
+        :param timeout: The legacy timeout value.
+        :type timeout: integer, float, :attr:`urllib3.util.Timeout.DEFAULT_TIMEOUT`, or None
+        :return: Timeout object
+        :rtype: :class:`Timeout`
+        """
+        return Timeout(read=timeout, connect=timeout)
+
+    def clone(self) -> Timeout:
+        """Create a copy of the timeout object
+
+        Timeout properties are stored per-pool but each request needs a fresh
+        Timeout object to ensure each one has its own start/stop configured.
+
+        :return: a copy of the timeout object
+        :rtype: :class:`Timeout`
+        """
+        # We can't use copy.deepcopy because that will also create a new object
+        # for _GLOBAL_DEFAULT_TIMEOUT, which socket.py uses as a sentinel to
+        # detect the user default.
+        return Timeout(connect=self._connect, read=self._read, total=self.total)
+
+    def start_connect(self) -> float:
+        """Start the timeout clock, used during a connect() attempt
+
+        :raises urllib3.exceptions.TimeoutStateError: if you attempt
+            to start a timer that has been started already.
+        """
+        if self._start_connect is not None:
+            raise TimeoutStateError("Timeout timer has already been started.")
+        self._start_connect = time.monotonic()
+        return self._start_connect
+
+    def get_connect_duration(self) -> float:
+        """Gets the time elapsed since the call to :meth:`start_connect`.
+
+        :return: Elapsed time in seconds.
+        :rtype: float
+        :raises urllib3.exceptions.TimeoutStateError: if you attempt
+            to get duration for a timer that hasn't been started.
+        """
+        if self._start_connect is None:
+            raise TimeoutStateError(
+                "Can't get connect duration for timer that has not started."
+            )
+        return time.monotonic() - self._start_connect
+
+    @property
+    def connect_timeout(self) -> _TYPE_TIMEOUT:
+        """Get the value to use when setting a connection timeout.
+
+        This will be a positive float or integer, the value None
+        (never timeout), or the default system timeout.
+
+        :return: Connect timeout.
+        :rtype: int, float, :attr:`Timeout.DEFAULT_TIMEOUT` or None
+        """
+        if self.total is None:
+            return self._connect
+
+        if self._connect is None or self._connect is _DEFAULT_TIMEOUT:
+            return self.total
+
+        return min(self._connect, self.total)  # type: ignore[type-var]
+
+    @property
+    def read_timeout(self) -> float | None:
+        """Get the value for the read timeout.
+
+        This assumes some time has elapsed in the connection timeout and
+        computes the read timeout appropriately.
+
+        If self.total is set, the read timeout is dependent on the amount of
+        time taken by the connect timeout. If the connection time has not been
+        established, a :exc:`~urllib3.exceptions.TimeoutStateError` will be
+        raised.
+
+        :return: Value to use for the read timeout.
+        :rtype: int, float or None
+        :raises urllib3.exceptions.TimeoutStateError: If :meth:`start_connect`
+            has not yet been called on this object.
+        """
+        if (
+            self.total is not None
+            and self.total is not _DEFAULT_TIMEOUT
+            and self._read is not None
+            and self._read is not _DEFAULT_TIMEOUT
+        ):
+            # In case the connect timeout has not yet been established.
+            if self._start_connect is None:
+                return self._read
+            return max(0, min(self.total - self.get_connect_duration(), self._read))
+        elif self.total is not None and self.total is not _DEFAULT_TIMEOUT:
+            return max(0, self.total - self.get_connect_duration())
+        else:
+            return self.resolve_default_timeout(self._read)

Scripts/reporter_lib/py38+/urllib3/util/url.py

@@ -0,0 +1,469 @@
+from __future__ import annotations
+
+import re
+import typing
+
+from ..exceptions import LocationParseError
+from .util import to_str
+
+# We only want to normalize urls with an HTTP(S) scheme.
+# urllib3 infers URLs without a scheme (None) to be http.
+_NORMALIZABLE_SCHEMES = ("http", "https", None)
+
+# Almost all of these patterns were derived from the
+# 'rfc3986' module: https://github.com/python-hyper/rfc3986
+_PERCENT_RE = re.compile(r"%[a-fA-F0-9]{2}")
+_SCHEME_RE = re.compile(r"^(?:[a-zA-Z][a-zA-Z0-9+-]*:|/)")
+_URI_RE = re.compile(
+    r"^(?:([a-zA-Z][a-zA-Z0-9+.-]*):)?"
+    r"(?://([^\\/?#]*))?"
+    r"([^?#]*)"
+    r"(?:\?([^#]*))?"
+    r"(?:#(.*))?$",
+    re.UNICODE | re.DOTALL,
+)
+
+_IPV4_PAT = r"(?:[0-9]{1,3}\.){3}[0-9]{1,3}"
+_HEX_PAT = "[0-9A-Fa-f]{1,4}"
+_LS32_PAT = "(?:{hex}:{hex}|{ipv4})".format(hex=_HEX_PAT, ipv4=_IPV4_PAT)
+_subs = {"hex": _HEX_PAT, "ls32": _LS32_PAT}
+_variations = [
+    #                            6( h16 ":" ) ls32
+    "(?:%(hex)s:){6}%(ls32)s",
+    #                       "::" 5( h16 ":" ) ls32
+    "::(?:%(hex)s:){5}%(ls32)s",
+    # [               h16 ] "::" 4( h16 ":" ) ls32
+    "(?:%(hex)s)?::(?:%(hex)s:){4}%(ls32)s",
+    # [ *1( h16 ":" ) h16 ] "::" 3( h16 ":" ) ls32
+    "(?:(?:%(hex)s:)?%(hex)s)?::(?:%(hex)s:){3}%(ls32)s",
+    # [ *2( h16 ":" ) h16 ] "::" 2( h16 ":" ) ls32
+    "(?:(?:%(hex)s:){0,2}%(hex)s)?::(?:%(hex)s:){2}%(ls32)s",
+    # [ *3( h16 ":" ) h16 ] "::"    h16 ":"   ls32
+    "(?:(?:%(hex)s:){0,3}%(hex)s)?::%(hex)s:%(ls32)s",
+    # [ *4( h16 ":" ) h16 ] "::"              ls32
+    "(?:(?:%(hex)s:){0,4}%(hex)s)?::%(ls32)s",
+    # [ *5( h16 ":" ) h16 ] "::"              h16
+    "(?:(?:%(hex)s:){0,5}%(hex)s)?::%(hex)s",
+    # [ *6( h16 ":" ) h16 ] "::"
+    "(?:(?:%(hex)s:){0,6}%(hex)s)?::",
+]
+
+_UNRESERVED_PAT = r"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789._\-~"
+_IPV6_PAT = "(?:" + "|".join([x % _subs for x in _variations]) + ")"
+_ZONE_ID_PAT = "(?:%25|%)(?:[" + _UNRESERVED_PAT + "]|%[a-fA-F0-9]{2})+"
+_IPV6_ADDRZ_PAT = r"\[" + _IPV6_PAT + r"(?:" + _ZONE_ID_PAT + r")?\]"
+_REG_NAME_PAT = r"(?:[^\[\]%:/?#]|%[a-fA-F0-9]{2})*"
+_TARGET_RE = re.compile(r"^(/[^?#]*)(?:\?([^#]*))?(?:#.*)?$")
+
+_IPV4_RE = re.compile("^" + _IPV4_PAT + "$")
+_IPV6_RE = re.compile("^" + _IPV6_PAT + "$")
+_IPV6_ADDRZ_RE = re.compile("^" + _IPV6_ADDRZ_PAT + "$")
+_BRACELESS_IPV6_ADDRZ_RE = re.compile("^" + _IPV6_ADDRZ_PAT[2:-2] + "$")
+_ZONE_ID_RE = re.compile("(" + _ZONE_ID_PAT + r")\]$")
+
+_HOST_PORT_PAT = ("^(%s|%s|%s)(?::0*?(|0|[1-9][0-9]{0,4}))?$") % (
+    _REG_NAME_PAT,
+    _IPV4_PAT,
+    _IPV6_ADDRZ_PAT,
+)
+_HOST_PORT_RE = re.compile(_HOST_PORT_PAT, re.UNICODE | re.DOTALL)
+
+_UNRESERVED_CHARS = set(
+    "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789._-~"
+)
+_SUB_DELIM_CHARS = set("!$&'()*+,;=")
+_USERINFO_CHARS = _UNRESERVED_CHARS | _SUB_DELIM_CHARS | {":"}
+_PATH_CHARS = _USERINFO_CHARS | {"@", "/"}
+_QUERY_CHARS = _FRAGMENT_CHARS = _PATH_CHARS | {"?"}
+
+
+class Url(
+    typing.NamedTuple(
+        "Url",
+        [
+            ("scheme", typing.Optional[str]),
+            ("auth", typing.Optional[str]),
+            ("host", typing.Optional[str]),
+            ("port", typing.Optional[int]),
+            ("path", typing.Optional[str]),
+            ("query", typing.Optional[str]),
+            ("fragment", typing.Optional[str]),
+        ],
+    )
+):
+    """
+    Data structure for representing an HTTP URL. Used as a return value for
+    :func:`parse_url`. Both the scheme and host are normalized as they are
+    both case-insensitive according to RFC 3986.
+    """
+
+    def __new__(  # type: ignore[no-untyped-def]
+        cls,
+        scheme: str | None = None,
+        auth: str | None = None,
+        host: str | None = None,
+        port: int | None = None,
+        path: str | None = None,
+        query: str | None = None,
+        fragment: str | None = None,
+    ):
+        if path and not path.startswith("/"):
+            path = "/" + path
+        if scheme is not None:
+            scheme = scheme.lower()
+        return super().__new__(cls, scheme, auth, host, port, path, query, fragment)
+
+    @property
+    def hostname(self) -> str | None:
+        """For backwards-compatibility with urlparse. We're nice like that."""
+        return self.host
+
+    @property
+    def request_uri(self) -> str:
+        """Absolute path including the query string."""
+        uri = self.path or "/"
+
+        if self.query is not None:
+            uri += "?" + self.query
+
+        return uri
+
+    @property
+    def authority(self) -> str | None:
+        """
+        Authority component as defined in RFC 3986 3.2.
+        This includes userinfo (auth), host and port.
+
+        i.e.
+            userinfo@host:port
+        """
+        userinfo = self.auth
+        netloc = self.netloc
+        if netloc is None or userinfo is None:
+            return netloc
+        else:
+            return f"{userinfo}@{netloc}"
+
+    @property
+    def netloc(self) -> str | None:
+        """
+        Network location including host and port.
+
+        If you need the equivalent of urllib.parse's ``netloc``,
+        use the ``authority`` property instead.
+        """
+        if self.host is None:
+            return None
+        if self.port:
+            return f"{self.host}:{self.port}"
+        return self.host
+
+    @property
+    def url(self) -> str:
+        """
+        Convert self into a url
+
+        This function should more or less round-trip with :func:`.parse_url`. The
+        returned url may not be exactly the same as the url inputted to
+        :func:`.parse_url`, but it should be equivalent by the RFC (e.g., urls
+        with a blank port will have : removed).
+
+        Example:
+
+        .. code-block:: python
+
+            import urllib3
+
+            U = urllib3.util.parse_url("https://google.com/mail/")
+
+            print(U.url)
+            # "https://google.com/mail/"
+
+            print( urllib3.util.Url("https", "username:password",
+                                    "host.com", 80, "/path", "query", "fragment"
+                                    ).url
+                )
+            # "https://username:password@host.com:80/path?query#fragment"
+        """
+        scheme, auth, host, port, path, query, fragment = self
+        url = ""
+
+        # We use "is not None" we want things to happen with empty strings (or 0 port)
+        if scheme is not None:
+            url += scheme + "://"
+        if auth is not None:
+            url += auth + "@"
+        if host is not None:
+            url += host
+        if port is not None:
+            url += ":" + str(port)
+        if path is not None:
+            url += path
+        if query is not None:
+            url += "?" + query
+        if fragment is not None:
+            url += "#" + fragment
+
+        return url
+
+    def __str__(self) -> str:
+        return self.url
+
+
+@typing.overload
+def _encode_invalid_chars(
+    component: str, allowed_chars: typing.Container[str]
+) -> str:  # Abstract
+    ...
+
+
+@typing.overload
+def _encode_invalid_chars(
+    component: None, allowed_chars: typing.Container[str]
+) -> None:  # Abstract
+    ...
+
+
+def _encode_invalid_chars(
+    component: str | None, allowed_chars: typing.Container[str]
+) -> str | None:
+    """Percent-encodes a URI component without reapplying
+    onto an already percent-encoded component.
+    """
+    if component is None:
+        return component
+
+    component = to_str(component)
+
+    # Normalize existing percent-encoded bytes.
+    # Try to see if the component we're encoding is already percent-encoded
+    # so we can skip all '%' characters but still encode all others.
+    component, percent_encodings = _PERCENT_RE.subn(
+        lambda match: match.group(0).upper(), component
+    )
+
+    uri_bytes = component.encode("utf-8", "surrogatepass")
+    is_percent_encoded = percent_encodings == uri_bytes.count(b"%")
+    encoded_component = bytearray()
+
+    for i in range(0, len(uri_bytes)):
+        # Will return a single character bytestring
+        byte = uri_bytes[i : i + 1]
+        byte_ord = ord(byte)
+        if (is_percent_encoded and byte == b"%") or (
+            byte_ord < 128 and byte.decode() in allowed_chars
+        ):
+            encoded_component += byte
+            continue
+        encoded_component.extend(b"%" + (hex(byte_ord)[2:].encode().zfill(2).upper()))
+
+    return encoded_component.decode()
+
+
+def _remove_path_dot_segments(path: str) -> str:
+    # See http://tools.ietf.org/html/rfc3986#section-5.2.4 for pseudo-code
+    segments = path.split("/")  # Turn the path into a list of segments
+    output = []  # Initialize the variable to use to store output
+
+    for segment in segments:
+        # '.' is the current directory, so ignore it, it is superfluous
+        if segment == ".":
+            continue
+        # Anything other than '..', should be appended to the output
+        if segment != "..":
+            output.append(segment)
+        # In this case segment == '..', if we can, we should pop the last
+        # element
+        elif output:
+            output.pop()
+
+    # If the path starts with '/' and the output is empty or the first string
+    # is non-empty
+    if path.startswith("/") and (not output or output[0]):
+        output.insert(0, "")
+
+    # If the path starts with '/.' or '/..' ensure we add one more empty
+    # string to add a trailing '/'
+    if path.endswith(("/.", "/..")):
+        output.append("")
+
+    return "/".join(output)
+
+
+@typing.overload
+def _normalize_host(host: None, scheme: str | None) -> None: ...
+
+
+@typing.overload
+def _normalize_host(host: str, scheme: str | None) -> str: ...
+
+
+def _normalize_host(host: str | None, scheme: str | None) -> str | None:
+    if host:
+        if scheme in _NORMALIZABLE_SCHEMES:
+            is_ipv6 = _IPV6_ADDRZ_RE.match(host)
+            if is_ipv6:
+                # IPv6 hosts of the form 'a::b%zone' are encoded in a URL as
+                # such per RFC 6874: 'a::b%25zone'. Unquote the ZoneID
+                # separator as necessary to return a valid RFC 4007 scoped IP.
+                match = _ZONE_ID_RE.search(host)
+                if match:
+                    start, end = match.span(1)
+                    zone_id = host[start:end]
+
+                    if zone_id.startswith("%25") and zone_id != "%25":
+                        zone_id = zone_id[3:]
+                    else:
+                        zone_id = zone_id[1:]
+                    zone_id = _encode_invalid_chars(zone_id, _UNRESERVED_CHARS)
+                    return f"{host[:start].lower()}%{zone_id}{host[end:]}"
+                else:
+                    return host.lower()
+            elif not _IPV4_RE.match(host):
+                return to_str(
+                    b".".join([_idna_encode(label) for label in host.split(".")]),
+                    "ascii",
+                )
+    return host
+
+
+def _idna_encode(name: str) -> bytes:
+    if not name.isascii():
+        try:
+            import idna
+        except ImportError:
+            raise LocationParseError(
+                "Unable to parse URL without the 'idna' module"
+            ) from None
+
+        try:
+            return idna.encode(name.lower(), strict=True, std3_rules=True)
+        except idna.IDNAError:
+            raise LocationParseError(
+                f"Name '{name}' is not a valid IDNA label"
+            ) from None
+
+    return name.lower().encode("ascii")
+
+
+def _encode_target(target: str) -> str:
+    """Percent-encodes a request target so that there are no invalid characters
+
+    Pre-condition for this function is that 'target' must start with '/'.
+    If that is the case then _TARGET_RE will always produce a match.
+    """
+    match = _TARGET_RE.match(target)
+    if not match:  # Defensive:
+        raise LocationParseError(f"{target!r} is not a valid request URI")
+
+    path, query = match.groups()
+    encoded_target = _encode_invalid_chars(path, _PATH_CHARS)
+    if query is not None:
+        query = _encode_invalid_chars(query, _QUERY_CHARS)
+        encoded_target += "?" + query
+    return encoded_target
+
+
+def parse_url(url: str) -> Url:
+    """
+    Given a url, return a parsed :class:`.Url` namedtuple. Best-effort is
+    performed to parse incomplete urls. Fields not provided will be None.
+    This parser is RFC 3986 and RFC 6874 compliant.
+
+    The parser logic and helper functions are based heavily on
+    work done in the ``rfc3986`` module.
+
+    :param str url: URL to parse into a :class:`.Url` namedtuple.
+
+    Partly backwards-compatible with :mod:`urllib.parse`.
+
+    Example:
+
+    .. code-block:: python
+
+        import urllib3
+
+        print( urllib3.util.parse_url('http://google.com/mail/'))
+        # Url(scheme='http', host='google.com', port=None, path='/mail/', ...)
+
+        print( urllib3.util.parse_url('google.com:80'))
+        # Url(scheme=None, host='google.com', port=80, path=None, ...)
+
+        print( urllib3.util.parse_url('/foo?bar'))
+        # Url(scheme=None, host=None, port=None, path='/foo', query='bar', ...)
+    """
+    if not url:
+        # Empty
+        return Url()
+
+    source_url = url
+    if not _SCHEME_RE.search(url):
+        url = "//" + url
+
+    scheme: str | None
+    authority: str | None
+    auth: str | None
+    host: str | None
+    port: str | None
+    port_int: int | None
+    path: str | None
+    query: str | None
+    fragment: str | None
+
+    try:
+        scheme, authority, path, query, fragment = _URI_RE.match(url).groups()  # type: ignore[union-attr]
+        normalize_uri = scheme is None or scheme.lower() in _NORMALIZABLE_SCHEMES
+
+        if scheme:
+            scheme = scheme.lower()
+
+        if authority:
+            auth, _, host_port = authority.rpartition("@")
+            auth = auth or None
+            host, port = _HOST_PORT_RE.match(host_port).groups()  # type: ignore[union-attr]
+            if auth and normalize_uri:
+                auth = _encode_invalid_chars(auth, _USERINFO_CHARS)
+            if port == "":
+                port = None
+        else:
+            auth, host, port = None, None, None
+
+        if port is not None:
+            port_int = int(port)
+            if not (0 <= port_int <= 65535):
+                raise LocationParseError(url)
+        else:
+            port_int = None
+
+        host = _normalize_host(host, scheme)
+
+        if normalize_uri and path:
+            path = _remove_path_dot_segments(path)
+            path = _encode_invalid_chars(path, _PATH_CHARS)
+        if normalize_uri and query:
+            query = _encode_invalid_chars(query, _QUERY_CHARS)
+        if normalize_uri and fragment:
+            fragment = _encode_invalid_chars(fragment, _FRAGMENT_CHARS)
+
+    except (ValueError, AttributeError) as e:
+        raise LocationParseError(source_url) from e
+
+    # For the sake of backwards compatibility we put empty
+    # string values for path if there are any defined values
+    # beyond the path in the URL.
+    # TODO: Remove this when we break backwards compatibility.
+    if not path:
+        if query is not None or fragment is not None:
+            path = ""
+        else:
+            path = None
+
+    return Url(
+        scheme=scheme,
+        auth=auth,
+        host=host,
+        port=port_int,
+        path=path,
+        query=query,
+        fragment=fragment,
+    )

Scripts/reporter_lib/py38+/urllib3/util/util.py

@@ -0,0 +1,42 @@
+from __future__ import annotations
+
+import typing
+from types import TracebackType
+
+
+def to_bytes(
+    x: str | bytes, encoding: str | None = None, errors: str | None = None
+) -> bytes:
+    if isinstance(x, bytes):
+        return x
+    elif not isinstance(x, str):
+        raise TypeError(f"not expecting type {type(x).__name__}")
+    if encoding or errors:
+        return x.encode(encoding or "utf-8", errors=errors or "strict")
+    return x.encode()
+
+
+def to_str(
+    x: str | bytes, encoding: str | None = None, errors: str | None = None
+) -> str:
+    if isinstance(x, str):
+        return x
+    elif not isinstance(x, bytes):
+        raise TypeError(f"not expecting type {type(x).__name__}")
+    if encoding or errors:
+        return x.decode(encoding or "utf-8", errors=errors or "strict")
+    return x.decode()
+
+
+def reraise(
+    tp: type[BaseException] | None,
+    value: BaseException,
+    tb: TracebackType | None = None,
+) -> typing.NoReturn:
+    try:
+        if value.__traceback__ is not tb:
+            raise value.with_traceback(tb)
+        raise value
+    finally:
+        value = None  # type: ignore[assignment]
+        tb = None

Scripts/reporter_lib/py38+/urllib3/util/wait.py

@@ -0,0 +1,124 @@
+from __future__ import annotations
+
+import select
+import socket
+from functools import partial
+
+__all__ = ["wait_for_read", "wait_for_write"]
+
+
+# How should we wait on sockets?
+#
+# There are two types of APIs you can use for waiting on sockets: the fancy
+# modern stateful APIs like epoll/kqueue, and the older stateless APIs like
+# select/poll. The stateful APIs are more efficient when you have a lots of
+# sockets to keep track of, because you can set them up once and then use them
+# lots of times. But we only ever want to wait on a single socket at a time
+# and don't want to keep track of state, so the stateless APIs are actually
+# more efficient. So we want to use select() or poll().
+#
+# Now, how do we choose between select() and poll()? On traditional Unixes,
+# select() has a strange calling convention that makes it slow, or fail
+# altogether, for high-numbered file descriptors. The point of poll() is to fix
+# that, so on Unixes, we prefer poll().
+#
+# On Windows, there is no poll() (or at least Python doesn't provide a wrapper
+# for it), but that's OK, because on Windows, select() doesn't have this
+# strange calling convention; plain select() works fine.
+#
+# So: on Windows we use select(), and everywhere else we use poll(). We also
+# fall back to select() in case poll() is somehow broken or missing.
+
+
+def select_wait_for_socket(
+    sock: socket.socket,
+    read: bool = False,
+    write: bool = False,
+    timeout: float | None = None,
+) -> bool:
+    if not read and not write:
+        raise RuntimeError("must specify at least one of read=True, write=True")
+    rcheck = []
+    wcheck = []
+    if read:
+        rcheck.append(sock)
+    if write:
+        wcheck.append(sock)
+    # When doing a non-blocking connect, most systems signal success by
+    # marking the socket writable. Windows, though, signals success by marked
+    # it as "exceptional". We paper over the difference by checking the write
+    # sockets for both conditions. (The stdlib selectors module does the same
+    # thing.)
+    fn = partial(select.select, rcheck, wcheck, wcheck)
+    rready, wready, xready = fn(timeout)
+    return bool(rready or wready or xready)
+
+
+def poll_wait_for_socket(
+    sock: socket.socket,
+    read: bool = False,
+    write: bool = False,
+    timeout: float | None = None,
+) -> bool:
+    if not read and not write:
+        raise RuntimeError("must specify at least one of read=True, write=True")
+    mask = 0
+    if read:
+        mask |= select.POLLIN
+    if write:
+        mask |= select.POLLOUT
+    poll_obj = select.poll()
+    poll_obj.register(sock, mask)
+
+    # For some reason, poll() takes timeout in milliseconds
+    def do_poll(t: float | None) -> list[tuple[int, int]]:
+        if t is not None:
+            t *= 1000
+        return poll_obj.poll(t)
+
+    return bool(do_poll(timeout))
+
+
+def _have_working_poll() -> bool:
+    # Apparently some systems have a select.poll that fails as soon as you try
+    # to use it, either due to strange configuration or broken monkeypatching
+    # from libraries like eventlet/greenlet.
+    try:
+        poll_obj = select.poll()
+        poll_obj.poll(0)
+    except (AttributeError, OSError):
+        return False
+    else:
+        return True
+
+
+def wait_for_socket(
+    sock: socket.socket,
+    read: bool = False,
+    write: bool = False,
+    timeout: float | None = None,
+) -> bool:
+    # We delay choosing which implementation to use until the first time we're
+    # called. We could do it at import time, but then we might make the wrong
+    # decision if someone goes wild with monkeypatching select.poll after
+    # we're imported.
+    global wait_for_socket
+    if _have_working_poll():
+        wait_for_socket = poll_wait_for_socket
+    elif hasattr(select, "select"):
+        wait_for_socket = select_wait_for_socket
+    return wait_for_socket(sock, read, write, timeout)
+
+
+def wait_for_read(sock: socket.socket, timeout: float | None = None) -> bool:
+    """Waits for reading to be available on a given socket.
+    Returns True if the socket is readable, or False if the timeout expired.
+    """
+    return wait_for_socket(sock, read=True, timeout=timeout)
+
+
+def wait_for_write(sock: socket.socket, timeout: float | None = None) -> bool:
+    """Waits for writing to be available on a given socket.
+    Returns True if the socket is readable, or False if the timeout expired.
+    """
+    return wait_for_socket(sock, write=True, timeout=timeout)